body {
    font-family: 'DM Sans', "interface", Helvetica, Arial, -apple-system, sans-serif;
    font-size: 14px;
    line-height: 24px;
    color: #000;
    text-rendering: optimizeLegibility;
    -webkit-font-smoothing: antialiased;
    -moz-osx-font-smoothing: grayscale;
    overflow-x: hidden;
}

label {
    font-weight: normal;
}

a {
    color: inherit;
    text-decoration: none;
}

a:hover,
a:focus,
a:active {
    text-decoration: none;
    outline: none;
    color: #222222;
}

p a,
.news_ul ul li a {
    color: #000;
    text-decoration: none;
}

img {
    max-width: 100%;
    height: auto;
}

ul,
ol {
    margin: 0;
    padding-left: 17px;
}

ul ul,
ul ol,
ol ol,
ol ul {
    padding-left: 17px;
}

h1,
h2,
h3,
h4,
h5,
h6 {
    line-height: 1.428;
    font-weight: normal;
    color: #363636;
    margin-top: 0;
}

h1 {
    font-size: 36px;
}

h2 {
    font-size: 30px;
}

h3 {
    font-size: 24px;
}

h4 {
    font-size: 20px;
}

h5 {
    font-size: 18px;
}

h6 {
    font-size: 16px;
}

p {
    margin-bottom: 20px;
}

blockquote,
q {
    font-weight: 500;
    display: inline-block;
    border-left: none;
    color: #333;
    font-size: 16px;
    line-height: 26px;
    border-bottom: 1px solid #f2f2f2;
    border-top: 1px solid #f2f2f2;
    padding: 20px 0;
    margin-top: 10px;
    margin-bottom: 38px;
}

blockquote p,
q p {
    font-style: italic;
    font-size: 14px;
}

blockquote::before {
    content: url('../img/demo/quote-item.png');
    display: block;
}

.screen-reader-text {
    clip: rect(1px, 1px, 1px, 1px);
    clip-path: polygon(0px 0px, 0px 0px, 0px 0px, 0px 0px);
    position: absolute !important;
    white-space: nowrap;
    height: 1px;
    width: 1px;
    overflow: hidden;
}

.button,
button,
input[type="submit"] {
    display: inline-block;
    padding: 9px 16px;
    color: #fff;
    border: none;
    text-align: center;
    font-size: 13px;
    font-weight: 700;
    -webkit-transition: all 0.4s ease 0s;
    -moz-transition: all 0.4s ease 0s;
    -o-transition: all 0.4s ease 0s;
    transition: all 0.4s ease 0s;
    border-radius: 0;
    text-transform: capitalize;
}

input[type="text"]:focus,
input[type="number"]:focus,
input[type="search"]:focus,
input[type="email"]:focus,
input[type="password"]:focus,
input[type="tel"]:focus,
input[type="url"]:focus,
textarea:focus,
button:focus,
select:focus {
    outline: none;
    border-color: #5d9d23 !important;
}

:focus {
    outline: none;
}

::-webkit-input-placeholder {
    text-align: inherit;
    color: inherit;
    opacity: 1;
    filter: alpha(opacity=100);
}

:-moz-placeholder {
    text-align: inherit;
    color: inherit;
    opacity: 1;
    filter: alpha(opacity=100);
}

::-moz-placeholder {
    text-align: inherit;
    color: inherit;
    opacity: 1;
    filter: alpha(opacity=100);
}

:-ms-input-placeholder {
    text-align: inherit;
    color: inherit;
    opacity: 1;
    filter: alpha(opacity=100);
}

.return-message {
    line-height: 20px;
    padding: 10px 30px;
    margin-top: 15px;
}

table {
    /* border: 1px solid #f3f3f3; */
    border-collapse: collapse;
    border-spacing: 0;
    table-layout: auto;
    width: 100%;
    margin-bottom: 20px;
}

table thead {
    background-color: #f8f8f8;
}

th,
td {
    /* border: 1px solid #f3f3f3; */
    padding: 10px;
    font-weight: normal;
}

table tr th:last-child,
table tr td:last-child {
    border-right: 0;
}

table tr:last-child td,
table tr:last-child th {
    border-bottom: none;
}

@media (min-width: 1500px) {
    .auto-clear .col-bg-1:nth-child(12n+1) {
        clear: left;
    }

    .auto-clear .col-bg-2:nth-child(6n+1) {
        clear: left;
    }

    .auto-clear .col-bg-15:nth-child(5n+1) {
        clear: left;
    }

    .auto-clear .col-bg-3:nth-child(4n+1) {
        clear: left;
    }

    .auto-clear .col-bg-4:nth-child(3n+1) {
        clear: left;
    }

    .auto-clear .col-bg-6:nth-child(odd) {
        clear: left;
    }
}

@media (min-width: 1200px) and (max-width: 1499px) {
    .auto-clear .col-lg-1:nth-child(12n+1) {
        clear: left;
    }

    .auto-clear .col-lg-2:nth-child(6n+1) {
        clear: left;
    }

    .auto-clear .col-lg-15:nth-child(5n+1) {
        clear: left;
    }

    .auto-clear .col-lg-3:nth-child(4n+1) {
        clear: left;
    }

    .auto-clear .col-lg-4:nth-child(3n+1) {
        clear: left;
    }

    .auto-clear .col-lg-6:nth-child(odd) {
        clear: left;
    }
}

@media (min-width: 992px) and (max-width: 1199px) {
    .auto-clear .col-md-1:nth-child(12n+1) {
        clear: left;
    }

    .auto-clear .col-md-2:nth-child(6n+1) {
        clear: left;
    }

    .auto-clear .col-md-15:nth-child(5n+1) {
        clear: left;
    }

    .auto-clear .col-md-3:nth-child(4n+1) {
        clear: left;
    }

    .auto-clear .col-md-4:nth-child(3n+1) {
        clear: left;
    }

    .auto-clear .col-md-6:nth-child(odd) {
        clear: left;
    }
}

@media (min-width: 768px) and (max-width: 991px) {
    .auto-clear .col-sm-1:nth-child(12n+1) {
        clear: left;
    }

    .auto-clear .col-sm-2:nth-child(6n+1) {
        clear: left;
    }

    .auto-clear .col-sm-15:nth-child(5n+1) {
        clear: left;
    }

    .auto-clear .col-sm-3:nth-child(4n+1) {
        clear: left;
    }

    .auto-clear .col-sm-4:nth-child(3n+1) {
        clear: left;
    }

    .auto-clear .col-sm-6:nth-child(odd) {
        clear: left;
    }
}

@media (min-width: 480px) and (max-width: 767px) {
    .auto-clear .col-xs-1:nth-child(12n+1) {
        clear: left;
    }

    .auto-clear .col-xs-2:nth-child(6n+1) {
        clear: left;
    }

    .auto-clear .col-xs-15:nth-child(5n+1) {
        clear: left;
    }

    .auto-clear .col-xs-3:nth-child(4n+1) {
        clear: left;
    }

    .auto-clear .col-xs-4:nth-child(3n+1) {
        clear: left;
    }

    .auto-clear .col-xs-6:nth-child(odd) {
        clear: left;
    }
}

@media (max-width: 479px) {
    .auto-clear .col-ts-1:nth-child(12n+1) {
        clear: left;
    }

    .auto-clear .col-ts-2:nth-child(6n+1) {
        clear: left;
    }

    .auto-clear .col-ts-15:nth-child(5n+1) {
        clear: left;
    }

    .auto-clear .col-ts-3:nth-child(4n+1) {
        clear: left;
    }

    .auto-clear .col-ts-4:nth-child(3n+1) {
        clear: left;
    }

    .auto-clear .col-ts-6:nth-child(odd) {
        clear: left;
    }
}

@media (min-width: 1500px) {

    .col-bg-1,
    .col-bg-10,
    .col-bg-11,
    .col-bg-12,
    .col-bg-2,
    .col-bg-3,
    .col-bg-4,
    .col-bg-5,
    .col-bg-6,
    .col-bg-7,
    .col-bg-8,
    .col-bg-9 {
        position: relative;
        min-height: 1px;
        padding-right: 15px;
        padding-left: 15px
    }

    .col-bg-1,
    .col-bg-2,
    .col-bg-3,
    .col-bg-4,
    .col-bg-5,
    .col-bg-6,
    .col-bg-7,
    .col-bg-8,
    .col-bg-9,
    .col-bg-10,
    .col-bg-11 {
        float: left;
    }

    .col-bg-12 {
        width: 100%;
    }

    .col-bg-11 {
        width: 91.66666667%;
    }

    .col-bg-10 {
        width: 83.33333333%;
    }

    .col-bg-9 {
        width: 75%;
    }

    .col-bg-8 {
        width: 66.66666667%;
    }

    .col-bg-7 {
        width: 58.33333333%;
    }

    .col-bg-6 {
        width: 50%;
    }

    .col-bg-5 {
        width: 41.66666667%;
    }

    .col-bg-4 {
        width: 33.33333333%;
    }

    .col-bg-3 {
        width: 25%;
    }

    .col-bg-2 {
        width: 16.66666667%;
    }

    .col-bg-1 {
        width: 8.33333333%;
    }
}

@media (max-width: 480px) {

    .col-ts-1,
    .col-ts-10,
    .col-ts-11,
    .col-ts-12,
    .col-ts-2,
    .col-ts-3,
    .col-ts-4,
    .col-ts-5,
    .col-ts-6,
    .col-ts-7,
    .col-ts-8,
    .col-ts-9 {
        position: relative;
        min-height: 1px;
        padding-right: 15px;
        padding-left: 15px;
    }

    .col-ts-1,
    .col-ts-2,
    .col-ts-3,
    .col-ts-4,
    .col-ts-5,
    .col-ts-6,
    .col-ts-7,
    .col-ts-8,
    .col-ts-9,
    .col-ts-10,
    .col-ts-11 {
        float: left;
    }

    .col-ts-12 {
        width: 100%;
    }

    .col-ts-11 {
        width: 91.66666667%;
    }

    .col-ts-10 {
        width: 83.33333333%;
    }

    .col-ts-9 {
        width: 75%;
    }

    .col-ts-8 {
        width: 66.66666667%;
    }

    .col-ts-7 {
        width: 58.33333333%;
    }

    .col-ts-6 {
        width: 50%;
    }

    .col-ts-5 {
        width: 41.66666667%;
    }

    .col-ts-4 {
        width: 33.33333333%;
    }

    .col-ts-3 {
        width: 25%;
    }

    .col-ts-2 {
        width: 16.66666667%;
    }

    .col-ts-1 {
        width: 8.33333333%;
    }

    .col-ts-pull-12 {
        right: 100%;
    }

    .col-ts-pull-11 {
        right: 91.66666667%;
    }

    .col-ts-pull-10 {
        right: 83.33333333%;
    }

    .col-ts-pull-9 {
        right: 75%;
    }

    .col-ts-pull-8 {
        right: 66.66666667%;
    }

    .col-ts-pull-7 {
        right: 58.33333333%;
    }

    .col-ts-pull-6 {
        right: 50%;
    }

    .col-ts-pull-5 {
        right: 41.66666667%;
    }

    .col-ts-pull-4 {
        right: 33.33333333%;
    }

    .col-ts-pull-3 {
        right: 25%;
    }

    .col-ts-pull-2 {
        right: 16.66666667%;
    }

    .col-ts-pull-1 {
        right: 8.33333333%;
    }

    .col-ts-pull-0 {
        right: auto;
    }

    .col-ts-push-12 {
        left: 100%;
    }

    .col-ts-push-11 {
        left: 91.66666667%;
    }

    .col-ts-push-10 {
        left: 83.33333333%;
    }

    .col-ts-push-9 {
        left: 75%;
    }

    .col-ts-push-8 {
        left: 66.66666667%;
    }

    .col-ts-push-7 {
        left: 58.33333333%;
    }

    .col-ts-push-6 {
        left: 50%;
    }

    .col-ts-push-5 {
        left: 41.66666667%;
    }

    .col-ts-push-4 {
        left: 33.33333333%;
    }

    .col-ts-push-3 {
        left: 25%;
    }

    .col-ts-push-2 {
        left: 16.66666667%;
    }

    .col-ts-push-1 {
        left: 8.33333333%;
    }

    .col-ts-push-0 {
        left: auto;
    }

    .col-ts-offset-12 {
        margin-left: 100%;
    }

    .col-ts-offset-11 {
        margin-left: 91.66666667%;
    }

    .col-ts-offset-10 {
        margin-left: 83.33333333%;
    }

    .col-ts-offset-9 {
        margin-left: 75%;
    }

    .col-ts-offset-8 {
        margin-left: 66.66666667%;
    }

    .col-ts-offset-7 {
        margin-left: 58.33333333%;
    }

    .col-ts-offset-6 {
        margin-left: 50%;
    }

    .col-ts-offset-5 {
        margin-left: 41.66666667%;
    }

    .col-ts-offset-4 {
        margin-left: 33.33333333%;
    }

    .col-ts-offset-3 {
        margin-left: 25%;
    }

    .col-ts-offset-2 {
        margin-left: 16.66666667%;
    }

    .col-ts-offset-1 {
        margin-left: 8.33333333%;
    }

    .col-ts-offset-0 {
        margin-left: 0;
    }

    .hidden-ts {
        display: none;
    }
}

.col-bg-15,
.col-bg-45,
.col-lg-15,
.col-lg-45,
.col-md-15,
.col-md-45,
.col-sm-15,
.col-sm-45,
.col-xs-15,
.col-xs-45,
.col-ts-15,
.col-ts-45 {
    position: relative;
    min-height: 1px;
    padding-right: 15px;
    padding-left: 15px
}

.col-ts-15,
.col-ts-45 {
    float: left;
}

.col-ts-15 {
    width: 20%;
}

.col-ts-45 {
    width: 80%;
}

@media (min-width: 480px) {

    .col-xs-15,
    .col-xs-45 {
        float: left;
    }

    .col-xs-15 {
        width: 20%;
    }

    .col-xs-45 {
        width: 80%;
    }
}

@media (min-width: 768px) {

    .col-sm-15,
    .col-sm-45 {
        float: left;
    }

    .col-sm-15 {
        width: 20%;
    }

    .col-sm-45 {
        width: 80%;
    }
}

@media (min-width: 992px) {

    .col-md-15,
    .col-md-45 {
        float: left;
    }

    .col-md-15 {
        width: 20%;
    }

    .col-md-45 {
        width: 80%;
    }
}

@media (min-width: 1200px) {

    .col-lg-15,
    .col-lg-45 {
        float: left;
    }

    .col-lg-15 {
        width: 20%;
    }

    .col-lg-45 {
        width: 80%;
    }
}

@media (min-width: 1500px) {

    .col-bg-15,
    .col-bg-45 {
        float: left;
    }

    .col-bg-15 {
        width: 20%;
    }

    .col-bg-45 {
        width: 80%;
    }
}

.rows-space-0 {
    margin-bottom: 0;
}

.rows-space-5 {
    margin-bottom: 5px;
}

.rows-space-10 {
    margin-bottom: 10px;
}

.rows-space-15 {
    margin-bottom: 15px;
}

.rows-space-20 {
    margin-bottom: 20px;
}

.rows-space-25 {
    margin-bottom: 25px;
}

.rows-space-30 {
    margin-bottom: 30px;
}

.rows-space-35 {
    margin-bottom: 35px;
}

.rows-space-40 {
    margin-bottom: 40px;
}

.rows-space-45 {
    margin-bottom: 45px;
}

.rows-space-50 {
    margin-bottom: 50px;
}

.rows-space-55 {
    margin-bottom: 55px;
}

.rows-space-60 {
    margin-bottom: 60px;
}

.rows-space-65 {
    margin-bottom: 65px;
}

.rows-space-70 {
    margin-bottom: 70px;
}

.rows-space-75 {
    margin-bottom: 75px;
}

.rows-space-80 {
    margin-bottom: 80px;
}

.rows-space-85 {
    margin-bottom: 85px;
}

.rows-space-90 {
    margin-bottom: 90px;
}

.rows-space-85 {
    margin-bottom: 85px;
}

.rows-space-100 {
    margin-bottom: 100px;
}

.row10 {
    margin-left: -10px;
    margin-right: -10px;
}

.row10::before,
.row10::after {
    display: table;
    content: "";
}

.row10::after {
    clear: both;
}

.no-padding {
    padding-left: 0 !important;
    padding-right: 0 !important;
}

@media (min-width: 1200px) {

    .auto-clear .vc_col-lg-1:nth-child(12n+1),
    .auto-clear .vc_col-lg-2:nth-child(6n+1),
    .auto-clear .vc_col-lg-15:nth-child(5n+1),
    .auto-clear .vc_col-lg-3:nth-child(4n+1),
    .auto-clear .vc_col-lg-4:nth-child(3n+1),
    .auto-clear .vc_col-lg-6:nth-child(odd) {
        clear: both;
    }
}

@media (min-width: 1500px) {

    .auto-clear .col-bg-1:nth-child(12n+1),
    .auto-clear .col-bg-2:nth-child(6n+1),
    .auto-clear .col-bg-15:nth-child(5n+1),
    .auto-clear .col-bg-3:nth-child(4n+1),
    .auto-clear .col-bg-4:nth-child(3n+1),
    .auto-clear .col-bg-6:nth-child(odd) {
        clear: both;
    }
}

@media (min-width: 1200px) and (max-width: 1499px) {

    .auto-clear .col-lg-1:nth-child(12n+1),
    .auto-clear .col-lg-2:nth-child(6n+1),
    .auto-clear .col-lg-15:nth-child(5n+1),
    .auto-clear .col-lg-3:nth-child(4n+1),
    .auto-clear .col-lg-4:nth-child(3n+1),
    .auto-clear .col-lg-6:nth-child(odd) {
        clear: both;
    }
}

@media (min-width: 992px) and (max-width: 1199px) {

    .auto-clear .vc_col-md-1:nth-child(12n+1),
    .auto-clear .vc_col-md-2:nth-child(6n+1),
    .auto-clear .vc_col-md-15:nth-child(5n+1),
    .auto-clear .vc_col-md-3:nth-child(4n+1),
    .auto-clear .vc_col-md-4:nth-child(3n+1),
    .auto-clear .vc_col-md-6:nth-child(odd),
    .auto-clear .col-md-1:nth-child(12n+1),
    .auto-clear .col-md-2:nth-child(6n+1),
    .auto-clear .col-md-15:nth-child(5n+1),
    .auto-clear .col-md-3:nth-child(4n+1),
    .auto-clear .col-md-4:nth-child(3n+1),
    .auto-clear .col-md-6:nth-child(odd) {
        clear: both;
    }
}

@media (min-width: 768px) and (max-width: 991px) {

    .auto-clear .vc_col-sm-1:nth-child(12n+1),
    .auto-clear .vc_col-sm-2:nth-child(6n+1),
    .auto-clear .vc_col-sm-15:nth-child(5n+1),
    .auto-clear .vc_col-sm-3:nth-child(4n+1),
    .auto-clear .vc_col-sm-4:nth-child(3n+1),
    .auto-clear .vc_col-sm-6:nth-child(odd),
    .auto-clear .col-sm-1:nth-child(12n+1),
    .auto-clear .col-sm-2:nth-child(6n+1),
    .auto-clear .col-sm-15:nth-child(5n+1),
    .auto-clear .col-sm-3:nth-child(4n+1),
    .auto-clear .col-sm-4:nth-child(3n+1),
    .auto-clear .col-sm-6:nth-child(odd) {
        clear: both;
    }
}

@media (min-width: 480px) and (max-width: 767px) {

    .auto-clear .col-xs-1:nth-child(12n+1),
    .auto-clear .col-xs-2:nth-child(6n+1),
    .auto-clear .col-xs-15:nth-child(5n+1),
    .auto-clear .col-xs-3:nth-child(4n+1),
    .auto-clear .col-xs-4:nth-child(3n+1),
    .auto-clear .col-xs-6:nth-child(odd) {
        clear: both;
    }
}

@media (max-width: 479px) {

    .auto-clear .col-ts-1:nth-child(12n+1),
    .auto-clear .col-ts-2:nth-child(6n+1),
    .auto-clear .col-ts-15:nth-child(5n+1),
    .auto-clear .col-ts-3:nth-child(4n+1),
    .auto-clear .col-ts-4:nth-child(3n+1),
    .auto-clear .col-ts-6:nth-child(odd) {
        clear: both;
    }
}

@media (max-width: 767px) {

    .auto-clear .vc_col-xs-1:nth-child(12n+1),
    .auto-clear .vc_col-xs-2:nth-child(6n+1),
    .auto-clear .vc_col-xs-15:nth-child(5n+1),
    .auto-clear .vc_col-xs-3:nth-child(4n+1),
    .auto-clear .vc_col-xs-4:nth-child(3n+1),
    .auto-clear .vc_col-xs-6:nth-child(odd) {
        clear: both;
    }
}

@media (min-width: 1500px) {

    .col-bg-1,
    .col-bg-10,
    .col-bg-11,
    .col-bg-12,
    .col-bg-2,
    .col-bg-3,
    .col-bg-4,
    .col-bg-5,
    .col-bg-6,
    .col-bg-7,
    .col-bg-8,
    .col-bg-9 {
        position: relative;
        min-height: 1px;
        padding-right: 15px;
        padding-left: 15px
    }

    .col-bg-1,
    .col-bg-2,
    .col-bg-3,
    .col-bg-4,
    .col-bg-5,
    .col-bg-6,
    .col-bg-7,
    .col-bg-8,
    .col-bg-9,
    .col-bg-10,
    .col-bg-11 {
        float: left;
    }

    .col-bg-12 {
        width: 100%;
    }

    .col-bg-11 {
        width: 91.66666667%;
    }

    .col-bg-10 {
        width: 83.33333333%;
    }

    .col-bg-9 {
        width: 75%;
    }

    .col-bg-8 {
        width: 66.66666667%;
    }

    .col-bg-7 {
        width: 58.33333333%;
    }

    .col-bg-6 {
        width: 50%;
    }

    .col-bg-5 {
        width: 41.66666667%;
    }

    .col-bg-4 {
        width: 33.33333333%;
    }

    .col-bg-3 {
        width: 25%;
    }

    .col-bg-2 {
        width: 16.66666667%;
    }

    .col-bg-1 {
        width: 8.33333333%;
    }
}

@media (max-width: 479px) {

    .col-ts-1,
    .col-ts-10,
    .col-ts-11,
    .col-ts-12,
    .col-ts-2,
    .col-ts-3,
    .col-ts-4,
    .col-ts-5,
    .col-ts-6,
    .col-ts-7,
    .col-ts-8,
    .col-ts-9 {
        position: relative;
        min-height: 1px;
        padding-right: 15px;
        padding-left: 15px;
    }

    .col-ts-1,
    .col-ts-2,
    .col-ts-3,
    .col-ts-4,
    .col-ts-5,
    .col-ts-6,
    .col-ts-7,
    .col-ts-8,
    .col-ts-9,
    .col-ts-10,
    .col-ts-11 {
        float: left;
    }

    .col-ts-12 {
        width: 100%;
    }

    .col-ts-11 {
        width: 91.66666667%;
    }

    .col-ts-10 {
        width: 83.33333333%;
    }

    .col-ts-9 {
        width: 75%;
    }

    .col-ts-8 {
        width: 66.66666667%;
    }

    .col-ts-7 {
        width: 58.33333333%;
    }

    .col-ts-6 {
        width: 50%;
    }

    .col-ts-5 {
        width: 41.66666667%;
    }

    .col-ts-4 {
        width: 33.33333333%;
    }

    .col-ts-3 {
        width: 25%;
    }

    .col-ts-2 {
        width: 16.66666667%;
    }

    .col-ts-1 {
        width: 8.33333333%;
    }
}

.col-bg-15,
.col-bg-25,
.col-bg-35,
.col-bg-45,
.col-lg-15,
.col-lg-25,
.col-lg-35,
.col-lg-45,
.col-md-15,
.col-md-25,
.col-md-35,
.col-md-45,
.col-sm-15,
.col-sm-25,
.col-sm-35,
.col-sm-45,
.col-xs-15,
.col-xs-25,
.col-xs-35,
.col-xs-45,
.col-ts-15,
.col-ts-25,
.col-ts-35,
.col-ts-45 {
    position: relative;
    min-height: 1px;
    padding-right: 15px;
    padding-left: 15px
}

.col-ts-15,
.col-ts-25,
.col-ts-35,
.col-ts-45 {
    float: left;
}

.col-ts-15 {
    width: 20%;
}

.col-ts-25 {
    width: 40%;
}

.col-ts-35 {
    width: 60%;
}

.col-ts-45 {
    width: 80%;
}

@media (min-width: 480px) {

    .col-xs-15,
    .col-xs-25,
    .col-xs-35,
    .col-xs-45 {
        float: left;
    }

    .col-xs-15 {
        width: 20%;
    }

    .col-xs-25 {
        width: 40%;
    }

    .col-xs-35 {
        width: 60%;
    }

    .col-xs-45 {
        width: 80%;
    }
}

@media (min-width: 768px) {

    .col-sm-15,
    .col-sm-25,
    .col-sm-35,
    .col-sm-45 {
        float: left;
    }

    .col-sm-15 {
        width: 20%;
    }

    .col-sm-25 {
        width: 40%;
    }

    .col-sm-35 {
        width: 60%;
    }

    .col-sm-45 {
        width: 80%;
    }
}

@media (min-width: 992px) {

    .col-md-15,
    .col-md-25,
    .col-md-35,
    .col-md-45 {
        float: left;
    }

    .col-md-15 {
        width: 20%;
    }

    .col-md-25 {
        width: 40%;
    }

    .col-md-35 {
        width: 60%;
    }

    .col-md-45 {
        width: 80%;
    }
}

@media (min-width: 1200px) {

    .col-lg-15,
    .col-lg-25,
    .col-lg-35,
    .col-lg-45 {
        float: left;
    }

    .col-lg-15 {
        width: 20%;
    }

    .col-lg-25 {
        width: 40%;
    }

    .col-lg-35 {
        width: 60%;
    }

    .col-lg-45 {
        width: 80%;
    }
}

@media (min-width: 1500px) {

    .col-bg-15,
    .col-bg-25,
    .col-bg-35,
    .col-bg-45 {
        float: left;
    }

    .col-bg-15 {
        width: 20%;
    }

    .col-bg-25 {
        width: 40%;
    }

    .col-bg-35 {
        width: 60%;
    }

    .col-bg-45 {
        width: 80%;
    }
}

.slick-list {
    margin: 0 -15px;
    padding: 0;
}

.owl-slick .slick-list {
    margin-top: -5px !important;
    padding-top: 5px;
    margin-bottom: -5px !important;
    padding-bottom: 5px;
}

.slick-track {
    margin-left: 0;
}

.slick-slide {
    padding: 0 15px;
}

.slick-slider .slick-arrow {
    display: inline-block;
    position: absolute;
    top: -4px;
    right: 0;
    font-size: 24px;
    line-height: 1;
    color: #fff;
    background-color: #5d9d23;
    z-index: 1;
    cursor: pointer;
    border-radius: 50%;
}

.slick-slider .slick-arrow:first-child {
    right: 29px;
}

.slick-vertical .slick-slide {
    border: none;
}

.slick-slider.nav-center {
    position: relative !important;
}

.slick-slider.nav-center>.slick-arrow {
    top: 50%;
    transform: translateY(-50%);
    margin: 0;
    font-size: 30px;
    background-color: transparent;
    color: #aaaaaa;
}

.slick-slider.nav-center>.slick-arrow:hover {
    color: #222222;
}

.slick-slider.nav-center>.slick-arrow::before {
    font-family: FontAwesome, sans-serif;
    content: '\f105';
}

.slick-slider.nav-center>.slick-arrow:first-child {
    right: auto;
    left: 0;
}

.slick-slider.nav-center>.slick-arrow:first-child::before {
    content: '\f104';
}

.slick-slide>div:not([class])>* {
    display: block !important;
}

.slick-dots {
    list-style: none;
    padding: 0;
    margin-bottom: 0;
    text-align: center;
    margin-top: 40px;
}

.slick-dots li {
    list-style: none;
    display: inline-block;
    font-size: 0;
    padding: 0;
    width: 12px;
    height: 12px;
    border: 2px solid #acacac;
    border-radius: 50%;
    margin: 0 5px;
    cursor: pointer;
    -webkit-transition: all 0.25s ease 0s;
    -moz-transition: all 0.25s ease 0s;
    -o-transition: all 0.25s ease 0s;
    transition: all 0.25s ease 0s;
}

.slick-dots li.slick-active {
    border-color: transparent;
    background-color: #5d9d23;
}

.slick-dots li button {
    display: none;
}

.slick-dots .slick-slide img {
    cursor: pointer;
    margin: auto;
}

.slick-slider.nav-botton-center>.slick-arrow {
    top: auto;
    bottom: 0;
    right: 43.5%;
}

.chosen-container {
    vertical-align: top;
    font-size: inherit;
    line-height: inherit;
    text-align: left;
    width: auto !important;
}

.chosen-container-single .chosen-single {
    padding: 8px 17px;
    height: auto;
    border: 1px solid #eee;
    background: #f6f6f6;
    box-shadow: none;
    font-size: 14px;
    line-height: 24px;
    color: inherit;
    border-radius: 0;
}

.chosen-container-single .chosen-single div b {
    position: relative;
    background-image: none !important;
}

.chosen-container-single .chosen-single div b::after {
    content: "\f0d7";
    font-size: 14px;
    font-weight: normal;
    color: #aaaaaa;
    font-family: 'FontAwesome';
    position: absolute;
    left: 50%;
    top: 50%;
    line-height: normal;
    margin-left: -5px;
    margin-top: -8px;
}

.chosen-container-single .chosen-single span {
    vertical-align: top;
    margin-right: 17px;
}

.chosen-container-active.chosen-with-drop .chosen-single {
    border: 1px solid #eee;
    background: #f6f6f6;
    box-shadow: none;
}

.chosen-container-single .chosen-drop {
    top: calc(100% + 1px);
    left: -1px;
    clip: auto;
    border-radius: 0;
    border: 1px solid #eee;
    border-top: none;
    box-shadow: none;
    width: auto;
    min-width: 100%;
    white-space: nowrap;
    margin: 0;
    -webkit-transition: all 0.3s ease;
    -moz-transition: all 0.3s ease;
    -ms-transition: all 0.3s ease;
    -o-transition: all 0.3s ease;
    transition: all 0.3s ease;
}

.chosen-container:not(.chosen-with-drop) .chosen-drop {
    visibility: hidden;
    opacity: 0;
    -webkit-transform: translateY(20px);
    -moz-transform: translateY(20px);
    -ms-transform: translateY(20px);
    -o-transform: translateY(20px);
    transform: translateY(20px);
}



.chosen-container-single .chosen-results {
    color: #888;
    padding: 0;
    margin: 0;
}

.chosen-container .chosen-results li {
    font-size: 14px;
    line-height: 18px;
    padding: 6px 20px;
    text-transform: capitalize;
}

/* .chosen-container .chosen-results li.result-selected {
    background-color: #5d9d23;
} */

.chosen-container .chosen-results li.highlighted {
    background-image: none;
    color: inherit;
    background-color: #f6f6f6;
}

@media (min-width: 1200px) {
    .container {
        width: 1100px;
    }
}

.header .main-header {
    padding: 35px 0;
}

.social-header,
.header-language {
    display: inline-block;
    vertical-align: middle;
}

.social-header .socials {
    padding-top: 10px;
    overflow: hidden;
}

.social-header .social-item {
    font-size: 23px;
    line-height: 20px;
    display: inline-block;
    padding: 0 15px;
    color: #222;
    float: left;
}

.social-header .social-item:first-child {
    padding-left: 0;
}

.header-language .emeriss-language {
    padding-top: 10px;
    margin-left: 100px;
    position: relative;
}

.emeriss-language .language-toggle {
    color: #565656;
}

.emeriss-submenu {
    position: absolute;
    background-color: #fff;
    z-index: 10;
    -webkit-box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
    -moz-box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
    box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
    padding: 0;
    margin: 0;
    opacity: 0;
    visibility: hidden;
    -webkit-transition: .35s;
    -o-transition: .35s;
    transition: .35s;
    -webkit-transform: translateY(10px);
    -moz-transform: translateY(10px);
    -ms-transform: translateY(10px);
    -o-transform: translateY(10px);
    transform: translateY(10px);
    text-align: left;
}

.emeriss-dropdown.open .emeriss-submenu {
    opacity: 1;
    visibility: visible;
    -webkit-transform: translateY(0);
    -moz-transform: translateY(0);
    -ms-transform: translateY(0);
    -o-transform: translateY(0);
    transform: translateY(0);
    z-index: 1001;
}

.emeriss-dropdown .language-toggle:after {
    content: "\f107";
    font-family: 'FontAwesome';
    display: inline-block;
    margin-left: 5px;
    vertical-align: top;
}

.header-language .emeriss-submenu {
    margin: 15px 0 0;
    min-width: 105px;
    top: 100%;
    left: 0;
}

.header-language .emeriss-submenu li {
    list-style: none;
}

.header-language .emeriss-submenu>li>a {
    display: block;
    padding: 11px 20px;
    color: #565656;
}

.header-language .emeriss-submenu>li>a:hover {
    background: #f1f1f1;
}

.header .logo {
    text-align: center;
}

.header-control {
    text-align: right;
}

.header.style7 .header-control {
    margin-top: 10px;
}

.header-control .block-header {
    display: inline-block;
    position: relative;
    text-align: left;
    vertical-align: middle;
    padding-left: 20px;
}

.header-control .block-header:first-child {
    padding-left: 0;
}

.shopcart-description .content-wrap .title {
    font-size: 18px;
    color: #222;
    padding: 15px 20px;
    border-bottom: 1px solid #f1f1f1;
    margin: 0;
}

.shopcart-description .content-wrap ul {
    padding: 0 20px;
    margin: 0;
    overflow-y: auto;
    max-height: 250px;
}

.shopcart-description .content-wrap ul li {
    list-style: none;
    overflow: hidden;
    padding: 20px 0;
    border-bottom: 1px solid #f1f1f1;
}

.mini_cart_item .product-media {
    float: left;
    width: 80px;
}

.mini_cart_item .product-details {
    overflow: hidden;
    padding-left: 10px;
}

.mini_cart_item .product-name {
    font-size: 15px;
    color: #333;
    text-transform: capitalize;
    margin-bottom: 0;
}

.shopcart-description .subtotal {
    padding: 15px 20px;
    overflow: hidden;
}

.shopcart-description .actions {
    padding: 0 20px 30px;
}

.mini_cart_item .variations {
    font-size: 13px;
    color: #888888;
    margin-bottom: 0px;
}

.mini_cart_item .variations .attribute_color {
    text-transform: capitalize;
}

.mini_cart_item .variations .attribute_size {
    text-transform: uppercase;
}

.mini_cart_item .product-price {
    font-size: 16px;
    color: #111111;
}

.mini_cart_item .product-quantity {
    color: #888881;
    font-size: 16px;
}

.mini_cart_item .product-remove {
    display: inline-block;
    float: right;
    color: #ccc;
    font-size: 15px
}

.shopcart-description .subtotal .total-title {
    font-size: 14px;
    color: #333;
    font-weight: 700;
}

.shopcart-description .subtotal .total-price {
    font-size: 20px;
    color: #111;
    font-weight: 700;
}

.shopcart-description .actions .button-viewcart {
    width: 140px;
    background: transparent;
    color: #333;
    border: 1px solid #f1f1f1;
    padding: 7px 20px;
}

.shopcart-description .actions .button-viewcart:hover {
    color: #ffffff;
}

.shopcart-description .actions .button-checkout {
    width: 110px;
    float: right;
    color: #ffffff;
}

.minicart-items .mCSB_scrollTools {
    right: -5px;
}

.minicart-items .mCSB_scrollTools .mCSB_dragger .mCSB_dragger_bar {
    background: #222222;
}

.minicart-items .mCSB_scrollTools .mCSB_draggerRail {
    background: #aaaaaa;
}

.minicart-items .mCSB_inside>.mCSB_container {
    margin-right: 20px;
}

.block-minicart .shopcart-icon {
    font-size: 15px;
    color: #555555;
    position: relative;
    text-transform: uppercase;
    font-weight: 500;
    border: 2px solid #e9e9e9;
    padding: 0 15px;
    height: 43px;
    display: inline-block;
    line-height: 45px;
    width: 102px;
    border-radius: 0;
}



.block-minicart .shopcart-icon .count {
    position: absolute;
    display: inline-block;
    text-align: center;
    width: 22px;
    height: 22px;
    border-radius: 50%;
    top: -5px;
    right: -5px;
    color: #ffffff;
    font-size: 14px;
    line-height: 22px;
}

.header-control .block-header .emeriss-submenu {
    top: 100%;
    right: 0;
}

.block-minicart .emeriss-submenu {
    min-width: 300px;
    margin: 10px 0 0;
}

.block-minicart .no-product.emeriss-submenu {
    text-align: center;
    padding: 20px
}

.block-minicart .no-product .text {
    color: #888;
    font-weight: 700;
    margin-bottom: 0;
}

.block-minicart .no-product .text span {
    text-transform: uppercase;
}

.header-control .block-search {
    padding-left: 35px;
}

.block-search .icon-search::before {
    content: "\f12d";
    font-family: Flaticon;
    display: inline-block;
    vertical-align: middle;
}

.block-search .emeriss-submenu {
    min-width: 425px;
    margin-top: 17px;
}

.block-search .title-search {
    font-size: 18px;
    color: #222222;
    padding: 15px 20px;
    border-bottom: 1px solid #f1f1f1;
    margin: 0;
}

.form-search .form-content {
    padding: 30px 20px;
}

.form-search .form-content .inner {
    display: inline-block;
    width: 100%
}

.form-search .form-content .input {
    width: 261px;
    color: #888;
}

.form-search .form-content .btn-search {
    width: 110px;
    float: right;
}

.block-account>a {
    font-size: 26px;
    color: #555555;
}

.block-account .emeriss-submenu {
    min-width: 270px;
    margin-top: 17px;
}

.header-user-form-tabs .tab-link {
    padding: 15px 20px;
    margin: 0;
    border-bottom: 1px solid #f1f1f1;
}

.header-user-form-tabs .tab-link li {
    display: inline-block;
    list-style: none;
    padding-right: 15px;
    font-size: 16px;
    font-weight: 700;
    color: #aaaaaa;
    text-transform: capitalize;
}

.header-account form {
    padding: 15px 20px;
}

.header-account form .form-row-wide {
    margin-bottom: 10px;
}

.header-account form .input-text {
    width: 100%;
    color: #888;
    font-size: 13px;
}

.header-account .form-checkbox {
    display: block;
}

.form-checkbox .input-checkbox {
    display: none;
}

.form-checkbox span {
    position: relative;
    padding-left: 31px;
    cursor: pointer
}

.form-checkbox span::before {
    position: absolute;
    content: '';
    width: 21px;
    height: 21px;
    border: 1px solid #f1f1f1;
    left: 0px;
    top: -2px;
}

.form-checkbox input[type="checkbox"]:checked+span::after,
.form-checkbox:hover span::after {
    font-family: 'FontAwesome';
    content: "\f00c";
    display: inline-block;
    top: 2px;
    left: 6px;
    width: 10px;
    height: 12px;
    text-align: center;
    font-size: 10px;
    color: #444;
    position: absolute;
    z-index: 11;
    padding: 0;
    line-height: 14px;
}

.header-account .form-row .button {
    display: block;
    width: 100%;
}

.header-account .login .lost_password {
    font-size: 13px;
    color: #222222;
    font-weight: 700;
    margin-bottom: 10px
}

.main-menu .submenu {
    position: absolute;
    top: 100%;
    left: 0;
    background-color: #fff;
    min-width: 250px;
    z-index: 1001;
    -webkit-box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
    -moz-box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
    box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
    padding: 0;
    margin: 0;
    opacity: 0;
    visibility: hidden;
    -webkit-transition: .01s;
    -o-transition: .01s;
    transition: .01s;
    -webkit-transform: translateY(10px);
    -moz-transform: translateY(10px);
    -ms-transform: translateY(10px);
    -o-transform: translateY(10px);
    transform: translateY(10px);
}

.main-menu .menu-item:hover>.submenu {
    opacity: 1;
    visibility: visible;
    -webkit-transform: translateY(0);
    -moz-transform: translateY(0);
    -ms-transform: translateY(0);
    -o-transform: translateY(0);
    transform: translateY(0);
    transition-delay: 0.1s;
}
.main-menu .menu-item b{
    display: none;
    width: 100%;
    text-align: center;
    position: absolute;
    margin-top: -35px;
    font-size: 12px;
    font-weight: normal
}
.menu-item:hover b {
    display: block;
}


.header.style1 .header-nav,
.header.style10 .header-nav {
    border-top: 1px solid #f1f1f1;
}

.main-menu {
    display: table;
    padding: 0;
}

.main-menu li {
    list-style: none;
    position: relative;
}

.main-menu>li {
    display: inline-block;
}

.main-menu>li>a {
    font-size: 13px;
    padding: 18px 20px;
    display: inline-block;
    cursor: pointer;
    color: #fff;
    text-transform: uppercase;
    font-weight: 700;
    letter-spacing: 0.05em;
}

.main-menu>li.menu-item-has-children>a:after {
    font-family: 'FontAwesome';
    content: "\f107";
    margin-left: 5px;
    font-size: 15px;
    color: #fff;
    font-weight: normal;
    vertical-align: top;
}

.submenu.mega-menu {
    padding: 30px 20px;
}

.home-menu .home-item {
    padding: 0 10px;
}

.emeriss-demolink {
    text-align: center;
    margin-top: 30px;
}

.emeriss-demolink .image {
    position: relative;
    margin-bottom: 5px;
}

.emeriss-demolink .image::before {
    content: '';
    background-color: #000000;
    transition: all 0.9s ease-out 0s;
    -webkit-transition: all 0.9s ease-out 0s;
    -o-transition: all 0.9s ease-out 0s;
    -moz-transition: all 0.9s ease-out 0s;
    position: absolute;
    top: 0;
    left: 0;
    width: 100%;
    bottom: 0;
    opacity: 0;
    visibility: hidden;
    z-index: 100;
}

.emeriss-demolink .image:hover::before {
    opacity: 0.5;
    visibility: visible;
}

.emeriss-demolink .image a {
    position: absolute;
    top: 50%;
    left: 50%;
    transform: translate(-50%, -50%);
    padding: 10px 20px;
    background: #222222;
    color: #fff;
    font-weight: 700;
    font-size: 14px;
    opacity: 0;
    visibility: hidden;
    z-index: 1001;
    min-width: 134px;
}

.emeriss-demolink .image:hover a {
    opacity: 1;
    visibility: visible;
}

.emeriss-demolink .title {
    font-size: 16px;
    color: #222222;
    font-weight: 700;
    margin-bottom: 0;
}

.submenu.menu-page {
    padding: 50px 0 40px;
    background-color: #fff;
}

.emeriss-nav .mega-menu .menu-page-item:first-child .emeriss-custommenu {
    padding-left: 50px;
}

.emeriss-nav .mega-menu .menu-page-item:nth-child(2) .emeriss-custommenu {
    padding-left: 47px;
}

.emeriss-nav .mega-menu .menu-page-item:nth-child(3) .emeriss-custommenu {
    padding-left: 17px;
}

.emeriss-nav .mega-menu .menu-page-item:last-child .emeriss-custommenu {
    padding-right: 50px;
}

.emeriss-nav .mega-menu .emeriss-custommenu {
    margin-bottom: 30px;
}

.mega-menu .emeriss-custommenu .widgettitle {
    font-size: 18px;
    color: #222222;
    font-weight: 700;
    margin-bottom: 15px;
    position: relative;
    padding-bottom: 10px;
}

.mega-menu .emeriss-custommenu .widgettitle::before {
    content: '';
    position: absolute;
    left: 0;
    bottom: 0;
    width: 30px;
}

.mega-menu .emeriss-custommenu ul {
    padding: 0;
    margin: 0;
}

.mega-menu .emeriss-custommenu ul li {
    font-size: 14px;
    line-height: 32px;
    color: #212121;
    white-space: nowrap;
    display: block;
    overflow: hidden;
    text-overflow: ellipsis;
}

.mega-menu .emeriss-custommenu ul li a {
    line-height: 28px;
    font-weight: bold;
}

.main-menu .submenu .submenu {
    left: 100%;
    top: 0;
}

.main-menu .submenu>li>a {
    display: block;
    padding: 11px 20px;
    color: #212121;
}

.main-menu .submenu>li:hover>a,
.main-menu .submenu>li.active>a {
    background-color: #fff;
}

.main-menu .submenu>li.menu-item-has-children>a:after {
    font-family: 'FontAwesome';
    content: "\f105";
    float: right;
}

.main-content.main-content-inlookbook {
    padding-bottom: 0;
}

.main-content.mansory {
    padding-bottom: 120px;
}

.home-01 .main-content {
    padding-bottom: 0;
}

.home-03 .main-content {
    padding-bottom: 55px;
}

.home-05 .main-content {
    padding-bottom: 0;
}

.home-08 .main-content {
    padding-bottom: 0;
}

.left-sidebar .content-area {
    float: right;
}

.no-sidebar .sidebar {
    display: none;
}

.no-sidebar .content-area {
    width: 100% !important;
}

.content-blog .custom_blog_title {
    margin-top: -8px;
}

.main-content-blog.right-sidebar .content-blog::after {
    right: -15px;
}

.main-content-blog.left-sidebar .content-blog::after {
    left: -15px;
}

.main-content-blog.no-sidebar .content-blog::after {
    display: none;
}

.custom_blog_title {
    margin-bottom: 13px;
    font-size: 20px;
    letter-spacing: 0;
    font-weight: 700;
    color: #222;
    font-family: "Segoe UI", "Fira Sans", "Droid Sans", "Helvetica Neue", "Source Sans Pro", sans-serif;
    display: inline-block;
}

.blog-articles>.custom_blog_title,
.comments-area>.custom_blog_title {
    font-size: 18px;
}

.category-blog {
    font-size: 12px;
    color: #aaa;
    text-transform: uppercase;
    margin-bottom: 10px;
    margin-top: 15px;
    font-weight: 500;
}

.post-item .post-format {
    position: relative;
    overflow: hidden;
}

.post-title {
    font-family: "Segoe UI", "Fira Sans", "Droid Sans", "Helvetica Neue", "Source Sans Pro", sans-serif;
}

.post-item .post-title {
    font-size: 26px;
    color: #333;
    margin-bottom: 20px;
    font-weight: 500;
}

.post-item .post-title a:not(:hover) {
    color: inherit;
}

blockquote .author .name {
    display: block;
    color: #222;
}

blockquote .author .desc {
    display: block;
    color: #aaa;
    font-size: 13px;
    line-height: 1.1;
    font-weight: normal;
}

.blog-articles {
    position: relative;
}

.blog-articles .owl-slick {
    position: static;
}

.blog-articles .owl-slick .slick-arrow {
    position: absolute;
    top: -5px;
    right: 0;
    font-size: 24px;
    border: 1px solid #eeeeee;
    width: 37px;
    height: 35px;
    line-height: 31px;
    color: #aaa;
    text-align: center;
    cursor: pointer;
    background-color: #ffffff;
}

.blog-articles .owl-slick .fa-angle-left {
    margin-right: 47px;
}

.blog-articles .owl-slick .slick-arrow:hover {
    color: #222;
}

.owl-slick.blog-slider .slick-list {
    margin: 0 !important;
    padding: 0 !important;
}

.blog-slider.style-1 .blog-item {
    width: 570px;
    margin: 0 15px;
    padding: 0
}

.blog-item {
    overflow: hidden;
    border: 1px solid #f4f4f4;
}

.blog-item .post-format {
    float: left;
}

.blog-item .post-info {
    padding: 0 0 0 30px;
    overflow: hidden;
    position: relative;
}

.blog-item .category-blog {
    margin-top: 20px;
}

.blog-item .post-title {
    font-size: 18px;
    color: #333;
    font-weight: 500;
}

.blog-item .main-info-post p {
    margin-bottom: 15px;
}

.blog-item .post-title a span {
    color: #aaa;
    display: none;
}

.author-view .author,
.author-view .review {
    display: inline-block;
    vertical-align: middle;
}

.author-view .avt {
    display: inline-block;
    float: left;
}

.author-view .avt img {
    display: inline-block;
    width: 31px;
    height: 28px;
    border-radius: 50%;
    text-align: center;
}

.author-view .name {
    display: inline-block;
    overflow: hidden;
    padding: 6px 0;
    font-size: 14px;
    color: #333;
    padding-left: 5px;
    margin: 0;
    font-weight: 500;
}

.author-view .review {
    padding: 3px 0;
    color: #aaa;
    display: none;
}

.review .view,
.review .s-comments {
    display: inline-block;
    cursor: pointer;
}

.review .icon-cmt {
    margin-left: 10px;
}

.main-info-post {
    margin-bottom: 20px;
}

.emeriss-blog-item .main-info-post {
    margin-bottom: 0;
}

.emeriss-blog-item .main-info-post p {
    margin-bottom: 10px;
}

.emeriss-blog-item .readmore {
    display: inline-block;
    text-transform: uppercase;
    letter-spacing: 0.1em;
    font-weight: 700;
    position: relative;
    padding-bottom: 3px;
    font-size: 11px;
    color: #000;
    overflow: hidden;
}

@-webkit-keyframes underline-link {
    0% {
        -webkit-transform: translateX(0);
        transform: translateX(0)
    }

    50% {
        -webkit-transform: translateX(100%);
        transform: translateX(100%)
    }

    50.01% {
        -webkit-transform: translateX(-100%);
        transform: translateX(-100%)
    }

    to {
        -webkit-transform: translateX(0);
        transform: translateX(0)
    }
}

@keyframes underline-link {
    0% {
        -webkit-transform: translateX(0);
        transform: translateX(0)
    }

    50% {
        -webkit-transform: translateX(100%);
        transform: translateX(100%)
    }

    50.01% {
        -webkit-transform: translateX(-100%);
        transform: translateX(-100%)
    }

    to {
        -webkit-transform: translateX(0);
        transform: translateX(0)
    }
}

.emeriss-blog-item .readmore:hover::before {
    -webkit-animation: underline-link .8s cubic-bezier(.58, .3, .005, 1) 0s 1;
    animation: underline-link .8s cubic-bezier(.58, .3, .005, 1) 0s 1;
}

.blog-articles>.main-info-post {
    margin-top: 40px;
    margin-bottom: 45px;
}

.main-info-post p:last-child {
    margin-bottom: 0;
}

.tags-blog {
    margin-bottom: 15px;
}

.tags .widgettitle {
    font-size: 16px;
    color: #666;
    display: inline-block;
    padding-right: 10px;
}

.tagcloud {
    display: inline-block;
    padding: 0;
    list-style: none;
    margin-left: 0;
}

.tag-cloud-link {
    display: inline-block;
    padding: 0 12px;
    border: 1px solid #ececec;
    height: 28px;
    line-height: 24px;
    text-align: center;
    margin-right: 5px;
    font-weight: 500;
    margin-bottom: 10px;
    font-size: 13px;
    border-radius: 0;
}

.tag-cloud-link a {
    color: #888888;
}

.view-share {
    display: block;
    padding-top: 20px;
    border-top: 1px solid #f4f4f4;
    border-bottom: 1px solid #f4f4f4;
    padding-bottom: 13px;
    margin-bottom: 50px;
}

.view-share .author-view .author {
    float: none;
}

.view-share .author-view,
.view-share .share {
    display: inline-block;
    vertical-align: middle;
}

.author-view .author {
    float: left;
    margin-right: 20px;
}

.view-share .share {
    float: right;
    padding: 6px 0;
}

.share .title {
    display: inline-block;
    font-size: 16px;
    color: #666;
    padding-right: 5px;
    margin: 0;
}

.share .icon {
    font-size: 16px;
    padding: 0 10px;
    color: #222;
    cursor: pointer;
}

.comments-area {
    margin-bottom: 75px;
}

.comment-form {
    border: 1px solid #F1F1F1;
    padding-top: 30px;
    margin-bottom: 50px;
}

.comment-form .comment-reply-content {
    padding: 0 30px;
}

.comment-form .input-form {
    border: none;
    padding-left: 0;
    padding-right: 0;
    width: 100%;
    border-radius: 0;
    min-width: 100%;
}

.comment-form .form-submit {
    border-top: 1px solid #F1F1F1;
    padding: 20px 30px;
    margin: 0;
    overflow: hidden
}

.comment-form .form-submit .controll {
    display: block;
    float: right;
}

.comment-form .controll .icon {
    line-height: 43px;
    padding: 0 8px;
    font-size: 18px;
    color: #888;
}

.comment-form .controll .submit {
    margin-left: 20px;
}

.comments-area ul {
    padding: 0;
    margin: 0;
}

.comments-area ul li {
    list-style: none;
    border-bottom: 1px solid #e6e6e6;
    margin-bottom: 30px;
}

.comments-area ul li:last-child {
    border: none;
    margin-bottom: 0;
}

.comment-item .author-view {
    display: inline-block;
    width: 100%;
}

.date-reply-comment {
    display: inline-block;
    padding: 5px 0;
    padding-left: 0px;
    font-size: 14px;
    color: #aaa;
}

.comments-area .comment-reply-link {
    margin-bottom: 30px;
}

.comment-reply-link>* {
    display: inline-block;
    padding: 0 10px;
    font-size: 14px;
    color: #aaa;
}

.comment-reply-link .Comment {
    padding-left: 0;
}

.comments-area .comment-reply-link .icon {
    font-size: 18px;
}

.comments-area .comment .children {
    list-style: none;
    padding-left: 60px;
    padding-top: 50px;
    border-top: 1px solid #e6e6e6;
}

.blog-list .blog-item {
    margin-bottom: 30px;
}

.blog-list .blog-item .post-format {
    margin-top: -2px;
    margin-left: -2px;
    margin-bottom: -2px;
    position: relative;
    max-width: 50%;
}

.blog-list .blog-item .post-format img {
    width: 100%;
}

.blog-list .blog-item .post-format>a::before {
    content: "";
    position: absolute;
    left: 50%;
    right: 50%;
    top: 6px;
    bottom: 6px;
    z-index: 9;
    transition: all 0.5s;
    -o-transition: all 0.5s;
    -webkit-transition: all 0.5s;
    border-top: 4px solid rgba(255, 255, 255, 0.6);
    border-bottom: 4px solid rgba(255, 255, 255, 0.6);
}

.blog-list .blog-item .post-format:hover>a::before {
    left: 10px;
    right: 10px;
}

.blog-list .blog-item .post-format>a::after {
    content: "";
    position: absolute;
    top: 50%;
    bottom: 50%;
    left: 6px;
    right: 6px;
    z-index: 9;
    transition: all 0.5s;
    -o-transition: all 0.5s;
    -webkit-transition: all 0.5s;
    border-left: 4px solid rgba(255, 255, 255, 0.6);
    border-right: 4px solid rgba(255, 255, 255, 0.6);
}

.blog-list .blog-item .post-format:hover>a::after {
    top: 6px;
    bottom: 6px;
}

.masonry-grid .grid-sizer,
.masonry-grid .grid-item {
    width: 33.333333% !important;
    padding: 0 15px;
}

.masonry-grid .blog-item {
    margin-bottom: 42px;
    border: none;
}

.masonry-grid .blog-item .post-info {
    overflow: visible;
    padding: 0;
}

.blog-list.masonry-style .blog-item .post-format {
    margin: 0;
    float: none;
}

.masonry-grid .category-blog {
    margin-top: 13px;
    margin-bottom: 3px;
}

.customer_login .title-login {
    border: 1px solid #f1f1f1;
    margin: 0;
    border-bottom: 0;
    font-size: 18px;
    padding: 25px 40px;
    color: #222;
    font-weight: 500;
}

.customer_login .login,
.customer_login .register {
    border: 1px solid #f1f1f1;
    padding: 25px 40px;
}

.login .social-account {
    margin-bottom: 20px;
}

.social-account .title-social {
    color: #aaa;
    margin-bottom: 20px;
    font-family: inherit;
    letter-spacing: 0;
}

.social-account .mxh-item {
    font-size: 13px;
    font-weight: 500;
    color: #222;
    margin-right: 30px;
}

.social-account .icon {
    font-size: 23px;
    vertical-align: middle;
}

.social-account .text {
    vertical-align: middle;
    padding-left: 5px;
}

.customer_login .form-row-wide .text {
    margin-bottom: 5px;
    font-size: 14px;
    color: #222;
    font-weight: 500;
    text-transform: none;
    display: block;
}

.customer_login input[type="text"],
.customer_login input[type="email"],
.customer_login input[type="password"] {
    margin-bottom: 0;
    width: 100%;
    border-color: #f1f1f1;
}

.customer_login input[type="checkbox"] {
    display: none;
}

.customer_login .label-text {
    cursor: pointer;
    font-size: 14px;
    color: #888;
    margin: 0;
    padding-left: 25px;
    position: relative;
    font-weight: normal;
}

.customer_login input[type="checkbox"]:checked+label::before,
.customer_login .label-text:hover::before {
    font-family: 'FontAwesome';
    content: "\f00c";
    display: inline-block;
    top: 5px;
    left: 0;
    width: 20px;
    height: 20px;
    text-align: center;
    font-size: 14px;
    color: #222;
    position: absolute;
    z-index: 2;
    padding: 0;
    line-height: 14px;
}

.customer_login input[type="checkbox"]+label::after {
    position: absolute;
    z-index: 1;
    content: "";
    left: 0;
    top: 2px;
    width: 20px;
    height: 20px;
    border: solid 1px #eeeeee;
}

.customer_login .lost_password .forgot-pw {
    font-size: 14px;
    color: #222;
    font-weight: 500;
    float: right
}

.customer_login .label-text span {
    font-size: 14px;
    color: #222;
    font-weight: 500;
}

.customer_login .login-item:hover {
    box-shadow: 0 0 10px #ddd;
    z-index: 2;
    background-color: #fff;
    border-radius: 0;
}

.emeriss-countdown {
    text-align: center;
    font-family: 'Oswald', sans-serif;
}

.emeriss-countdown .box-count {
    display: inline-block;
    border: 2px solid #5d9d23;
    border-radius: 50%;
    background-color: #5d9d23;
    color: #fff;
    -webkit-box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.1);
    -moz-box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.1);
    box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.1);
    vertical-align: middle;
    text-align: center;
    overflow: hidden;
    padding: 9px 5px 9px;
    min-width: 49px;
    margin-right: -7px;
    margin-bottom: 7px;
}

.emeriss-countdown .box-count:last-child {
    margin-right: 0;
}

.emeriss-countdown .box-count span {
    display: block;
    text-align: center;
    line-height: 12px;
}

.emeriss-countdown .box-count .number {
    font-size: 12px;
    line-height: 12px;
    font-weight: 500;
    padding-bottom: 5px;
}

.emeriss-countdown .box-count .text {
    font-size: 12px;
    text-transform: capitalize;
    font-weight: 500;
}

.emeriss-iconbox.default {
    margin-bottom: 20px;
    padding: 50px 10px;
    background-color: #080a09;
    ;
    border-radius: 0;
}

.last-item .emeriss-iconbox.default {
    margin-bottom: 10px;
}

.emeriss-iconbox.default .iconbox-inner {
    display: table;
    vertical-align: middle;
    overflow: hidden;
    margin: 0 auto;
}

.emeriss-iconbox.default .icon,
.emeriss-iconbox.default .content {
    display: table-cell;
    vertical-align: middle;
}

.emeriss-iconbox.default .icon {
    font-size: 50px;
    padding: 0 20px 0 0;
    color: #5d9d23;
}

.emeriss-iconbox.default .icon .fa.fa-life-ring {
    font-size: 48px;
}

.emeriss-iconbox.default .iconbox-inner .content .title {
    color: #fff;
    margin-bottom: 0;
}

.emeriss-iconbox-wrapp.layout2 .emeriss-iconbox.default .iconbox-inner .content .title {
    color: #fff;
}

.emeriss-iconbox.default .iconbox-inner .content .text {
    font-size: 15px;
    color: #888;
}

.emeriss-iconbox-wrapp.rows-space-40 .row {
    margin-left: -10px;
    margin-right: -10px;
}

.emeriss-iconbox-wrapp.rows-space-40 .col-lg-4 {
    padding-left: 10px;
    padding-right: 10px;
}

.kt-popup-quickview {
    width: 770px;
    margin: 0 auto;
    background-color: #fff;
    position: relative;
    padding: 40px 30px;
}

.kt-popup-quickview:after,
.kt-popup-quickview:before {
    display: table;
    content: '';
}

.kt-popup-quickview:after {
    clear: both;
}

.kt-popup-quickview .details-thumb {
    width: 51.9480519%;
    float: left;
    padding-right: 20px;
    position: relative;
}

.kt-popup-quickview .details-infor {
    width: 48.0519481%;
    padding-left: 30px;
    border-left: 0;
}

.kt-popup-quickview .details-thumb .slider-product {
    margin-bottom: 20px;
}

.kt-popup-quickview .slider-product-button .slick-list {
    margin-left: -12.5px;
    margin-right: -12.5px;
}

.kt-popup-quickview .slider-product-button .details-item {
    padding: 0 12.5px;
}

.kt-popup-quickview .slider-product-button .details-item img {
    border: 1px solid #eeeeee;
}

.kt-popup-quickview .slider-product-button .details-item.slick-current img {
    border-color: #333333;
}

.kt-popup-quickview .slider-product-button .slick-arrow {
    width: 37px;
    height: 35px;
    line-height: 31px;
    border: 1px solid #eeeeee;
    text-align: center;
    font-size: 20px;
    right: 30px;
    opacity: 0;
    visibility: hidden;
    background: #ffffff;
    -moz-transition: all 0.45s ease;
    -webkit-transition: all 0.45s ease;
    -o-transition: all 0.45s ease;
    -ms-transition: all 0.45s ease;
}

.kt-popup-quickview .slider-product-button:hover .slick-arrow {
    opacity: 1;
    visibility: visible;
    right: -20px;
}

.kt-popup-quickview .slider-product-button .slick-arrow:first-child {
    left: 30px;
}

.kt-popup-quickview .slider-product-button:hover .slick-arrow:first-child {
    left: -20px;
}

.kt-popup-quickview .mfp-close {
    width: 30px;
    height: 30px;
    border-radius: 50px;
    text-align: center;
    line-height: 28px;
    color: #ffffff;
    position: absolute;
    top: -15px;
    right: -15px;
    opacity: 1;
}

.mfp-bg {
    opacity: 0.5;
}

.kt-popup-newsletter {
    position: relative;
    margin: 0 auto;
}

.kt-popup-newsletter .popup-content {
    overflow: hidden;
}

.kt-popup-newsletter.style-1 {
    width: 770px;
}

.kt-popup-newsletter .image-newsletter {
    background-repeat: no-repeat;
    background-position: left center;
    background-color: #ffffff;
    background-size: cover;
}

.kt-popup-newsletter.style-1 .image-newsletter {
    width: 38.9610%;
    display: inline-block;
    float: left;
    padding: 40px 40px 24px 40px;
}

.kt-popup-newsletter .newsletter-infor {
    background: #ffffff;
    overflow: hidden;
    text-align: center;
}

.kt-popup-newsletter.style-1 .newsletter-infor {
    width: 61.039%;
    display: inline-block;
    padding: 40px 40px 24px 40px;
}

.kt-popup-newsletter .title {
    font-size: 36px;
    font-weight: 700;
    color: #222222;
    letter-spacing: -0.05em;
    margin-bottom: 5px;
}

.kt-popup-newsletter .sub-title {
    font-size: 16px;
    color: #555555;
    font-weight: 700;
    margin-bottom: 50px;
}

.kt-popup-newsletter .sub-title span {
    color: #111111;
    text-decoration: underline;
}

.kt-popup-newsletter .newsletter-form-wrap {
    margin-bottom: 56px;
}

.kt-popup-newsletter .newsletter-form-wrap input {
    width: 100%;
    font-size: 14px;
    color: #888888;
    margin-bottom: 20px;
    height: 43px;
    text-align: center;
}

.kt-popup-newsletter .newsletter-form-wrap button {
    width: 100%;
    font-size: 13px;
    height: 43px;
}

.emeriss-disablepopupnewsletter .checkbox {
    margin: 0;
    font-size: 13px;
    color: #aaa;
    font-style: italic;
}

.emeriss-disablepopupnewsletter input.emeriss_disabled_popup_by_user {
    display: none;
}

.emeriss-disablepopupnewsletter .checkbox label {
    display: table;
    margin: 0 auto;
    padding: 0;
}

.emeriss-disablepopupnewsletter span {
    position: relative;
    padding-left: 23px;
    cursor: pointer;
}

.emeriss-disablepopupnewsletter span::before {
    position: absolute;
    content: '';
    width: 17px;
    height: 17px;
    border: 1px solid #e9e9e9;
    left: 0;
    top: 0;
}

.emeriss-disablepopupnewsletter input[type="checkbox"]:checked+span::after {
    font-family: 'FontAwesome';
    content: "\f00c";
    display: inline-block;
    top: 1px;
    left: 2px;
    width: 10px;
    height: 12px;
    text-align: center;
    font-size: 10px;
    color: #444;
    position: absolute;
    z-index: 11;
    padding: 0;
    line-height: 14px;
}

.kt-popup-newsletter.style-2 {
    width: 570px;
}

.kt-popup-newsletter.style-2 .newsletter-infor {
    padding-right: 70px;
    padding-bottom: 10px;
    padding-left: 70px;
}

.kt-popup-newsletter.style-2 .title {
    padding-bottom: 0;
    padding-top: 18px;
}

.kt-popup-newsletter.style-2 .sub-title {
    margin-top: 1px;
    margin-bottom: 0;
}

.kt-popup-newsletter.style-2 .newsletter-form-wrap {
    margin-top: 25px;
    margin-bottom: 0;
}

.kt-popup-newsletter.style-2 .emeriss-disablepopupnewsletter .checkbox {
    margin-top: 42px;
    text-decoration: underline;
    font-style: normal;
}

.kt-popup-newsletter.style-2 .emeriss-disablepopupnewsletter span {
    padding: 0;
}

.kt-popup-newsletter.style-2 .emeriss-disablepopupnewsletter span::before {
    display: none;
}

.kt-popup-newsletter.style-2 .mfp-close {
    width: 30px;
    height: 30px;
    border-radius: 50px;
    text-align: center;
    line-height: 28px;
    color: #ffffff;
    position: absolute;
    top: -15px;
    right: -15px;
    opacity: 1;
}

.kt-popup-newsletter.style-2 .newsletter-form-wrap input {
    margin-bottom: 10px;
}

.kt-popup-newsletter.style-3 {
    width: 770px;
    background-color: #ffffff;
}

.kt-popup-newsletter.style-3 .newsletter-infor {
    width: 48.0519%;
    display: inline-block;
    float: left;
    padding: 44px 30px 15px 30px;
}

.kt-popup-newsletter.style-3 .newsletter-slider {
    padding: 44px 50px 15px 50px;
    width: 51.9481%;
    display: inline-block;
}

.kt-popup-newsletter.style-3 .sub-title {
    font-size: 16px;
    color: #888888;
    text-align: left;
    margin-bottom: 7px;
}

.kt-popup-newsletter.style-3 .newsletter-infor .sub-title span {
    color: #ffffff;
}

.kt-popup-newsletter.style-3 .title {
    font-size: 36px;
    color: #ffffff;
    line-height: 42px;
    text-align: left;
    margin-bottom: 53px;
}

.kt-popup-newsletter.style-3 .input-text {
    background-color: #fff;
    border-color: #fff;
    color: #888;
    text-align: left;
    margin-bottom: 20px;
}

.kt-popup-newsletter.style-3 input:focus {
    border-color: #ffffff !important;
}

.emeriss-newsletter-form .input-text,
.emeriss-newsletter-form .submit-newsletter {
    width: 100%;
    text-align: center;
}

.kt-popup-newsletter.style-3 .newsletter-slider .title {
    font-size: 30px;
    color: #222222;
    text-align: center;
    margin-bottom: 4px;
    margin-top: 6px;
}

.kt-popup-newsletter.style-3 .newsletter-slider .sub-title {
    font-size: 16px;
    color: #888888;
    text-align: center;
    margin-bottom: 45px;
}

.kt-popup-newsletter.style-3 .emeriss-slider-wrapp .slick-dots {
    overflow: hidden;
    text-align: center;
    margin-top: 10px;
}

.kt-popup-newsletter.style-3 .emeriss-slider-wrapp .slick-dots>li {
    width: 8px;
    height: 8px;
    float: none;
    margin: 0 5px;
}

.kt-popup-newsletter.style-3 .emeriss-slider-wrapp .slick-dots>li.slick-active {
    background-color: #222222;
}

.kt-popup-newsletter.style-3 .emeriss-disablepopupnewsletter span {
    padding-left: 0;
}

.kt-popup-newsletter.style-3 .emeriss-disablepopupnewsletter span::before {
    display: none;
}

.kt-popup-newsletter.style-3 .emeriss-disablepopupnewsletter .checkbox {
    margin-top: 22px;
    text-decoration: underline;
    font-style: normal;
}

.kt-popup-newsletter.style-3 .owl-product .newsletter-slider-item img {
    width: 278px;
    margin: 0 auto;
}

.kt-popup-newsletter.style-3 .emeriss-disablepopupnewsletter input[type="checkbox"]:checked+span::after {
    display: none;
}

.newsletter-slider-item .product-item {
    margin-bottom: 0;
}

.newsletter-slider-item .product-item .product-inner {
    padding: 0;
    border: none;
}

.newsletter-slider-item .product-item .product-thumb {
    margin-bottom: 0;
}

.newsletter-slider-item .product-item:hover .product-inner {
    box-shadow: none;
}

.newsletter-slider-item .product-item .product-thumb .variations {
    position: static;
    opacity: 1;
    visibility: visible;
    margin-top: 10px;
}

.newsletter-slider-item .attribute_color .list-color a {
    margin-right: 0;
}

.newsletter-slider-item .attribute_color .list-color a:hover::before,
.newsletter-slider-item .attribute_color .list-color a.active::before {
    display: none;
}

.newsletter-slider-item .product-item .product-thumb .attribute_color .list-color a.active {
    border: none;
}

.load-more {
    text-align: center;
    overflow: hidden;
    margin-top: 20px;
}

.load-more a {
    display: inline-block;
    height: 43px;
    line-height: 38px;
    border: 1px solid #f4f4f4;
    padding: 0 10px;
    width: 149px;
    color: #222;
    font-weight: 700;
    border-radius: 40px;
}

.load-more a:hover,
.load-more a:hover .icon {
    color: #ffffff;
}

.load-more a:hover {
    border-color: transparent;
}

.load-more .icon {
    color: #aaa;
    font-weight: normal;
    margin-right: 5px;
}

.header-device-mobile {
    padding: 25px 0;
    display: none;
    position: relative;
}

.header-device-mobile .wapper {
    display: table;
    width: 100%;
    padding: 0 15px;
}

.header-device-mobile .item {
    display: table-cell;
    vertical-align: middle;
}

.header-device-mobile .item .block-sub {
    position: absolute;
    top: 100%;
    right: 0;
    background-color: #fff;
    padding: 15px;
    left: 0;
    z-index: 100;
    margin-top: 1px;
    -webkit-box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
    -moz-box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
    box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
    -webkit-transition: opacity .5s, -webkit-transform .5s;
    transition: opacity .3s, transform .3s;
    -webkit-transform: translate(0, 30px);
    -moz-transform: translate(0, 30px);
    -o-transform: translate(0, 30px);
    -ms-transform: translate(0, 30px);
    transform: translate(0, 30px);
    opacity: 0;
    display: block;
    visibility: hidden;
    padding-top: 50px;
}

.header-device-mobile .item.open .block-sub {
    -webkit-transform: translate(0, 0);
    -moz-transform: translate(0, 0);
    -o-transform: translate(0, 0);
    -ms-transform: translate(0, 0);
    transform: translate(0, 0);
    opacity: 1;
    visibility: visible;
}

.header-device-mobile .mobile-search-box,
.header-device-mobile .mobile-settings-box,
.header-device-mobile .menu-bar {
    width: 40px;
    padding-left: 5px;
}

.header-device-mobile .mobile-navigation {
    top: auto;
}

.header-device-mobile .mobile-navigation,
.mobile-search-box>a,
.mobile-settings-box>a {
    width: 40px;
    height: 40px;
    float: left;
    border: 2px solid #dedede;
    padding: 0;
    text-align: center;
    line-height: 36px;
    color: #555;
    font-size: 16px;
    border-radius: 0;
}

.header-device-mobile .mobile-navigation {
    margin: 0;
    text-align: center;
    padding: 13px 11px 10px;
}

.header-device-mobile .mobile-navigation span {
    background-color: #555;
}

.mobile-search-box>a,
.mobile-settings-box>a:hover {
    color: #555;
}

.header-device-mobile .item .block-sub .close {
    font-size: 14px;
    display: inline-block;
    width: 30px;
    height: 30px;
    text-align: center;
    float: none;
    position: absolute;
    top: 10px;
    right: 15px;
    line-height: 27px;
    border: 1px solid #eee;
}

.header-device-mobile .header-searchform-box {
    padding: 19px 0;
}

.header-device-mobile .header-searchform-box .search-input {
    width: calc(100% - 100px);
    font-size: 13px;
    color: #999999;
    background: #ffffff;
}

.header-device-mobile .block-item-title {
    font-size: 14px;
    border-bottom: 1px solid #eee;
    padding-bottom: 10px;
    margin-bottom: 15px;
}

.mobile-settings-box .emeriss-language-wrap {
    padding: 0;
    margin: 0;
}

.mobile-settings-box .emeriss-language-wrap li {
    list-style: none;
    display: inline-block;
    font-size: 15px;
    color: #888;
    margin-right: 20px;
    margin-bottom: 20px;
}

.mobile-settings-box .emeriss-language-wrap li.active {
    color: #222222;
}

.ft-contact-span:hover {
    color: #5d9d23;
    padding-right: 5px;
}

.footer-device-mobile {
    position: fixed;
    bottom: 0;
    left: 0;
    width: 100%;
    z-index: 999;
    background-color: #fff;
    border-top: 1px solid #eee;
    display: none;
}

.footer-device-mobile-item {
    display: table-cell;
    vertical-align: middle;
    text-align: center;
}

.footer-device-mobile .wapper {
    display: table;
    width: 100%;
    table-layout: fixed;
}

.footer-device-mobile-item>a {
    display: inline-block;
    padding: 5px 0;
    color: #222;
    line-height: normal;
}

.footer-device-mobile-item>a .icon {
    font-size: 20px;
    display: block;
    position: relative;
    height: 30px;
    line-height: 30px;
    font-weight: 700;
}

.footer-device-mobile-item.device-cart .count-icon {
    width: 20px;
    height: 20px;
    text-align: center;
    line-height: 20px;
    border-radius: 50%;
    color: #ffffff;
    font-weight: 700;
    display: inline-block;
    position: absolute;
    top: 0;
    right: -10px;
    font-size: 12px;
}

.mega-menu .border-custom {
    margin-top: 30px;
}

.footer .border-custom span {
    border-bottom: 1px solid #2b2b2b;
}

.border-custom span {
    width: 100%;
    border-bottom: 1px solid #eee;
    display: inline-block;
    float: left;
}

.kt-clone-wrap .kt-sub-opened {
    z-index: 1;
    opacity: 0;
    visibility: hidden;
}

.kt-clone-wrap {
    position: fixed;
    overflow-x: hidden;
    top: 0;
    left: -100%;
    width: 320px;
    height: 100vh;
    background-color: #fff;
    -webkit-transition: all 0.3s ease 0s;
    -o-transition: all 0.3s ease 0s;
    -moz-transition: all 0.3s ease 0s;
    transition: all 0.3s ease 0s;
    z-index: 100000;
    -webkit-box-shadow: 3px 5px 14px -3px rgba(0, 0, 0, 0.11);
    -moz-box-shadow: 3px 5px 14px -3px rgba(0, 0, 0, 0.11);
    box-shadow: 3px 5px 14px -3px rgba(0, 0, 0, 0.11);
}

.kt-clone-wrap.open {
    left: 0;
}

.kt-panels-actions-wrap {
    border-bottom: 1px solid #eee;
    height: 50px;
    position: relative;
}

.kt-panels-actions-wrap .kt-close-btn,
.kt-panels-actions-wrap .kt-prev-panel {
    width: 50px;
    height: 50px;
    position: absolute;
    top: 0;
    right: 0;
    z-index: 10;
    border-left: 1px solid #eee;
    text-align: center;
    line-height: 50px;
    font-size: 20px;
    color: #222;
}

.kt-panels-actions-wrap .kt-prev-panel {
    right: inherit;
    left: 0;
    border: none;
    border-right: 1px solid #eee;
}

.kt-panels-actions-wrap .kt-prev-panel:before {
    content: "\f104";
    font-family: FontAwesome;
}

.kt-clone-wrap .kt-panels {
    background: inherit;
    border-color: inherit;
    position: absolute;
    margin-top: 50px;
    left: 0;
    right: 0;
    top: 0;
    bottom: 0;
    z-index: 0;
    box-sizing: border-box;
}

.kt-clone-wrap .kt-panel {
    border-color: #fff;
    bottom: 0;
    background: #fff;
    box-sizing: border-box;
    display: block;
    left: 0;
    margin: 0;
    overflow-x: hidden;
    overflow-y: auto;
    position: absolute;
    right: 0;
    top: 0;
    transform: translateX(100%);
    transition: all 0.2s ease 0s;
    z-index: 0;
}

.kt-clone-wrap .kt-main-panel,
.kt-clone-wrap .kt-panel.kt-panel-opened {
    transform: translateX(0);
    z-index: 10
}

.kt-panel>ul {
    padding: 0;
    margin: 0;
}

.kt-panel li {
    list-style: none;
    position: relative
}

.kt-panel>ul>li {
    padding: 0 20px;
    border-bottom: 1px solid #eee;
}

.kt-panel>ul>li>a {
    display: block;
    font-size: 14px;
    color: #222;
    padding: 10px 20px;
    text-transform: uppercase;
}

.kt-next-panel {
    width: 50px;
    text-align: center;
    position: absolute;
    top: 0;
    right: 0;
    z-index: 10;
}

.kt-next-panel:before {
    content: "\f105";
    font-family: FontAwesome;
}

.kt-panels-actions-wrap .kt-current-panel-title {
    display: block;
    text-align: center;
    line-height: 50px;
    padding: 0 50px;
    text-transform: uppercase;
    color: #222222;
}

.kt-clone-wrap .kt-panel .menu-page {
    background-image: none;
}

.emeriss-menu-panels .submenu {
    position: static;
    visibility: visible;
    opacity: 1;
    min-width: 1px;
    -webkit-box-shadow: none;
    -moz-box-shadow: none;
    box-shadow: none;
    -webkit-transition: opacity .5s, -webkit-transform .5s;
    transition: opacity .3s, transform .3s;
    -webkit-transform: translate(0, 0);
    -moz-transform: translate(0, 0);
    -o-transform: translate(0, 0);
    -ms-transform: translate(0, 0);
    transform: translate(0, 0);
    display: block;
    text-align: left;
}

.backtotop {
    display: none;
    width: 50px;
    height: 50px;
    font-size: 24px;
    font-weight: 700;
    background: #3f6a18;
    color: #fff;
    border-radius: 50%;
    position: fixed;
    bottom: 50px;
    right: 25px;
    text-align: center;
    line-height: 50px;
    z-index: 999;
}

.backtotop.show {
    display: block;
}

.backtotop:hover {
    background: #2f4e12;
    color: #fff !important;
}

.coppyright {
    color: #888888;
    padding: 5px 0;
}

.coppyright a:not(:hover) {
    color: #fff;
}

.footer-end .emeriss-payment {
    cursor: default;
    text-align: right;
}

.footer-end .demos {
    text-align: right;
}

.footer-end .demos a {
    min-width: 139px;
    height: 34px;
    border: 1px solid #363636;
    display: inline-block;
    text-align: center;
    line-height: 30px;
    text-transform: capitalize;
    color: #888888;
    font-size: 13px;
}

.footer-end .demos a::after {
    font-family: 'FontAwesome';
    content: "\f107";
    margin-left: 5px;
    font-size: 15px;
    color: #888;
    font-weight: normal;
    vertical-align: top;
}

.footer-end .demos span {
    color: #ffffff;
}

.header-top-message {
    background-color: #111111;
    color: #aaaaaa;
    font-weight: 700;
    text-transform: uppercase;
    text-align: center;
    font-size: 15px;
    padding: 12px 15px;
}

.header-top-message .icon {
    color: #fff;
    font-size: 22px;
}

.header-top-message a {
    color: #fff;
    text-decoration: underline;
}

.header-top-message a:hover {
    color: #ffffff;
}

.header-block-text {
    background-color: #111111;
    color: #aaaaaa;
    font-weight: 700;
    text-transform: uppercase;
    text-align: center;
    font-size: 15px;
    padding: 12px 0;
}

.header-block-text .icon {
    color: #fff;
    font-size: 18px;
    margin-right: 10px;
}

.header-block-text a {
    color: #ffffff;
    text-decoration: underline;
}

.header-block-text a:hover {
    color: #aaaaaa;
}

.tab-container {
    position: relative;
}

.tab-container .tab-panel {
    position: absolute;
    top: 0;
    left: 0;
    width: 100%;
    opacity: 0;
    visibility: hidden;
    height: 1px;
    overflow: hidden
}

.tab-container .active {
    opacity: 1;
    visibility: inherit;
    position: inherit;
    -vendor-animation-duration: 0.3s;
    -vendor-animation-delay: 1s;
    -vendor-animation-iteration-count: infinite;
    height: auto;
    overflow: inherit;
}

.breadcrumb {
    padding: 12px 0 12px;
    background: #ffffff;
    margin: 0;
}

.breadcrumb>li {
    display: inline-block;
    list-style: none;
    font-weight: 500;
    font-size: 14px;
}

.breadcrumb a {
    color: #888888;
}

.breadcrumb>.active {
    color: #222;
}

.breadcrumb>li+li:before {
    padding: 0 8px;
    content: "\f101";
    font-family: 'FontAwesome';
    font-weight: 400;
}

.pagination {
    display: block;
    margin: 50px 0 0;
    padding: 0;
}

.pagination.grid {
    margin-top: 20px;
}

.pagination .page-numbers {
    display: inline-block;
    width: 42px;
    height: 42px;
    line-height: 39px;
    text-align: center;
    border: 2px solid #F1F1F1;
    font-size: 16px;
    color: #888;
    font-weight: 500;
    margin-left: 5px;
    border-radius: 0;
}

.pagination .page-numbers:first-child {
    margin-left: 0;
}

.pagination .page-numbers.current,
.pagination .page-numbers:hover {
    color: #fff;
    border-color: transparent;
    background-color: #5d9d23;
}

.pagination .page-numbers .icon {
    font-weight: 700;
}

.pagination.style1 {
    text-align: right;
}

.pagination.style2 {
    text-align: center;
}

.shop-grid-content .pagination {
    margin-top: 10px;
}

.content-inlookbook .pagination {
    margin-top: 10px;
    margin-bottom: 60px
}

.main-content-blog.mansory .pagination {
    margin-top: 10px;
}

.widget {
    margin-bottom: 40px;
}

.widget:last-child {
    margin-bottom: 0;
}

.widget .widgettitle {
    font-size: 15px;
    font-weight: 700;
    padding-bottom: 10px;
    margin-bottom: 30px;
    position: relative;
    margin-top: -3px;
    z-index: 1;
    border-bottom: 2px solid #e8e8e8;
}

.widget .widgettitle::before {
    content: '';
    position: absolute;
    left: 0;
    bottom: -1px;
    width: 50px;
    border-bottom: 2px solid #5d9d23;
}

.widget ul,
.widget ol {
    padding: 0;
    margin: 0;
}

.widget li {
    list-style: none;
    line-height: 24px;
}

.widget a {
    color: #555555;
}

.sidebar input[type="checkbox"] {
    display: none;
}

.sidebar .label-text {
    cursor: pointer;
    font-size: 14px;
    color: #555;
    margin: 0;
    padding-left: 25px;
    position: relative;
    font-weight: normal;
}

.sidebar input[type="checkbox"]+label::after {
    position: absolute;
    z-index: 1;
    content: "";
    left: 0;
    top: 3px;
    width: 18px;
    height: 18px;
    border: solid 1px #eeeeee;
    border-radius: 0;
}

.sidebar input[type="checkbox"]:checked+label::before {
    font-family: 'FontAwesome';
    content: "\f00c";
    display: inline-block;
    top: 7px;
    left: 0;
    width: 15px;
    height: 14px;
    text-align: center;
    font-size: 10px;
    color: #222;
    position: absolute;
    z-index: 2;
    padding: 0;
    line-height: 14px;
}

.widget-socials .social-list {
    overflow: hidden;
}

.widget-socials .social-list .social-item {
    font-size: 23px;
    color: #222;
    display: inline-block;
    float: left;
    padding: 0 15px;
    margin-bottom: 10px;
}

.widget-socials .social-list .social-item:first-child {
    padding-left: 0;
}

.widget-socials .social-list .social-item:last-child {
    padding-right: 0;
}

.widget-post .widget-post-item {
    overflow: hidden;
    margin-bottom: 20px;
}

.widget-post .widget-post-item:last-child {
    margin-bottom: 0;
}

.widget-post .widget-post-item .thumb-blog {
    width: 100px;
    float: left;
}

.widget-post .widget-post-item .post-content {
    overflow: hidden;
    padding-left: 10px;
}

.widget-post .widget-post-item .cat {
    font-size: 11px;
    font-weight: 700;
    text-transform: uppercase;
    color: #aaaaaa;
    line-height: normal;
    margin-top: 0;
}

.widget-post .widget-post-item .cat a:not(:hover) {
    color: inherit;
}

.widget-post .widget-post-item .post-title {
    font-size: 14px;
    font-weight: 500;
    margin-bottom: 0;
    line-height: 20px;
    margin-top: 6px;
}

.widget-post .widget-post-item .post-title a {
    color: #333333;
}

.widget-post .widget-post-item .post-title span {
    color: #aaaaaa;
    display: none;
}

.widget-tags .tagcloud {
    overflow: hidden;
    margin: 0;
    padding: 0;
    width: 100%;
}

.widget-tags .tag-cloud-link {
    color: #888888;
    margin-right: 10px;
    margin-top: 5px;
    margin-bottom: 5px;
    float: left;
    line-height: 26px;
    text-transform: capitalize;
    border-radius: 0;
}

.widget-tags .tag-cloud-link a {
    color: #888888;
}

.widget .view-all:not(:hover) {
    color: #aaa;
    text-decoration: underline;
}

.woof_Widget .widget:last-child {
    border-bottom: 0;
    margin-bottom: 0;
    border-radius: 0;
}

.woof_Widget {
    border-radius: 0;
}

.widget_filter_price .ui-widget-content {
    background: #ddd;
    border-radius: 2px;
    height: 4px;
    border: none;
}

.widget_filter_price .ui-slider .ui-slider-range {
    background: #5d9d23;
}

.widget_filter_price .ui-slider .ui-slider-handle {
    width: 0;
    height: 0;
    border: none;
    top: -6px;
    border-radius: 1em;
    cursor: ew-resize;
    margin-left: -0.3em;
    outline: 0 none;
    position: absolute;
    z-index: 2;
    border-color: #5d9d23 transparent;
}

.widget_filter_price .ui-slider .ui-slider-handle::before {
    content: '';
    border-style: solid;
    border-width: 8px 6px 0 6px;
    border-color: #5d9d23 transparent;
}

.widget_filter_price .price-slider-amount {
    margin-top: 25px;
    font-size: 13px;
    color: #666666;
    overflow: hidden;
}

.woof_Widget .price-slider-amount span {
    display: inline-block;
    font-size: 15px;
    color: #222222;
    border: 1px solid #eeeeee;
    padding: 4px 10px;
    font-weight: 700;
    border-radius: 0;
}

.woof_Widget .price-slider-amount span:first-child {
    margin-right: 10px;
}

.widget_filter_size li {
    display: inline-block;
    min-width: 54px;
    line-height: 30px;
    height: 30px;
    border: 2px solid #eeeeee;
    text-align: center;
    margin-right: 10px;
    margin-bottom: 15px;
    border-radius: 0;
}

.widget_filter_size li a {
    color: #222;
    font-weight: 500;
    text-transform: uppercase;
}

.widget_filter_size li.active a,
.widget_filter_size li:hover a {
    color: #fff;
}

.widget-color .list-color a {
    display: inline-block;
    height: 27px;
    margin-bottom: 3px;
    margin-right: 10px;
    position: relative;
    text-align: center;
    width: 26px;
    line-height: 27px;
    border-radius: 0;
}

.widget-color .list-color .color1 {
    border: 1px solid #eeeeee;
}

.widget-color .list-color .color2 {
    background: #222222;
}

.widget-color .list-color .color3 {
    background: #4a5365;
}

.widget-color .list-color .color4 {
    background: #84664d;
}

.widget-color .list-color .color5 {
    background: #d27d53;
}

.widget-color .list-color .color6 {
    background: #719271;
}

.widget-color .list-color .color7 {
    background: #5f8ea9;
}

.list-color a.active::before,
.list-color a:hover::before {
    color: #fff;
    content: "\f00c";
    display: inline-block;
    font-family: FontAwesome;
    font-size: 12px;
    left: 0;
    position: absolute;
    width: 100%;
}

.list-color .colo1.active::before,
.list-color .colo1:hover::before {
    color: #222222;
}

.tag-cloud-link a:hover,
.tag-cloud-link.active a {
    color: #111111;
}

.sidebar-details .widget {
    position: relative;
}

.sidebar-details .widget .slick-slider {
    position: static;
}

.sidebar-details .widget .slick-slider .slick-arrow {
    width: 35px;
    height: 35px;
    line-height: 31px;
    text-align: center;
    background: none;
    color: #aaaaaa;
    font-size: 20px;
}

.sidebar-details .widget .slick-slider .slick-arrow:first-child {
    right: 45px;
}

.widget-related-products .product-item {
    margin-bottom: 0;
}

.sidebar-details .widgettitle {
    margin-bottom: 25px;
}

.sidebar-details .widget-categories .widgettitle {
    margin-bottom: 10px;
}

.sidebar-details .widget-banner {
    text-align: center;
}

.sidebar-details .widget-banner img {
    border-radius: 0;
}

.Testimonial-inner {
    padding: 17px 22px 20px;
    border: 1px solid #f4f4f4;
    border-radius: 0;
}

.Testimonial-inner .comment {
    font-size: 14px;
    color: #555555;
    margin-bottom: 33px;
    position: relative;
    padding-top: 30px;
}

.Testimonial-inner .comment::before {
    content: '鈥�';
    font-size: 60px;
    font-family: Georgia;
    color: #aaaaaa;
    position: absolute;
    top: 0;
    line-height: 1;
}

.Testimonial-inner .author {
    overflow: hidden;
}

.Testimonial-inner .author .avt {
    float: left;
    width: 41px;
}

.Testimonial-inner .author .name {
    overflow: hidden;
    padding-left: 10px;
    font-size: 14px;
    color: #333333;
}

.Testimonial-inner .author .name span {
    font-size: 13px;
    font-weight: normal;
    color: #aaaaaa;
    display: block;
    letter-spacing: 0;
}

.newsletter-widget {
    padding: 20px;
    padding-top: 30px;
    padding-bottom: 32px;
    border: 1px solid #F1F1F1;
    position: relative;
    border-radius: 0;
}

.newsletter-widget:before {
    font-family: 'FontAwesome';
    content: "\f003";
    font-size: 150px;
    color: #f5f5f5;
    position: absolute;
    top: 15px;
    left: 32px;
    line-height: normal;
    -ms-transform: rotate(-30deg);
    -webkit-transform: rotate(-30deg);
    transform: rotate(-30deg);
}

.newsletter-widget .newsletter-form-wrap {
    position: relative;
    z-index: 2
}

.newsletter-widget .title {
    font-size: 20px;
    color: #222;
    line-height: 1.2;
    margin-bottom: 10px;
    font-family: 'Oswald', serif;
    font-weight: 700;
    letter-spacing: 0;
}

.newsletter-widget .subtitle {
    font-size: 15px;
    color: #555;
    line-height: 20px;
    margin-bottom: 60px;
}

.newsletter-widget .email,
.newsletter-widget .submit-newsletter {
    width: 100%;
    text-align: center
}

.newsletter-widget .email {
    margin-bottom: 10px;
}

.shop-top-control {
    border: 1px solid #F1F1F1;
    background-color: #F1F1F1;
    border-radius: 0;
    padding: 15px 0 15px;
    margin-bottom: 40px;
    display: table;
    width: 100%;
    font-weight: 500;
    color: #888888;
    position: relative;
}

.shop-top-control .select-form,
.shop-top-control .grid-view-mode {
    padding: 0 13px;
    border-right: 1px solid #F1F1F1;
    display: table-cell;
    vertical-align: middle;
}

.shop-top-control .select-form {
    position: relative;
    z-index: 999;
    line-height: 28px;
}

.shop-top-control .select-form .title {
    margin-right: 3px;
}

.shop-top-control .select-form.select-item {
    z-index: 1000;
}

.shop-top-control .chosen-container-single .chosen-single {
    height: 28px;
    line-height: 28px;
    border: 1px solid #fff;
    background: #fff !important;
    padding: 0 10px;
    max-width: 100%;
    background: none;
    box-shadow: none;
    width: 154px;
    color: #222;
    border-radius: 0;
}

.shop-top-control .chosen-container-single .chosen-single span {
    font-size: 13px;
    line-height: 26px;
    margin-right: 0;
}

.shop-top-control .chosen-container .chosen-results li.highlighted {
    background-image: none;
    background-color: #222222;
}

.shop-top-control .grid-view-mode {
    border-right: none;
    width: 125px;
    padding: 0;
}

.grid-view-mode .inner {
    display: table;
    margin: 0 auto;
}

.grid-view-mode .modes-mode {
    display: inline-block;
    padding: 4px 0;
    overflow: hidden;
    margin: 0 5px;
    vertical-align: top;
}

.grid-view-mode .modes-mode.active {
    color: #5d9d23;
}

.grid-view-mode .modes-mode.mode-grid::before {
    content: "\f118";
    font-family: Flaticon;
    font-size: 17px;
}

.grid-view-mode .modes-mode.mode-list::before {
    content: "\f119";
    font-family: Flaticon;
    font-size: 23px;
}

ul.list-products {
    padding: 0;
    margin-top: 0;
    margin-bottom: 0;
}

.product-item {
    list-style: none;
    margin-bottom: 30px;
}

.product-item .product-inner {
    border-radius: 0;
    overflow: hidden;
    position: relative;
    border: 2px solid #5c71d5;
    padding: 15px;
    background-color: #fff;
}

.product-item:hover .product-inner {
    z-index: 2;
    border-color: #5d9d23;
}

.product-item .product-top {
    overflow: hidden;
    z-index: 1;
    position: absolute;
    left: 15px;
    top: 15px;
    right: 15px;
}

.product-item .flash {
    font-size: 12px;
    font-weight: 500;
    text-transform: capitalize;
    display: inline-block;
    float: left;
    line-height: 44px;
    height: 44px;
    min-width: 44px;
    border-radius: 50%;
    padding: 0 5px;
    text-align: center;
    background-color: #5d9d23;
    color: #fff;
    position: relative;
    font-family: "Segoe UI", "Fira Sans", "Droid Sans", "Helvetica Neue", "Source Sans Pro", sans-serif;
}

.product-item .yith-wcwl-add-to-wishlist>div a:before {
    font-size: 18px;
    font-family: 'FontAwesome';
    content: "\f08a";
}

.product-item .yith-wcwl-add-to-wishlist>div a:hover::before {
    content: "\f004";
}

.product-item .product-thumb {
    margin-bottom: 15px;
    position: relative;
    text-align: center;
}

.product-item.style-list .button.quick-wiew-button,
.product-item.style2 .button.quick-wiew-button,
.product-item.style-3 .button.quick-wiew-button {
    position: absolute;
    top: 50%;
    left: 50%;
    width: 46px;
    height: 46px;
    line-height: 46px;
    padding: 0;
    font-size: 0;
    background-color: #fff;
    color: #222;
    border-radius: 100%;
    z-index: 10;
    font-weight: 400;
    text-align: center;
    opacity: 0;
    visibility: hidden;
    transform: translate(-50%, -50%);
    -webkit-transition: all 0.4s ease 0s;
    -moz-transition: all 0.4s ease 0s;
    -o-transition: all 0.4s ease 0s;
    transition: all 0.4s ease 0s;
}

.product-item.style-list:hover .button.quick-wiew-button,
.product-item.style2:hover .button.quick-wiew-button,
.product-item.style-3:hover .button.quick-wiew-button {
    opacity: 1;
    visibility: visible;
}

.product-item.style-list .button.quick-wiew-button::before,
.product-item.style2 .button.quick-wiew-button::before,
.product-item.style-3 .button.quick-wiew-button::before {
    font-size: 18px;
    content: "\f12d";
    font-family: 'Flaticon';
    font-weight: normal;
}

.product-item.style-list .button.quick-wiew-button:hover,
.product-item.style2 .button.quick-wiew-button:hover,
.product-item.style-3 .button.quick-wiew-button:hover {
    color: #fff;
}

.product-item .product-info {
    text-align: center;
    position: relative;
}

.product-item .product-name {
    font-size: 16px;
    font-weight: 600;
    margin: 0;
    margin-bottom: 4px;
    letter-spacing: 0;
}

.product-item.style-list .product-name {
    font-size: 22px;
}

.product-item .thumb-group {
    position: absolute;
    bottom: 31px;
    right: 0;
}

.product-item .thumb-group .quick-wiew-button,
.product-item .thumb-group .yith-wcwl-add-to-wishlist,
.product-item .thumb-group .loop-form-add-to-cart {
    width: 46px;
    height: 46px;
    line-height: 46px;
    background-color: #333;
    border-radius: 50%;
    margin: 4px 0;
    box-shadow: 0 15px 25px rgba(0, 0, 0, .08);
    -webkit-transform: translateX(60px);
    -moz-transform: translateX(60px);
    -ms-transform: translateX(60px);
    -o-transform: translateX(60px);
    transform: translateX(60px);
    opacity: 0;
    visibility: hidden;
    color: #fff;
    position: relative !important;
    display: block;
    vertical-align: top;
}

.product-item:hover .thumb-group .quick-wiew-button,
.product-item:hover .thumb-group .yith-wcwl-add-to-wishlist,
.product-item:hover .thumb-group .loop-form-add-to-cart {
    -webkit-transform: translateX(0);
    -moz-transform: translateX(0);
    -ms-transform: translateX(0);
    -o-transform: translateX(0);
    transform: translateX(0);
}

.product-item .thumb-group .yith-wcwl-add-to-wishlist {
    -webkit-transition: all 0.2s ease 0s;
    -moz-transition: all 0.2s ease 0s;
    -o-transition: all 0.2s ease 0s;
    transition: all 0.2s ease 0s;
    font-size: 0;
    background-color: #333;
}

.product-item .thumb-group .quick-wiew-button {
    -webkit-transition: all 0.4s ease 0s;
    -moz-transition: all 0.4s ease 0s;
    -o-transition: all 0.4s ease 0s;
    transition: all 0.4s ease 0s;
    font-size: 0;
    background-color: #333;
    padding: 0;
}

.product-item .thumb-group .quick-wiew-button::before {
    font-size: 18px;
    content: "\f12d";
    font-family: 'Flaticon';
    font-weight: normal;
}

.product-item .thumb-group .loop-form-add-to-cart {
    -webkit-transition: all 0.6s ease 0s;
    -moz-transition: all 0.6s ease 0s;
    -o-transition: all 0.6s ease 0s;
    transition: all 0.6s ease 0s;
}

.product-item .thumb-group .loop-form-add-to-cart .single_add_to_cart_button {
    font-size: 0;
    background-color: transparent;
    padding: 0;
}

.product-item .thumb-group .loop-form-add-to-cart .single_add_to_cart_button::before {
    font-family: 'Flaticon';
    content: "\f137";
    font-size: 18px;
    color: #fff;
    font-weight: normal;
}

.product-item:hover .thumb-group .quick-wiew-button,
.product-item:hover .thumb-group .yith-wcwl-add-to-wishlist,
.product-item:hover .thumb-group .loop-form-add-to-cart {
    opacity: 1;
    visibility: visible;
}

.product-item .thumb-group .loop-form-add-to-cart:hover {
    background-color: #5d9d23;
}

.product-item .thumb-group .loop-form-add-to-cart:hover .single_add_to_cart_button::before {
    color: #fff;
}

.product-item .thumb-group .quick-wiew-button:hover,
.product-item .thumb-group .button.quick-wiew-button:hover {
    color: #fff;
    background-color: #5d9d23;
}

.product-item .thumb-group .yith-wcwl-add-to-wishlist:hover {
    background-color: #5d9d23;
}

.product-item .thumb-group .yith-wcwl-add-to-wishlist:hover a {
    color: #fff;
}

.shop-grid-content.full-width .shop-top-control .select-item {
    width: 23.2%;
}

.product-item.style2 .product-inner {
    display: table;
    border: 1px solid #eee;
}

.product-item.style2 .product-thumb {
    width: 240px;
    margin-bottom: 0;
    display: table-cell;
    vertical-align: middle
}

.product-item.style2 .yith-wcwl-add-to-wishlist {
    display: none;
}

.product-item.style2 .product-info {
    text-align: left;
    padding-left: 20px;
    display: table-cell;
    vertical-align: middle;
    opacity: 1;
}

.product-item.style2 .product-name {
    font-size: 22px;
    margin-bottom: 9px;
}

.product-item.style2 .product-name a {
    color: #222222;
}

.product-item.style2 .stars-rating {
    margin-bottom: 5px;
}

.product-item.style2 .desc {
    font-size: 16px;
    color: #555555;
    margin-bottom: 15px;
}

.product-item.style2 .group-buttons .price,
.product-item.style2 .group-buttons .added_to_cart {
    vertical-align: middle;
    color: #222222;
}

.product-item.style2 .group-buttons .price {
    padding: 0 10px 15px 0;
    border-right: 0;
    font-size: 16px
}

.product-item.style2 .group-buttons .button {
    background-color: #000;
}

.product-item.style-2 .group-buttons .added_to_cart {
    background: transparent;
    border: 1px solid #dddddd;
    position: relative;
    text-align: center;
    text-transform: uppercase;
}

.product-item.style-2 .group-buttons .added_to_cart:hover {
    color: #ffffff;
}

.slider-product .slick-slider>.slick-arrow {
    width: 44px;
    height: 44px;
    text-align: center;
    line-height: 42px;
    border: 1px solid #fff;
    color: #aaaaaa;
    right: -22px;
    z-index: 33;
    background: #ffffff;
    border-radius: 50%;
    opacity: 0;
    visibility: hidden;
    -webkit-box-shadow: 0px 0px 9px 0px rgba(0, 0, 0, 0.1);
    -moz-box-shadow: 0px 0px 9px 0px rgba(0, 0, 0, 0.1);
    box-shadow: 0px 0px 9px 0px rgba(0, 0, 0, 0.1);
}

.slider-product:hover .slick-slider>.slick-arrow {
    opacity: 1;
    visibility: visible;
}

.slider-product .slick-slider>.slick-arrow:first-child {
    left: -22px;
}

.product-item.style-list .product-top {
    position: absolute;
    z-index: 1;
}

.product-item.style-list .products-bottom-content {
    display: table;
    width: 100%
}

.product-item.style-list .product-thumb {
    width: 250px;
}

.product-item.style-list .product-thumb .thumb-inner {
    position: relative;
}

.product-item.style-list .product-thumb,
.product-item.style-list .product-info-left,
.product-item.style-list .product-info-right {
    display: table-cell;
    vertical-align: top;
}

.product-item.style-list .product-info-left {
    vertical-align: top;
    padding: 0 30px;
}

.product-item.style-list .product-info-right {
    padding-left: 30px;
    border-left: 1px solid #eee;
    width: 250px;
}

.product-item .quantity {
    display: none;
}

.product-item.style-list .yith-wcwl-add-to-wishlist {
    width: 100%;
    margin-bottom: 15px;
    display: none;
}

.product-item.style-list .stars-rating {
    margin-bottom: 20px;
}

.product-item.style-list .product-info-left ul {
    padding: 0;
    margin: 0;
}

.product-item.style-list .product-info-left ul li {
    font-size: 14px;
    color: #222;
    line-height: 30px;
    display: inline-block;
}

.product-item.style-list .product-info-left .attributes-display li a:after {
    content: "/";
    display: inline-block;
    color: #888888;
}

.product-item.style-list .product-info-left .attributes-display li:last-child a:after {
    display: none;
}

.product-item.style-list .price {
    font-size: 22px;
    margin-bottom: 15px;
}

.product-item.style-list .product-list-message {
    font-size: 13px;
    color: #111;
    font-weight: 500;
    position: relative;
    padding-bottom: 15px;
    margin-bottom: 20px;
    display: inline-block;
}

.product-item.style-list .product-list-message::after {
    content: '';
    height: 2px;
    width: 36px;
    bottom: 0;
    left: 0;
    background: #e7e7e7;
    display: inline-block;
    position: absolute;
}

.product-item.style-list .product-list-message .icon {
    font-size: 20px;
}

.product-item.style-list .single_variation_wrap>.button {
    margin-bottom: 20px;
    background-color: #000;
    font-weight: 700;
    vertical-align: middle;
    height: 43px;
    padding: 0 20px;
    line-height: 41px;
}

.product-item.style-list .single_variation_wrap>.button:hover {
    color: #ffffff;
}

.full-width .product-item.style-list .product-info-right {
    width: 270px;
}

.quantity .control {
    display: table;
    border: 1px solid #e9e9e9;
    width: 100%;
    padding: 0 10px;
}

.quantity .control {
    display: table;
    border: 1px solid #e9e9e9;
    width: 100%;
    padding: 0 10px;
    border-radius: 0;
}

.quantity .control .btn-number,
.quantity .control .input-qty {
    display: table-cell;
    vertical-align: middle;
}

.quantity .control .btn-number {
    font-size: 23px;
    color: #d9d9d9;
    font-weight: 500;
}

.quantity .control .input-qty {
    border: none;
    padding: 7px 0;
    text-align: center;
    font-size: 16px;
    color: #333333;
    font-weight: 500;
    width: 34px;
    height: inherit;
}

.star-rating {
    font-size: 0;
    position: relative;
    display: inline-block;
    overflow: hidden;
}

.star-rating:before,
.star-rating>span:before {
    display: inline-block;
    float: left;
    font-family: FontAwesome;
    content: "\f006\f006\f006\f006\f006";
    font-size: 13px;
    line-height: 13px;
    color: #ffb933;
    letter-spacing: 0.1em;
}

.star-rating>span {
    display: inline-block;
    position: absolute;
    top: 0;
    left: 0;
    overflow: hidden;
    line-height: 13px;
}

.star-rating .star-1 {
    width: 20%;
}

.star-rating .star-2 {
    width: 40%;
}

.star-rating .star-3 {
    width: 60%;
}

.star-rating .star-4 {
    width: 80%;
}

.star-rating .star-5 {
    width: 100%
}

.star-rating>span:before {
    content: "\f005\f005\f005\f005\f005";
    color: #ffb933;
}

.count-star {
    position: relative;
    display: inline-block;
    overflow: hidden;
    line-height: 14px;
}

.product-item .price {
    display: block;
    font-size: 14px;
    color: #5d9d23;
    font-weight: 500;
    line-height: 100%;
    margin-top: 10px;
}

.product-item .price del {
    color: #aaa;
    margin-right: 5px;
    font-size: 14px;
}

.product-item .price ins {
    text-decoration: none;
}

.error-404 {
    display: table;
    padding: 60px 0 0;
    width: 100%;
}

.error-404 .images {
    display: table-cell;
    vertical-align: middle;
    text-align: right;
}

.error-404 .text-404 {
    display: table-cell;
    vertical-align: middle;
    padding-left: 40px;
}

.text-404 .page-title {
    font-size: 36px;
    font-weight: 700;
    color: #111111;
    text-transform: capitalize;
    margin-bottom: 25px;
    line-height: 1;
    margin-top: 110px;
}

.text-404 .page-content {
    font-size: 15px;
    line-height: 24px;
    color: #888888;
}

.text-404 .page-content .hightlight {
    color: #222222;
    font-weight: 500;
    cursor: pointer;
}

.error-404 .search-form .search-field {
    display: inline-block;
    margin-right: 5px;
    margin-bottom: 30px;
}

.error-404 .search-form {
    -webkit-transition: .35s;
    -o-transition: .35s;
    transition: .35s;
}

.error-404 .search-form.open {
    opacity: 1;
    visibility: visible;
    -webkit-transform: translateY(0);
    -moz-transform: translateY(0);
    -ms-transform: translateY(0);
    -o-transform: translateY(0);
    transform: translateY(0);
}

.emeriss-google-maps {
    min-height: 480px;
}

.form-contact {
    background-color: #ffffff;
    -webkit-box-shadow: 0 0 12px 0 rgba(2, 2, 2, 0.16);
    -moz-box-shadow: 0 0 12px 0 rgba(2, 2, 2, 0.16);
    box-shadow: 0 0 12px 0 rgba(2, 2, 2, 0.16);
    border-radius: 0;
    overflow: hidden;
}

.form-contact::after,
.form-contact::before {
    display: table;
    content: '';
}

.form-contact::after {
    clear: both;
}

.form-message {
    padding-top: 55px;
    padding-bottom: 55px;
    background-color: #ffffff;
}

.form-message .title {
    font-size: 16px;
    font-weight: 500;
    color: #222222;
    text-align: left;
    font-style: normal;
    margin-bottom: 27px;
    font-family: "Segoe UI", "Fira Sans", "Droid Sans", "Helvetica Neue", "Source Sans Pro", sans-serif;
}

.emeriss-contact-fom p:last-child {
    margin-bottom: 0;
}

.emeriss-contact-fom .form-label {
    font-size: 14px;
    line-height: 16px;
    display: block;
    margin-bottom: 5px;
}

.emeriss-contact-fom .form-control {
    position: relative;
    overflow: hidden;
}

.emeriss-contact-fom .form-control:focus {
    -webkit-box-shadow: none;
    box-shadow: none;
}

.emeriss-contact-fom .your-textarea {
    border: 1px solid #eeeeee;
}

.emeriss-contact-fom .button-submit {
    min-width: 157px;
}

.form-contact-information {
    padding-top: 55px;
    padding-right: 25px;
    padding-bottom: 45px;
    padding-left: 25px;
    background-color: #111111;
}

.emeriss-contact-info .title {
    font-size: 16px;
    font-weight: 500;
    color: #fff;
    margin-bottom: 55px;
    font-family: "Segoe UI", "Fira Sans", "Droid Sans", "Helvetica Neue", "Source Sans Pro", sans-serif;
    text-transform: uppercase;
}

.emeriss-contact-info .item {
    display: block;
    overflow: hidden;
    margin-bottom: 32px;
}

.emeriss-contact-info .item .icon {
    display: inline-block;
    float: left;
    border: 1px solid #fff;
    border-radius: 50%;
    width: 42px;
    height: 42px;
    margin-right: 20px;
    text-align: center;
    line-height: 40px;
}

.emeriss-contact-info .item .icon::before {
    font-family: 'FontAwesome';
    font-size: 20px;
    color: #fff;
    display: inline-block;
    text-align: center;
}

.emeriss-contact-info .address .icon::before {
    content: "\f041";
}

.emeriss-contact-info .phone .icon::before {
    content: "\f095";
}

.emeriss-contact-info .email .icon::before {
    content: "\f003";
}

.emeriss-contact-info .item .text {
    display: block;
    color: #dddddd;
    text-transform: capitalize;
    font-size: 14px;
    overflow: hidden;
}

.emeriss-contact-info .socials {
    padding-top: 238px;
}

.emeriss-contact-info .socials .social-item {
    font-size: 23px;
    color: #555;
    margin-right: 20px;
}

.emeriss-contact-info .socials .social-item:hover {
    color: #ffffff;
}

.cart-form {
    border: 1px solid #f1f1f1;
    border-radius: 0;
}

.cart-form .shop_table {
    border: none;
    margin-bottom: 0;
}

.cart-form .shop_table thead {
    display: none;
}

.cart-form .shop_table thead>tr,
.cart-form .shop_table tbody>tr.cart_item {
    display: block;
    font-size: 0;
    line-height: 0;
    position: relative;
    text-align: left;
}

.cart-form .shop_table thead tr,
.cart-form .shop_table tr.cart_item {
    border-bottom: 1px solid #f1f1f1;
}

.cart-form .shop_table th,
.cart-form .shop_table td {
    border: none;
    text-align: left;
}

.cart-form .shop_table tbody>tr>td {
    padding: 30px 30px 30px 0;
}

.cart-form .shop_table tbody tr.cart_item td.product-remove {
    position: absolute;
    top: 50%;
    -webkit-transform: translateY(-50%);
    -moz-transform: translateY(-50%);
    -ms-transform: translateY(-50%);
    -o-transform: translateY(-50%);
    transform: translateY(-50%);
    right: 60px;
    width: 20px;
    font-size: 0;
    font-weight: 700;
    text-align: right;
    padding: 30px 0;
}

td.product-checkout {
    position: absolute;
    top: 50%;
    -webkit-transform: translateY(-50%);
    -moz-transform: translateY(-50%);
    -ms-transform: translateY(-50%);
    -o-transform: translateY(-50%);
    transform: translateY(-50%);
    right: 100px;
    width: 20px;
    font-size: 0;
    font-weight: 700;
    text-align: right;
    padding: 30px 0;
}

.shop_table td.product-remove a {
    display: block;
    font-size: 20px
}

.cart-form .product-remove a:before {
    content: "\f014";
    font-family: FontAwesome;
    font-size: 20px;
    color: #aaa;
}

.cart-form .shop_table thead th,
.cart-form .shop_table tbody tr.cart_item td {
    display: inline-block;
    line-height: 24px;
    border: none;
    text-align: left;
}

.cart-form .shop_table .product-thumbnail {
    width: 160px;
    padding-left: 30px;
}

.cart-form .shop_table .product-thumbnail img {
    width: 200px;
}

.cart-form .shop_table .product-name {
    color: #333333;
    width: 35%;
    font-size: 16px;
}

.cart-form .shop_table .product-name a {
    display: block;
    font-weight: 500;
    font-size: 16px;
}

.cart-form .shop_table .cart_inq_list_quantity {
    border: 1px solid black;
    padding: 7px 0;
    text-align: center;
    font-size: 16px;
    color: #333333;
    font-weight: 500;
    width: 84px;
    height: inherit;
}

.cart-form .shop_table .product-name .attributes-select {
    display: inline-block;
    font-size: 14px;
    color: #888888;
    cursor: pointer;
}

.cart-form .shop_table .product-name .attributes-size {
    text-transform: capitalize;
}

.cart-form .shop_table .product-quantity {
    width: 22%
}

.cart-form .shop_table .product-quantity .quantity {
    display: block;
    border: 1px solid #f1f1f1;
    padding: 0 6px;
    width: 75px;
    text-align: center;
}

.cart-form .shop_table .product-quantity .quantity .control {
    border: none;
}

.cart-form .shop_table .product-price {
    width: 20%;
    font-size: 20px;
    color: #111;
    font-weight: 500;
}

.cart-form .shop_table tbody>tr>td.actions {
    padding: 50px 60px 50px 30px;
}

.shop_table .actions .coupon {
    position: relative;
    display: inline-block;
}

.shop_table .actions>.order-total {
    float: right;
    padding: 8px 0;
}

.cart-form .shop_table .actions .coupon_code {
    font-size: 16px;
    font-weight: 500;
    color: #333333;
}

.cart-form .shop_table .actions input[type="text"] {
    min-width: 281px;
    color: #888888;
}

.cart-form .coupon .button {
    font-size: 0;
    padding: 0;
    width: 42px;
    height: 42px;
    line-height: 40px;
    color: #aaaaaa;
    position: absolute;
    top: 0;
    right: 0;
    border: none;
    text-align: center;
    cursor: pointer;
    background: transparent;
}

.shop_table .actions .coupon .button::after {
    content: '\f061';
    display: inline-block;
    font-family: 'FontAwesome';
    font-size: 14px;
}

.shop_table .actions .order-total span {
    color: #333333;
    text-transform: capitalize;
    font-weight: 500;
}

.shop_table .actions .order-total .title {
    font-size: 16px;
}

.shop_table .actions .order-total .total-price {
    font-size: 20px;
}

.shoppingcart-content .control-cart {
    text-align: right;
    margin-top: 30px;
}

.shoppingcart-content .control-cart .button {
    background: transparent;
    color: #333333;
    border: 1px solid #e9e9e9;
    margin-left: 15px;
}

.shoppingcart-content .control-cart .button:hover {
    color: #ffffff;
}

.header-banner.banner-image .banner-wrap {
    background-image: url(/img/about.bg.vsc.jpg) !important;
    background-position: center !important;
    background-repeat: no-repeat !important;
    background-size: cover !important;
    position: relative;
}

.header-banner.banner-image .banner-wrap::after,
.header-banner.banner-image .banner-wrap::before {
    display: table;
    content: '';
}

.header-banner.banner-image .banner-wrap::after {
    clear: both;
}

.header-banner.banner-image .banner-wrap .content-inner {
    padding-top: 65px;
    padding-bottom: 65px;
}

.header-banner .title {
    font-size: 34px;
    line-height: 35px;
    text-align: left;
    font-style: normal;
    font-weight: 700;
    margin-bottom: 20px;
    font-family: 'Oswald', serif;
}

.header-banner .sub-title {
    font-size: 16px;
    color: #888888;
    text-align: left;
    margin-bottom: 35px;
}

.header-banner .button {
    color: #ffffff;
    height: 43px;
    line-height: 39px;
    padding: 0 15px;
}

.header-banner .emeriss-button.button {
    background-color: #5d9d23;
    border-color: #5d9d23;
    margin-top: 0;
    box-shadow: 0 0 10px #5d9d23;
}

.emeriss-iconbox.layout1 {
    margin-top: 63px;
}

.emeriss-iconbox.layout1 .icon-item {
    position: relative;
    margin-bottom: 15px;
    color: #222222;
}

.emeriss-iconbox.layout1 .icon-item .placeholder-text {
    font-size: 90px;
    color: #555;
    opacity: 0.1;
    line-height: 1;
    display: block;
    font-weight: 500;
    display: none;
}

.emeriss-iconbox.layout1 .icon-item .icon {
    left: 3px;
    font-size: 60px;
    bottom: 20px;
    color: #5d9d23;
}

.emeriss-iconbox .content .title {
    font-size: 15px;
    text-transform: uppercase;
    font-weight: 700;
}

.emeriss-iconbox.layout1 .content .title {
    color: #222;
    margin-bottom: 8px;
}

.team-member .border-custom {
    margin-top: 75px;
}

.team-member .custom_blog_title {
    margin-top: 65px;
    margin-bottom: 50px;
    text-transform: capitalize;
}

.custom_blog_title.center {
    text-align: center;
}

.emeriss-team-member {
    text-align: center;
    padding: 0 15px;
}

.emeriss-team-member .member_avatar img {
    margin: 0 auto;
    border-radius: 50%;
}

.emeriss-team-member .member_name {
    font-size: 15px;
    text-transform: uppercase;
    font-weight: 500;
    color: #222;
    margin-top: 20px;
    margin-bottom: 3px;
}

.team-member-slider.nav-center .slick-arrow {
    top: calc(50% - 50px);
    transform: none;
    opacity: 0;
    visibility: hidden;
}

.team-member-slider:hover .slick-arrow {
    opacity: 1;
    visibility: visible;
}

.sevice-item.style-1 {
    padding-bottom: 60px;
    border-bottom: 1px solid #e9e9e9;
    margin-bottom: 60px;
}

.sevice-box-wrap {
    position: relative;
}

.sevice-box-content {
    padding: 0 45px;
    position: absolute;
    text-align: center;
    top: 50%;
    -webkit-transform: translateY(-50%);
    -ms-transform: translateY(-50%);
    -o-transform: translateY(-50%);
    transform: translateY(-50%);
    width: 100%;
}

.sevice-box-content .sevice-title {
    font-size: 32px;
    font-weight: 700;
    color: #222;
    line-height: 1.3;
    margin-bottom: 25px;
}

.sevice-box-content .sevice-title span {
    display: block;
}

.sevice-box-content .sevide-desc {
    margin: 0 0 35px;
}

.sevice-box-content .sevice-button {
    border: 1px solid #e9e9e9;
    min-width: 206px;
    height: 43px;
    line-height: 38px;
    color: #333;
    display: inline-block;
    padding: 0 15px;
    font-size: 12px;
    font-weight: 700;
}

.sevice-box-content .sevice-button:hover {
    color: #ffffff;
}

.wapper-slider-lookbook {
    padding: 60px 0;
    background: #f4f4f4;
}

.slider-lookbook-item {
    padding: 0 15px;
}

.slider-lookbook-item .lookbook-inner {
    padding: 30px;
    background: #ffffff;
    overflow: hidden;
}

.slider-lookbook-item .lookboox-thumb {
    float: left;
    max-width: 200px;
}

.slider-lookbook-item .lookboox-infore {
    text-align: center;
    padding: 35px 0 0 50px;
    overflow: hidden;
}

.slider-lookbook-item .name-lookbook {
    font-size: 20px;
    text-transform: capitalize;
    margin-bottom: 45px;
    font-weight: 700;
}

.slider-lookbook-item .view-the-look {
    color: #aaaaaa;
    font-size: 13px;
    font-weight: 700;
    text-transform: uppercase
}

.slider-lookbook.nav-center>.slick-arrow {
    width: 50px;
    border: 1px solid #eeeeee;
    text-align: center;
    line-height: 48px;
    background: #ffffff;
}

.slider-lookbook.nav-center>.slick-arrow:hover {
    background: #ffffff;
}

.slick-slider.slider-lookbook.nav-center>.slick-arrow {
    right: -40px;
}

.slick-slider.slider-lookbook.nav-center>.slick-arrow:first-child {
    left: -40px;
}

.sevice-item.style-1:last-child {
    padding-bottom: 0;
    margin-bottom: 0;
    border-bottom: 0;
}

.checkout-form {
    display: inline-block;
    padding: 40px 30px;
    border: 1px solid #f3f3f3;
    margin-bottom: 25px;
    width: 100%;
    border-radius: 0;
}

.checkout-wrapp .row-col {
    display: inline-block;
    float: left;
}

.checkout-wrapp .row-col-1 {
    width: 57.264957%;
    padding-right: 15px;
}

.checkout-wrapp .row-col-2 {
    width: 42.735043%;
    padding-left: 135px;
}

.title-form {
    font-size: 18px;
    font-weight: 500;
    color: #222222;
    margin-bottom: 25px;
    padding-bottom: 10px;
    position: relative;
}

.title-form::before {
    content: '';
    position: absolute;
    left: 0;
    bottom: 0;
    border-bottom: 2px solid #5d9d23;
    width: 30px;
}

.shipping-address .form-row:not(.form-row-last) {
    clear: left;
}

.shipping-address .form-row.form-row-first,
.shipping-address .form-row.form-row-last {
    display: inline-block;
    width: calc(50% - 10px);
    overflow: visible;
}

.shipping-address .form-row.form-row-last {
    float: right;
}

.shipping-address .form-row .text {
    display: block;
    font-weight: 500;
    font-size: 14px;
    color: #333;
    text-transform: capitalize;
}

.checkout-wrapp .form-row .input-text {
    width: 100%;
}

.checkout-wrapp .forn-row-col {
    width: 33%;
    display: inline-block;
    padding: 0 8px;
}

.checkout-wrapp .forn-row-col.forn-row-col-1 {
    padding-left: 0
}

.checkout-wrapp .forn-row-col.forn-row-col-3 {
    padding-right: 0;
    float: right;
}

.checkout-wrapp .chosen-container {
    width: 100% !important;
}

.checkout-wrapp .chosen-container-single .chosen-single {
    background: transparent;
    font-weight: 400;
    text-transform: capitalize;
}

.checkout-wrapp .chosen-container-single .chosen-single div {
    right: 10px;
}

.your-order .title-form {
    margin-bottom: 35px;
    position: relative;
    padding-bottom: 10px;
}

.list-product-order {
    padding: 0;
    margin: 0;
}

.list-product-order li {
    list-style: none;
    overflow: hidden;
    padding-bottom: 30px;
    margin-bottom: 30px;
    border-bottom: 1px solid #f3f3f3
}

.list-product-order li:last-child {
    padding-bottom: 0;
    border-bottom: 0;
    margin-bottom: 35px;
}

.list-product-order .product-thumb {
    float: left;
    width: 100px;
    margin-right: 30px;
}

.list-product-order .product-order-inner {
    overflow: hidden;
}

.list-product-order .product-name {
    font-size: 16px;
    color: #333333;
    margin-bottom: 5px;
    margin-top: 5px;
    position: relative;
}

.list-product-order .attributes-select {
    font-size: 14px;
    color: #888888;
    text-transform: capitalize;
    cursor: pointer;
    margin-bottom: 5px;
    display: inline-block;
}

.list-product-order .attributes-size {
    text-transform: uppercase;
}

.list-product-order .price {
    font-size: 16px;
    color: #111111;
    font-weight: 500;
}

.list-product-order .price .count {
    color: #888881;
}

.your-order .order-total {
    color: #333333;
    font-weight: 500;
}

.your-order .order-total .title {
    font-size: 16px;
    text-transform: capitalize;
}

.your-order .order-total .total-price {
    font-size: 20px;
}

.checkout-wrapp .button {
    min-width: 110px;
    background: transparent;
    color: #333333;
    border: 1px solid #e9e9e9;
    margin-bottom: 50px;
}

.checkout-wrapp .button-payment {
    float: right;
    min-width: 135px;
}

.checkout-wrapp .button-payment::after {
    content: "\f061";
    font-family: "FontAwesome";
    font-size: 13px;
    color: #aaaaaa;
    margin-left: 10px;
}

.checkout-wrapp .button:hover,
.checkout-wrapp .button:hover:after,
.button-control .btn-back-to-shipping:hover::before {
    color: #ffffff;
}

.payment-method-wrapp .button-control {
    float: right;
}

.payment-method .title-form {
    margin-bottom: 35px;
}

.checkout-wrapp .group-button-payment .button {
    margin-bottom: 20px;
    margin-right: 15px;
}

.checkout-wrapp .group-button-payment .btn-credit-card {
    min-width: 155px;
    color: #ffffff;
}

.payment-method .form-row-card-number {
    max-width: 360px;
}

.form-row-card-number .input-text {
    text-align: center;
}

.payment-method-wrapp .button-control .button {
    margin-left: 15px;
}

.payment-method-wrapp .button-control .btn-pay-now {
    color: #ffffff;
}

.button-control .btn-back-to-shipping::before {
    content: "\f060";
    font-family: "FontAwesome";
    font-size: 13px;
    color: #aaaaaa;
    margin-right: 10px;
}

.end-checkout {
    text-align: center;
    padding: 50px 30px;
    margin-bottom: 0;
}

.end-checkout .icon {
    display: inline-block;
    width: 98px;
    height: 98px;
    border: 3px solid #5d9d23;
    border-radius: 50%;
    line-height: 102px;
    text-align: center;
    margin-bottom: 25px;
}

.end-checkout .icon::before {
    content: url("../img/demo/icon-checkout.png");
}

.end-checkout .title-checkend {
    font-size: 18px;
    color: #222222;
}

.end-checkout .sub-title {
    font-size: 14px;
    color: #555555;
    margin: 0 auto 40px;
    max-width: 570px;
}

.end-checkout .button {
    min-width: 200px;
    margin-bottom: 0;
    color: #ffffff;
}

.end-checkout .button:hover,
.payment-method-wrapp .button-control .btn-pay-now:hover,
.checkout-wrapp .group-button-payment .btn-credit-card:hover {
    background: #333333 !important;
    border-color: #333333 !important;
}

.details-thumd {
    width: 400px;
    float: left;
    padding-right: 20px;
    position: relative;
    min-height: 100%;
}

.details-infor {
    width: 49.8759%;
    float: right;
}

.details-thumd .thumbnails_carousel .owl-item a {
    display: block;
    position: relative;
}

.details-thumd .thumbnails_carousel .owl-item a::before {
    border: 1px solid #eee;
    position: absolute;
    left: 1px;
    right: 1px;
    top: 1px;
    bottom: 1px;
    content: '';
    z-index: 1;
    border-radius: 0;
}

.details-thumd .thumbnails_carousel .owl-item a.active::before {
    border-color: #5d9d23;
}

.details-thumd .thumbnails_carousel .owl-item img {
    margin: 0 auto;
}

.details-thumd .image-preview-container {
    position: relative;
    border: 1px solid #eee;
    margin-bottom: 10px;
    overflow: hidden;
    border-radius: 0;
    min-height: 100%;
}

.details-product .details-thumd .image-preview-container {
    box-shadow: 0 0 2px rgb(0 0 0 / 15%);
}

@media (max-width: 480px) {
    .details-thumd .image-preview-container {
        padding-top: 10px;
        padding-bottom: 10px;
        background: #fff;
    }
}

.btn-zoom.open_qv {
    position: absolute;
    width: 40px;
    height: 40px;
    right: 10px;
    top: 10px;
    border-radius: 50%;
    overflow: hidden;
    border: 1px solid #dddddd;
    background-color: #fff;
    text-align: center;
    line-height: 38px;
    z-index: 32;
}

.btn-zoom.open_qv:hover {
    color: #ffffff;
}

.zoomContainer:nth-child(n+1),
.zoomContainer:first-child {
    display: none !important;
}

.zoomContainer:last-child {
    display: block !important;
}

.details-thumd .product-preview {
    padding: 0 40px;
}

.details-thumd .owl-thumb-item {
    font-size: 0;
    display: none;
}

.details-thumd .owl-nav .owl-next {
    right: -40px;
}

.details-thumd .owl-nav .owl-prev {
    left: -40px;
}

.details-thumd .owl-nav div {
    width: 35px;
    height: 35px;
    border: 1px solid #eeeeee;
    text-align: center;
    line-height: 30px;
    display: inline-block;
    position: absolute;
    top: 50%;
    transform: translateY(-50%);
    font-size: 20px;
    color: #aaaaaa;
    background: #ffffff;
    z-index: 33;
    border-radius: 50%;
}

.details-infor .product-title {
    font-size: 26px;
    font-weight: 700;
    color: #363636;
    margin-bottom: 9px;
    word-wrap: break-word
}

.details-infor .stars-rating {
    display: inline-block;
    vertical-align: middle;
    margin-bottom: 5px;
}

.details-infor .availability {
    text-transform: capitalize;
    font-size: 14px;
    color: #555555;
    margin-bottom: 10px;
}

.details-infor .availability a {
    font-weight: 700;
}

.details-infor .price {
    font-size: 22px;
    font-weight: 500;
    color: #111111;
    margin-bottom: 20px;
}

.details-infor .product-details-description {
    font-size: 14px;
    color: #555555;
    margin-bottom: 15px;
}

.details-infor .variations .text-attribute {
    font-size: 14px;
    font-weight: 700;
}

.details-infor .variations .text-attribute span {
    color: #212121;
    font-weight: normal;
}

.details-infor .variations .basic-attr {
    line-height: 18px;
    padding-bottom: 10px;
    padding-top: 10px;
}

.details-infor .variations div.attribute {
    margin-bottom: -10px;
}

.attribute .list-item {
    overflow: hidden;
    margin: 15px 0 10px;
}

.attribute_color .list-color a {
    display: inline-block;
    height: 27px;
    margin-bottom: 15px;
    margin-right: 10px;
    position: relative;
    text-align: center;
    width: 26px;
    line-height: 27px;
    float: left;
    border-radius: 0;
}

.attribute_color .list-color a:last-child {
    margin-right: 0;
}

.attribute_color .list-color .color1 {
    border: 1px solid #eeeeee
}

.attribute_color .list-color .color2 {
    background: #222222;
}

.attribute_color .list-color .color3 {
    background: #4a5365;
}

.attribute_color .list-color .color4 {
    background: #84664d;
}

.attribute_color .list-color a:hover::before,
.attribute_color .list-color a.active::before {
    color: #fff;
    content: "\f00c";
    display: inline-block;
    font-family: FontAwesome;
    font-size: 12px;
    left: 0;
    position: absolute;
    width: 100%;
}

.attribute_color .list-color .color1:hover::before,
.attribute_color .list-color .color1.active::before {
    color: #222222;
}

.attribute_size .list-size a {
    display: inline-block;
    min-width: 54px;
    line-height: 30px;
    height: 30px;
    border: 1px solid #eeeeee;
    text-align: center;
    margin-right: 10px;
    margin-bottom: 15px;
    text-transform: uppercase;
    font-weight: 500;
    border-radius: 0;
}

.attribute_size .list-size a.active,
.attribute_size .list-size a:hover {
    color: #ffffff;
}

.details-infor .group-button .yith-wcwl-add-to-wishlist,
.details-infor .group-button .size-chart-wrapp {
    display: inline-block;
    vertical-align: middle;
    margin-bottom: 25px;
    font-size: 14px;
    color: #555555;
}

.details-infor .group-button .size-chart-wrapp {
    margin-left: 25px;
}

.details-infor .group-button .yith-wcwl-add-to-wishlist div a::before,
.details-infor .group-button .size-chart-wrapp .btn-size-chart a::before {
    font-family: 'FontAwesome';
    margin-right: 7px;
    color: #ccc;
    font-size: 18px;
    line-height: normal;
    vertical-align: middle;
    display: inline-block;
    margin-top: -2px;
}

.details-infor .group-button .yith-wcwl-add-to-wishlist div a::before {
    content: "\f08a";
}

.details-infor .group-button .yith-wcwl-add-to-wishlist div a:hover::before {
    content: "\f004";
}

.details-infor .group-button .size-chart-wrapp .btn-size-chart a::before {
    content: "\f11b";
    font-family: 'Flaticon';
}

.details-infor .quantity,
.details-infor .group-button .button {
    display: inline-block;
    vertical-align: middle;
    margin-right: 5px;
    border-radius: 5px;
}

.details-infor .quantity .control {
    padding: 1px 8px;
}

.details-infor .group-button .button {
    min-width: 130px;
    font-size: 14px;
}

.styled-table {
    border-collapse: collapse;
    box-shadow: 0 0 2px rgba(0, 0, 0, 0.15);
}

.styled-table thead tr {
    background-color: #009879;
    color: #ffffff;
    text-align: left;
}

.styled-table th,
.styled-table td {
    padding: 12px 15px;
}

.styled-table tbody tr {
    border-bottom: 1px solid #dddddd;
}

.styled-table tbody tr:nth-of-type(even) {
    background-color: #F7F7F7;
}

.styled-table tbody tr.active-row {
    font-weight: bold;
    color: #5d9d23;
}

.tab-details-product {
    margin-top: 30px;
    width: 100%;
    float: left;
}

.tab-details-product .tab-link {
    margin-bottom: 10px;
    padding: 0;
    padding-bottom: 4px;
}

.no-sidebar .tab-details-product .tab-link {
    text-align: center;
}

.tab-details-product .tab-link li {
    list-style: none;
    display: inline-block;
    padding: 0 30px;
    font-weight: 500;
}

.tab-details-product .tab-link li:first-child {
    padding-left: 0;
}

.tab-details-product .tab-link li:last-child {
    padding-right: 0;
}

.tab-details-product .tab-link li a {
    display: inline-block;
    font-size: 18px;
    color: #bbb;
    position: relative;
}

.tab-details-product .tab-link li.active a::after {
    height: 3px;
    width: 100%;
    position: absolute;
    bottom: -4px;
    left: 0;
    content: '';
}

.tab-details-product #product-descriptions p {
    margin-bottom: 0;
}

.reviews-tab .comments .reviews-title {
    font-size: 16px;
    text-transform: uppercase;
    margin-bottom: 20px;
}

.reviews-tab .commentlist {
    padding: 0;
    margin: 0;
}

.reviews-tab .conment {
    list-style: none;
    margin-bottom: 30px;
}

.reviews-tab .avatar {
    float: left;
}

.reviews-tab .comment-text {
    overflow: hidden;
    padding-left: 30px;
}

.reviews-tab .stars-rating {
    float: right;
    display: inline-block;
}

.reviews-tab .comment-text .meta {
    border-bottom: 1px solid #eee;
    padding-bottom: 5px;
    margin-bottom: 5px;
}

.review_form .comment-reply-title {
    font-size: 14px;
    text-transform: uppercase;
    margin-bottom: 20px;
}

.comment-form-review p {
    width: 100%;
    float: left;
    margin-bottom: 30px;
}

.comment-form-review label {
    display: block;
    font-weight: normal;
}

.review_form .comment-form-review .stars {
    margin-bottom: 0;
}

.review_form .comment-form-review .stars a {
    font-size: 0;
    color: #ccc;
    display: inline-block;
    border-right: 1px solid #eee;
    padding: 0 10px;
    line-height: 13px;
    float: left;
}

.review_form .comment-form-review .stars a:last-child {
    border: none;
}

.review_form .comment-form-review .stars a:first-child {
    padding-left: 0;
}

.review_form .comment-form-review .stars a::before {
    font-family: 'FontAwesome';
    font-size: 13px;
    display: inline-block
}

.review_form .comment-form-review .stars a.star-1::before {
    content: "\f005";
}

.review_form .comment-form-review .stars a.star-2::before {
    content: "\f005\f005";
}

.review_form .comment-form-review .stars a.star-3::before {
    content: "\f005\f005\f005";
}

.review_form .comment-form-review .stars a.star-4::before {
    content: "\f005\f005\f005\f005";
}

.review_form .comment-form-review .stars a.star-5::before {
    content: "\f005\f005\f005\f005\f005";
}

.comment-form-review input[type="text"],
.comment-form-review input[type="email"],
.comment-form input[type="url"] {
    clear: both;
    float: left;
    padding: 6px 15px;
    width: 48%;
}

.comment-form-review .form-submit .submit {
    padding: 9px 30px;
}

.related,
.up-sells {
    position: relative;
}

.product-grid-title {
    font-size: 20px;
    color: #222222;
    text-align: center;
    font-style: normal;
    margin-bottom: 16px;
    position: relative;
    font-weight: 700;
    letter-spacing: 0;
    display: table;
    margin-left: auto;
    margin-right: auto;
    padding-bottom: 10px;
    font-family: "Segoe UI", "Fira Sans", "Droid Sans", "Helvetica Neue", "Source Sans Pro", sans-serif;
    padding-top: 20px;
}

.product-grid-title::before {
    position: absolute;
    content: '';
    width: 70px;
    border-bottom: 4px solid #5d9d23;
    bottom: 0;
    left: 50%;
    -webkit-transform: translateX(-50%);
    -moz-transform: translateX(-50%);
    -ms-transform: translateX(-50%);
    -o-transform: translateX(-50%);
    transform: translateX(-50%);
}

.related .product-item,
.up-sells .product-item {
    margin-bottom: 0;
}

.related .slick-slider.nav-center>.slick-arrow,
.up-sells .slick-slider.nav-center>.slick-arrow {
    color: #aaaaaa;
    width: 35px;
    height: 35px;
    text-align: center;
    line-height: 30px;
    border: 1px solid #f3f3f3;
    font-size: 20px;
    opacity: 0;
    right: 50px;
    visibility: hidden;
    background: #ffffff;
    -moz-transition: all 0.45s ease;
    -webkit-transition: all 0.45s ease;
    -o-transition: all 0.45s ease;
    -ms-transition: all 0.45s ease;
}

.related .slick-slider.nav-center>.slick-arrow:first-child,
.up-sells .slick-slider.nav-center>.slick-arrow:first-child {
    left: 50px;
}

.related:hover .slick-slider.nav-center>.slick-arrow,
.up-sells:hover .slick-slider.nav-center>.slick-arrow {
    opacity: 1;
    visibility: visible;
    right: -20px;
}

.related:hover .slick-slider.nav-center>.slick-arrow:first-child,
.up-sells:hover .slick-slider.nav-center>.slick-arrow:first-child {
    left: -20px;
}

.full-width .details-thumd {
    padding-right: 70px;
}

.full-width .details-thumd .product-preview {
    padding: 0;
}

.full-width .details-thumd .owl-nav .owl-prev {
    left: -17px;
}

.full-width .details-thumd .owl-nav .owl-next {
    right: -17px;
}

.slider-item .slider-inner {
    background-position: center;
    background-repeat: no-repeat;
    background-size: cover;
    position: relative;
    border-radius: 0;
    overflow: hidden;
}

.slider-item .title-small {
    color: #5d9d23;
    font-size: 14px;
    letter-spacing: 0.05em;
    font-weight: 700;
    padding: 0;
    text-transform: uppercase;
    margin-bottom: 12px;
}

.slider-item.slick-active .title-small {
    animation-duration: 2s;
    -webkit-animation-duration: 2s;
    animation-fill-mode: both;
    -webkit-animation-fill-mode: both;
    animation-name: bounceInDown;
    -webkit-animation-name: bounceInDown;
}

.slider-item .title-big {
    font-size: 36px;
    color: #fff;
    font-weight: 700;
    line-height: 1;
    max-width: 370px;
    font-family: "Segoe UI", "Fira Sans", "Droid Sans", "Helvetica Neue", "Source Sans Pro", sans-serif;
    text-transform: capitalize;
}

.slider-item.slick-active .title-big {
    animation-duration: 2s;
    -webkit-animation-duration: 2s;
    animation-fill-mode: both;
    -webkit-animation-fill-mode: both;
    animation-name: bounceInRight;
    -webkit-animation-name: bounceInRight;
}

.slider-item .price {
    font-size: 18px;
    letter-spacing: -0.05em;
    font-weight: 500;
    display: block;
    color: #dbdbdb;
    margin-bottom: 35px;
}

.slider-item.slick-active .price,
.slider-item.slick-active .description {
    animation-duration: 2s;
    -webkit-animation-duration: 2s;
    animation-fill-mode: both;
    -webkit-animation-fill-mode: both;
    animation-name: bounceInLeft;
    -webkit-animation-name: bounceInLeft;
}

.slider-item .price .number-price {
    text-transform: uppercase;
    font-size: 28px;
    color: #5d9d23;
    font-weight: 700;
    position: relative;
}

.slider-item .slider-infor .button {
    padding-top: 7px;
    padding-bottom: 7px;
    padding-right: 20px;
    padding-left: 20px;
    background: #795548;
    border: 1px solid #5d9d23;
    color: #fff;
    margin-right: 5px;
    min-width: 110px;
    border-radius: 0;
}

.slider-item.slick-active .slider-infor .button {
    animation-duration: 2s;
    -webkit-animation-duration: 2s;
    animation-fill-mode: both;
    -webkit-animation-fill-mode: both;
    animation-name: bounceInUp;
    -webkit-animation-name: bounceInUp;
}

.slider-item .slider-infor .button:last-child {
    margin-right: 0;
}

.slider-item .slider-infor .button:hover {
    background: #ffffff;
    border-color: #ffffff;
}

.slider-item.style1 .slider-inner {
    background-image: url(../img/banner/black.jpg);
}

.slider-item.style1 .slider-inner.mobile {
    background-image: url(../img/banner/black-m.jpg);
}

.slider-item.style1 .slider-inner .slider-infor,
.slider-item.style3 .slider-inner .slider-infor {
    padding-bottom: 126px;
    padding-top: 139px;
    padding-left: 680px;
    padding-right: 170px;
}

.slider-item.style2 .slider-inner {
    background-image: url(../img/banner/white.jpg);
}

.slider-item.style2 .slider-inner.mobile {
    background-image: url(../img/banner/white-m.jpg);
}

.slider-item.style2 .slider-inner .slider-infor {
    padding-bottom: 160px;
    padding-top: 155px;
    padding-left: 680px;
    padding-right: 170px;
}

.slider-item.style2 .title-big {
    margin-bottom: 23px;
    color: #5d9d23;
}

.slider-item.style2 .title-big span {
    position: relative;
    color: #5d9d23;
}

.slider-item.style3 .slider-inner {
    background-image: url(../img/banner/grey.jpg);
}

.home-slider.style1 {
    padding-top: 15px;
}

.home-slider .slick-slider.nav-center>.slick-arrow {
    width: 52px;
    height: 52px;
    background-color: #fff;
    font-size: 30px;
    text-align: center;
    line-height: 52px;
    opacity: 0;
    right: 30px;
    visibility: hidden;
    -moz-transition: all 0.45s ease;
    -webkit-transition: all 0.45s ease;
    -o-transition: all 0.45s ease;
    -ms-transition: all 0.45s ease;
}

.home-slider .slick-slider.nav-center>.slick-arrow:first-child {
    left: 30px;
}

.home-slider:hover .slick-slider.nav-center>.slick-arrow:first-child {
    left: 15px;
}

.home-slider:hover .slick-slider.nav-center>.slick-arrow {
    right: 15px;
    opacity: 1;
    visibility: visible;
}

.emeriss-newsletter.default {
    padding-top: 30px;
    padding-right: 30px;
    padding-bottom: 35px;
    padding-left: 30px;
    background-image: url(../img/demo/newsletter-bg.jpg);
    background-position: center;
    background-repeat: no-repeat;
    background-size: cover;
    margin-bottom: 30px;
    border-radius: 0;
}

.emeriss-newsletter.default .title {
    font-size: 28px;
    font-weight: 700;
    margin-bottom: 0;
    font-family: 'Oswald', serif;
    color: #fff;
}

.emeriss-newsletter.default .subtitle {
    font-size: 15px;
    color: #888;
    margin-bottom: 54px;
}

.emeriss-newsletter.default .newsletter-form-wrap .email-newsletter {
    margin-bottom: 10px;
    width: 100%;
    background: #fff;
    font-size: 14px;
    text-align: center;
    color: #888;
    border-color: #fff;
}

.emeriss-newsletter.default .newsletter-form-wrap .submit-newsletter {
    width: 100%;
}

.emeriss-tabs.default.rows-space-40 {
    padding-top: 9px;
}

.emeriss-tabs .tab-head {
    margin-bottom: 30px;
}

.emeriss-tabs .tab-link {
    padding: 0;
    margin: 0;
    text-align: center;
    position: relative;
}

.emeriss-tabs .tab-link::before {
    content: '';
    top: 50%;
    left: 0;
    right: 0;
    position: absolute;
    border-top: 2px solid #F1F1F1;
    display: none;
}

.emeriss-tabs .tab-link li {
    display: inline-block;
    list-style: none;
}

.emeriss-tabs .tab-link li a {
    margin: 0 15px;
    padding: 13px 20px;
    background-color: #000;
    font-size: 13px;
    color: #fff;
    font-weight: 700;
    position: relative;
    text-transform: uppercase;
    letter-spacing: 0.1em;
    border-radius: 0;
}

.emeriss-tabs .tab-link li.active a {
    color: #fff;
    background-color: #5d9d23;
}

.emeriss-tabs .tab-link li.active a::before,
.emeriss-tabs .tab-link li a:hover::before {
    -webkit-transform: scale(1);
    -moz-transform: scale(1);
    -ms-transform: scale(1);
    -o-transform: scale(1);
    transform: scale(1);
}

.emeriss-blog-wraap.default {
    padding-top: 58px;
    padding-bottom: 63px;
}

.custommenu-title-blog {
    font-size: 24px;
    color: #222222;
    text-transform: uppercase;
    text-align: center;
    font-style: normal;
    margin-bottom: 20px;
    position: relative;
    font-weight: 700;
    letter-spacing: 0;
    display: table;
    margin-left: auto;
    margin-right: auto;
    padding-bottom: 15px;
}

.custommenu-title-blog::before {
    position: absolute;
    content: '';
    width: 70px;
    border-bottom: 4px solid #5d9d23;
    bottom: 0;
    left: 50%;
    -webkit-transform: translateX(-50%);
    -moz-transform: translateX(-50%);
    -ms-transform: translateX(-50%);
    -o-transform: translateX(-50%);
    transform: translateX(-50%);
}

.emeriss-blog .owl-slick .slick-list {
    margin-top: 0 !important;
    margin-bottom: 0 !important;
    padding: 0;
}

.emeriss-blog-item .post-thumb {
    position: relative;
}

.emeriss-blog-item .post-thumb>a::after,
.emeriss-blog-item .post-thumb .video-emeriss-blog figure::after {
    position: absolute;
    content: '';
    top: 0;
    bottom: 0;
    left: 0;
    right: 0;
    background-color: rgba(0, 0, 0, 0.3);
    -webkit-transition: opacity 0.2s ease;
    -moz-transition: opacity 0.2s ease;
    -ms-transition: opacity 0.2s ease;
    -o-transition: opacity 0.2s ease;
    transition: opacity 0.2s ease;
    opacity: 0;
}

.emeriss-blog-item .post-thumb:hover .video-emeriss-blog figure::after,
.emeriss-blog-item .post-thumb:hover>a::after {
    opacity: 1;
}

.emeriss-blog-item .post-thumb .post-item-share {
    position: absolute;
    top: 15px;
    right: 20px;
    display: none;
}

.emeriss-blog-item .post-item-share .icon {
    color: #fff;
    opacity: 0.5
}

.post-item-share .icon {
    font-size: 16px;
    color: #a3a4a6;
}

.post-item-share .box-content {
    position: absolute;
    top: 100%;
    left: 0;
    opacity: 0;
    visibility: hidden;
    -webkit-transition: .35s;
    -o-transition: .35s;
    transition: .35s;
    -webkit-transform: translateY(10px);
    -moz-transform: translateY(10px);
    -ms-transform: translateY(10px);
    -o-transform: translateY(10px);
    transform: translateY(10px);
    z-index: 5;
}

.post-item-share .box-content a {
    display: list-item;
    list-style: none;
    color: #a3a4a6;
    font-size: 15px;
}

.emeriss-blog-item .post-item-share .icon:hover {
    opacity: 1
}

.post-item-share:hover .box-content {
    opacity: 1;
    visibility: visible;
    -webkit-transform: translateY(0);
    -moz-transform: translateY(0);
    -ms-transform: translateY(0);
    -o-transform: translateY(0);
    transform: translateY(0);
}

.post-item-share .box-content a:hover {
    color: #fff;
}

.emeriss-blog-item .post-date {
    font-size: 11px;
    color: #aaa;
    padding: 15px 20px 0;
    margin-bottom: 5px;
    text-transform: uppercase;
    font-weight: 500;
    letter-spacing: 0.1em;
}

.emeriss-blog-item .blog-title {
    font-size: 16px;
    color: #333;
    margin-bottom: 15px;
    font-weight: 500;
    position: relative;
    padding-bottom: 10px;
    font-family: "Segoe UI", "Fira Sans", "Droid Sans", "Helvetica Neue", "Source Sans Pro", sans-serif;
}

.emeriss-blog-item .blog-title::before {
    content: '';
    position: absolute;
    left: 0;
    bottom: 0;
    border-bottom: 2px solid #5d9d23;
    width: 40px;
}

.emeriss-blog-item .blog-title span {
    color: #aaaaaa;
}

.emeriss-blog-item .blog-meta {
    padding: 10px 0 5px;
}

.emeriss-blog-item .blog-meta .author {
    display: inline-block;
    float: left;
    font-size: 14px;
    color: #333;
    font-weight: 500;
    text-transform: capitalize;
}

.emeriss-blog-item .blog-meta .author img {
    display: inline-block;
    width: 29px;
    height: 28px;
    border-radius: 50%;
    text-align: center
}

.emeriss-blog-item .blog-meta .view,
.emeriss-blog-item .blog-meta .comment {
    color: #aaa;
    font-size: 13px;
    font-weight: 700;
    display: none;
}

.emeriss-blog .slick-slider>.slick-arrow {
    width: 51px;
    height: 51px;
    text-align: center;
    line-height: 48px;
    border: 1px solid #eeeeee;
    color: #aaaaaa;
    right: -40px;
    z-index: 33;
    background: #ffffff;
    opacity: 0;
    visibility: hidden;
}

.emeriss-blog .slick-slider>.slick-arrow:first-child {
    left: -40px;
}

.emeriss-blog:hover .slick-slider>.slick-arrow {
    opacity: 1;
    visibility: visible;
}

.emeriss-blog-item.style2 .emeriss-blog-inner {
    overflow: hidden;
    background: #f5f5f5;
    border-radius: 0;
}

.emeriss-blog-item.style2 .post-thumb {
    float: left;
    margin-top: -2px;
    margin-left: -2px;
    margin-bottom: -2px;
}

.emeriss-blog-item.style2 .blog-info {
    overflow: hidden;
    border-left: 0;
}

.emeriss-blog-item.style2 .post-top {
    margin: 20px 20px 20px;
    position: relative;
    padding-bottom: 5px;
}

.emeriss-blog-item.style2 .post-date {
    padding-top: 0;
}

.emeriss-blog-item .post-top>a {
    font-size: 14px;
    color: #222;
    font-weight: 700;
    text-transform: uppercase;
}

.emeriss-blog-item .post-top .post-item-share {
    position: relative;
    display: none;
    float: right;
}

.emeriss-blog-item.style2 .post-top>a {
    color: #fff;
    padding: 3px 10px;
    background-color: #5d9d23;
    font-size: 11px;
    letter-spacing: 0.1em;
}

.emeriss-blog-item.style2 .post-item-share .icon {
    color: #aaa;
    font-size: 16px;
    opacity: 1;
}

.post-top .post-item-share .box-content {
    padding-top: 20px;
}

.emeriss-blog-item.style2 .post-item-share .icon:hover,
.emeriss-blog-item.style2 .post-item-share .box-content a:hover {
    color: #333333;
}

.emeriss-blog-item.style2 .blog-title {
    height: 75px;
    margin-bottom: 59px;
    overflow: hidden;
    font-size: 16px;
    padding: 0 20px;
}

.emeriss-blog-item.style2 .blog-title::before {
    left: 20px;
    display: none;
}

.emeriss-blog-item.style2 .blog-meta {
    border: none;
    padding: 0 20px;
}

.emeriss-blog-item.style2 .blog-meta .blog-meta-wrapp {
    padding: 11px 0 12px;
    border-top: 1px solid #e4e4e4;
}

.video-emeriss-blog .quick-install {
    border-radius: 50%;
    cursor: pointer;
    display: inline-block;
    height: 64px;
    left: 50%;
    line-height: 64px;
    position: absolute;
    text-align: center;
    top: 50%;
    width: 64px;
    -webkit-transform: translateX(-50%) translateY(-50%);
    -ms-transform: translateX(-50%) translateY(-50%);
    -o-transform: translateX(-50%) translateY(-50%);
    transform: translateX(-50%) translateY(-50%);
    -webkit-transition: all .6s ease-in-out;
    -moz-transition: all .6s ease-in-out;
    -ms-transition: all .6s ease-in-out;
    -o-transition: all .6s ease-in-out;
    transition: all .6s ease-in-out;
    font-size: 64px;
    color: #fff;
}

.video-emeriss-blog .quick-install::before {
    content: "\f115";
    font-family: 'Flaticon', sans-serif;
}

.video-emeriss-blog .quick-install:hover {
    -webkit-transform: translateX(-50%) translateY(-50%) scale(0.9);
    -ms-transform: translateX(-50%) translateY(-50%) scale(0.9);
    -o-transform: translateX(-50%) translateY(-50%) scale(0.9);
    transform: translateX(-50%) translateY(-50%) scale(0.9);
}

.header.style5 .bar-open-menu {
    width: 44px;
    height: 43px;
    text-align: center;
    line-height: 43px;
    border: 1px solid #e9e9e9;
    padding: 11px 10px;
    float: left;
    margin-right: 50px;
}

.header.style5 .bar-open-menu span {
    background: #555555;
}

.header.style5 .logo {
    text-align: left;
}

.header.style5 .block-search-block {
    display: inline-block;
}

.header.style5 .form-search .form-content {
    padding: 0;
}

.header.style5 .form-search .form-content .inner {
    width: 251px;
    position: relative;
    border: 1px solid #f1f1f1;
}

.header.style5 .form-search .form-content .input {
    width: 75%;
    border: none;
}

.header.style5 .form-search .form-content .btn-search {
    top: 0;
    right: 0;
    border: none;
    line-height: 38px;
    position: absolute;
    width: 25%;
    padding: 0;
    height: 100%;
    background: transparent;
    color: #888;
    font-size: 22px;
    font-weight: normal;
    margin: 0;
}

.header.style5 .header-language .emeriss-language {
    padding-top: 0;
    margin-right: 38px;
    margin-left: 62px;
}

.header.style5 .header-nav .header-language .emeriss-language {
    margin: 0;
    padding: 0;
    margin-top: 30px;
}

.header.style5 .header-nav .header-language {
    display: none;
}

.fullwidth.style2 .slick-list .slick-slide {
    padding: 0 15px;
}

.slider-item.style25 .slider-inner .slider-infor {
    padding-bottom: 139px;
    padding-top: 116px;
    padding-left: 720px;
    padding-right: 15px
}

.slider-item.style25 .price {
    margin-bottom: 45px;
}

.slider-item.style26 .slider-inner .slider-infor {
    padding-bottom: 139px;
    padding-top: 115px;
    padding-left: 720px;
    padding-right: 15px
}

.slider-item .description {
    font-size: 16px;
    line-height: 22px;
    color: #888;
    margin-bottom: 30px;
}

.slider-item.style27 .slider-inner .slider-infor {
    padding-bottom: 139px;
    padding-top: 126px;
    padding-left: 720px;
    padding-right: 15px
}

.emeriss-newsletter.style3 {
    overflow: hidden;
    padding: 63px 0 54px;
    background-image: url(../img/demo/newsletter-bg-2.jpg);
    background-position: center;
    background-repeat: no-repeat;
    position: relative;
    text-align: center;
}

.emeriss-newsletter.style3 .newsletter-form-wrap {
    display: inline-block;
    overflow: hidden;
    margin-top: 20px;
}

.emeriss-newsletter.style3 .title {
    font-size: 26px;
    font-weight: 700;
    margin-bottom: 20px;
    padding-bottom: 15px;
    position: relative;
    text-transform: uppercase;
    font-family: 'Oswald', serif;
    color: #fff;
}

.emeriss-newsletter.style3 .title::before {
    position: absolute;
    content: '';
    width: 70px;
    border-bottom: 4px solid #5d9d23;
    bottom: 0;
    left: 50%;
    -webkit-transform: translateX(-50%);
    -moz-transform: translateX(-50%);
    -ms-transform: translateX(-50%);
    -o-transform: translateX(-50%);
    transform: translateX(-50%);
    color: #fff;
}

.emeriss-newsletter.style3 .subtitle {
    margin-bottom: 15px;
    font-size: 16px;
    color: #bdbdbd;
}

.emeriss-newsletter.style3 .email-newsletter {
    width: 313px;
    border-color: #e9e9e9;
    background: #fff;
    color: #888;
    margin-bottom: 10px;
    border: none;
    text-align: left;
}

.emeriss-newsletter.style3 .submit-newsletter {
    min-width: 139px;
    margin-left: 5px;
    background-color: #5d9d23;
    color: #ffffff;
    vertical-align: top;
    font-size: 14px;
}

.header-vertical {
    padding-left: 375px;
}

.header.style6 {
    padding: 80px 40px 80px 60px;
    position: fixed;
    top: 0;
    left: 0;
    z-index: 99;
    background: #090909;
    min-height: 100vh;
    bottom: 0;
    max-width: 100%
}

.header-vertical .header {
    width: 375px;
    float: left;
}

.header.style6.vertical-style .header-nav {
    position: static;
    padding: 0;
    min-height: 0;
}

.header.style6 .header-nav .mCustomScrollbar {
    height: calc(100vh - 405px);
}

.header.style6 .logo,
.header.style6 .header-control {
    text-align: left;
}

.header.style6 .logo {
    padding-bottom: 50px;
}

.header.style6 .header-control {
    margin-bottom: 35px;
}

.header.style6 .form-search .form-content {
    padding: 0;
}

.header.style6 .form-search .form-content .inner {
    position: relative;
    border: 1px solid #353535;
    margin-bottom: 85px;
    width: 100%;
}

.header.style6 .form-search .form-content .input {
    width: 75%;
    border: none;
}

.header.style6 .form-search .form-content .btn-search {
    position: absolute;
    height: 100%;
    background: transparent;
    color: #888;
    font-size: 20px;
    font-weight: normal;
    top: 0;
    right: 0;
    border: none;
    padding: 0 15px;
    width: auto;
}

.header.style6 .header-language {
    margin-bottom: 35px;
}

.header.style6 .block-account>a,
.header.style6 .block-minicart .shopcart-icon {
    color: #ffffff;
}

.header.style6 .block-minicart .shopcart-icon {
    border-color: #353535;
}

.header-vertical .block-header .emeriss-submenu {
    right: auto;
    left: 0;
}

.header.style6 .block-minicart .shopcart-icon .count {
    background-color: #444444;
}

.item-banner .banner-content.full-height {
    text-align: center;
}

.item-banner .banner-content.full-height .title {
    font-size: 30px;
    letter-spacing: 0;
    text-transform: uppercase;
    line-height: 1.2;
    margin-bottom: 20px;
}

.item-banner.style28 .banner-content {
    padding-top: 50px;
    padding-right: 30px;
    padding-bottom: 705px;
    padding-left: 30px;
}

.item-banner.style29 .banner-content {
    padding-top: 705px;
    padding-right: 30px;
    padding-bottom: 50px;
    padding-left: 30px;
}

.item-banner.style30 .banner-content {
    padding-top: 50px;
    padding-right: 30px;
    padding-bottom: 705px;
    padding-left: 30px;
}

.item-banner.style30 .title sup {
    color: #888888;
    font-size: 16px;
    top: -0.5em;
}

.header-vertical .main-content::before,
.header-vertical .main-content::after {
    content: '';
    display: table;
}

.header-vertical .main-content::after {
    clear: both;
}

.header-vertical .main-content {
    padding: 0;
}

.item-banner .banner-content.full-height .title span {
    text-decoration: underline;
}

.header.style7 .logo {
    text-align: left;
}

.header.style7 .form-search .form-content {
    position: relative;
    display: table;
    width: 100%;
    margin: 0 auto;
    background-color: #fff;
    max-width: 584px;
    padding: 0;
    border: 2px solid #5d9d23;
    height: 43px;
    border-radius: 0;
}

.header.style7 .form-search-width-category .category,
.header.style7 .form-search-width-category .inner,
.header.style7 .form-search-width-category .btn-search {
    display: table-cell;
    vertical-align: middle;
}

.header.style7 .form-search-width-category .category {
    width: 154px;
}

.header.style7 .form-search-width-category .category .chosen-container {
    width: 154px !important;
}

.header.style7 .form-search-width-category .btn-search {
    width: 60px;
    font-size: 21px;
    font-weight: normal;
    color: #fff;
    position: relative;
    padding: 9px 0;
    margin: 0;
}

.form-search-width-category .chosen-container-single .chosen-single {
    width: 100%;
    border: none;
    background-color: transparent;
    padding: 0 20px;
    line-height: 40px !important;
    height: 40px !important;
    text-align: center;
    border-right: 1px solid #e3e3e3;
    border-radius: 0;
}

.form-search-width-category .chosen-container-single .chosen-single>span {
    display: inline-block;
    vertical-align: top;
    font-size: 14px;
    color: #888;
    margin-right: 20px;
}

.header.style7 .form-search .form-content .input {
    border: none;
    width: 100%;
}

.form-search-width-category .chosen-container-single .chosen-single div {
    right: 20px;
}

.form-search-width-category .chosen-container-single .chosen-single div b::after {
    margin-top: -8px;
}

.header.style7 .header-control .block-header {
    vertical-align: top;
}

.header-nav-container {
    background: #151515;
}

.header-nav-wapper {
    display: table;
    width: 100%;
}

.header-nav-wapper .vertical-wapper,
.header-nav-wapper .header-nav {
    display: table-cell;
    vertical-align: middle;
}

.header-nav-wapper .vertical-wapper {
    width: 270px;
    position: relative;
}

.vertical-wapper .block-title-href {
    font-size: 14px;
    font-weight: 700;
    text-transform: uppercase;
    color: #ffffff;
    height: 60px;
    line-height: 28px;
    cursor: pointer;
    display: block;
    padding: 12px 30px 17px;
    letter-spacing: 0.05em;
}

.vertical-wapper .block-title-href::after {
    content: '';
    position: absolute;
    left: -8px;
    top: -10px;
    border-style: solid;
    border-width: 10px 8px 0 0;
    border-color: transparent #333 transparent transparent;
}

.vertical-wapper .block-title-href::before {
    position: absolute;
    top: -10px;
    left: 0;
    right: 0;
    content: '';
    background-color: #5d9d23;
    height: 10px;
}

.vertical-wapper .block-title-href .text {
    display: inline-block;
    vertical-align: top;
}

.verticalmenu-content {
    background-color: #fff;
    padding: 20px 0;
    position: absolute;
    top: 100%;
    z-index: 9999999;
    left: 0;
    width: 100%;
    opacity: 0;
    visibility: hidden;
    -webkit-transform: translateY(50px);
    -moz-transform: translateY(50px);
    -ms-transform: translateY(50px);
    -o-transform: translateY(50px);
    transform: translateY(50px);
    transition: all 0.3s;
    -webkit-box-shadow: 0 3px 18px 0 rgba(0, 0, 0, 0.1);
    -moz-box-shadow: 0 3px 18px 0 rgba(0, 0, 0, 0.1);
    box-shadow: 0 3px 18px 0 rgba(0, 0, 0, 0.1);
}

.verticalmenu-content.show-up {
    opacity: 1;
    -webkit-transform: translateY(0px);
    -moz-transform: translateY(0px);
    -ms-transform: translateY(0px);
    -o-transform: translateY(0px);
    transform: translateY(0px);
    visibility: visible;
}

.vertical-wapper .icon-bar {
    display: inline-block;
    margin-right: 15px;
    vertical-align: middle;
}

.vertical-wapper .icon-bar span {
    width: 20px;
    display: block;
    background: #fff;
    height: 2px;
    margin-bottom: 5px;
}

.vertical-wapper .icon-bar span:nth-child(2) {
    width: 16px;
}

.header.style7 .main-menu>li>a {
    padding: 30px 25px;
}

.header-nav-wapper .vertical-wapper~.header-nav {
    padding-left: 20px;
}

.vertical-menu {
    padding: 0;
    list-style: none;
}

.vertical-menu .menu-item {
    list-style: none;
    position: relative;
}

.vertical-menu .menu-item a {
    line-height: 41px;
    font-size: 15px;
    color: #555555;
    text-transform: capitalize;
    position: relative;
    display: block;
    border-bottom: 1px solid #e6e6e6;
    margin: 0 25px;
}

.vertical-menu .menu-item a:hover {
    color: #5d9d23;
}

.vertical-menu .menu-item:last-child a {
    border: none;
}

.vertical-menu .submenu {
    position: absolute;
    z-index: 100;
    background-color: #fff;
    padding: 0;
    left: 100%;
    top: 0;
    min-width: 100%;
    -webkit-transition: opacity .5s;
    -o-transition: opacity .5s;
    -moz-transition: opacity .5s;
    transition: opacity .5s;
    opacity: 0;
    display: block;
    visibility: hidden;
    list-style: none;
}

.vertical-menu .menu-item-has-children:hover>.submenu {
    opacity: 1;
    visibility: visible;
    -webkit-box-shadow: 0 0 9px 0 rgba(0, 0, 0, 0.2);
    -moz-box-shadow: 0 0 9px 0 rgba(0, 0, 0, 0.2);
    box-shadow: 0 0 9px 0 rgba(0, 0, 0, 0.2);
    -webkit-transform: translate(0, 0);
    -moz-transform: translate(0, 0);
    -o-transform: translate(0, 0);
    -ms-transform: translate(0, 0);
    transform: translate(0, 0)
}

.vertical-menu .menu-item-has-children>a::before {
    content: '\f105';
    font-family: 'FontAwesome';
    position: absolute;
    top: 0;
    right: 0;
    font-size: 15px;
    color: #aaa;
}

.home-slider-7 .slider-item .slider-infor .button {
    color: #000;
}

.slider-item .slider-infor .button:hover {
    color: #000 !important;
    background-color: #fff !important;
    border-color: #fff !important;
}

.slider-item.style19 .slider-inner .slider-infor {
    padding-bottom: 169px;
    padding-top: 136px;
    padding-left: 800px;
    padding-right: 15px;
}

.slider-item.style19 .price {
    margin-bottom: 45px;
}

.slider-item.style20 .slider-inner .slider-infor {
    padding-bottom: 154px;
    padding-top: 136px;
    padding-left: 800px;
    padding-right: 15px;
}

.slider-item.style20 .description {
    font-size: 13px;
    font-weight: 700;
    color: #888888;
    text-transform: uppercase;
    margin-bottom: 25px;
}

.slider-item.style20 .title-big {
    font-weight: 900;
    margin-bottom: 6px;
}

.slider-item.style20 .title-small {
    color: #909090;
}

.slider-item.style21 .slider-inner .slider-infor {
    padding-bottom: 199px;
    padding-top: 179px;
    padding-left: 755px;
    padding-right: 38px;
    text-align: center;
}

.tabs-sidebar-wrapp .product-deal-slider {
    border-width: 2px;
    padding: 29px 15px 40px;
}

.tabs-sidebar-wrapp .product-deal-slider .title {
    border: none;
}

.tabs-sidebar-wrapp .product-deal-slider .sub-title {
    margin-bottom: 25px;
}

.tabs-sidebar-wrapp .product-item.style-4 .product-thumb {
    margin-bottom: 25px;
}

.tabs-sidebar-wrapp .emeriss-tabs .tab-head {
    margin-bottom: 40px;
}

.tabs-sidebar-wrapp .emeriss-tabs.default {
    margin-top: 25px;
}

.emeriss-iconbox-wrapp.layout2 .emeriss-iconbox.default {
    margin-top: 30px;
    padding-top: 34px;
    padding-bottom: 34px;
    background-color: #070707;
    border: none;
}

.product-item.style-3 .product-inner {
    overflow: hidden;
}

.product-item.style-3 .product-top {
    display: none;
}

.product-item.style-3 .product-thumb {
    float: left;
    margin-right: 20px;
    max-width: 140px;
    margin-bottom: 0;
}

.product-item.style-3 .product-info {
    overflow: hidden;
    text-align: left;
    opacity: 1;
}

.product-item.style-3 .group-buttons .button {
    display: inline-block;
    vertical-align: middle;
    padding: 5px 15px;
    min-width: 103px;
    background-color: #000;
}

.product-item.style-3 .group-buttons .button:hover {
    background-color: #5d9d23;
}

.product-item.style-3 .product-name a {
    overflow: hidden;
    display: block;
    text-overflow: ellipsis;
    white-space: nowrap;
    margin-top: 15px;
}

.product-item.style-3 .price {
    margin-bottom: 20px;
}

.product-item.style-3 .quantity {
    margin-bottom: 0;
    display: none;
}

.emeriss-blog-item .blog-meta .post-date {
    margin: 0;
    padding: 0;
}

.emeriss-blog-item .post-thumb .category-blog {
    margin: 0 70px 0 0;
    position: absolute;
    top: 20px;
    left: 20px;
    display: none;
}

.category-blog .list-category {
    margin: 0;
    padding: 0;
}

.list-category .category-item {
    list-style: none;
    display: inline-block;
    padding: 0 10px;
    background: #5d9d23;
    min-width: 77px;
    height: 26px;
    line-height: 26px;
    text-align: center;
    border-radius: 26px;
}

.list-category .category-item a {
    color: #ffffff;
}

a.category-a-text::before {
    padding: 0 8px;
    content: "\f101";
    font-family: 'FontAwesome';
    font-weight: 400;
}

.header.style8 .main-header {
    padding: 10px 0;
}

.header.style8 .logo {
    line-height: 74px;
}

.header.style8 .header-control {
    padding-top: 16px;
    padding-bottom: 15px;
}

.home-slider-8 .slider-item .slider-infor .button:hover {
    color: #ffffff;
}

.slider-item.style16 .slider-inner .slider-infor,
.slider-item.style17 .slider-inner .slider-infor,
.slider-item.style18 .slider-inner .slider-infor {
    padding-bottom: 60px;
    padding-top: 305px;
    padding-left: 40px;
    padding-right: 15px;
}

.emeriss-product.layout1 {
    background-color: #151515;
    padding: 70px 0 35px;
}

.emeriss-product.layout1 .container-wapper {
    position: relative;
}

.emeriss-product.layout1 .head {
    width: 270px;
    margin-right: 30px;
    text-align: center;
    float: left;
    padding-top: 100px;
}

.emeriss-product.layout1 .head .title {
    font-size: 26px;
    font-weight: 700;
    margin-bottom: 20px;
    position: relative;
    color: #fff;
    font-family: 'Oswald', serif;
}

.emeriss-product.layout1 .head .title::before {
    position: absolute;
    content: '';
    width: 40px;
    top: auto;
    bottom: -10px;
    right: 50%;
    -webkit-transform: translateX(50%);
    -moz-transform: translateX(50%);
    -ms-transform: translateX(50%);
    -o-transform: translateX(50%);
    transform: translateX(50%);
    border-bottom: 2px solid #5d9d23;
}

.emeriss-product.layout1 .head .subtitle {
    font-size: 15px;
    line-height: 28px;
}

.emeriss-product.layout1 .product-list-owl {
    width: calc(100% - 300px);
    display: inline-block;
}

.slick-slider.nav-center-left {
    position: static;
}

.slick-slider.nav-center-left .slick-arrow {
    display: block;
    left: 145px;
    width: 51px;
    height: 51px;
    text-align: center;
    line-height: 47px;
    top: 52%;
    color: #fff;
    border-radius: 50%;
}

.slick-slider.nav-center-left .slick-arrow:first-child {
    left: 70px;
}

.slick-slider.nav-center-left .slick-arrow:hover {
    color: #eeeeee;
}

.emeriss-testimonials.default {
    margin-bottom: 30px;
    background-image: url("../img/demo/test-bg.jpg");
    background-position: center;
    background-repeat: no-repeat;
    background-size: cover;
    border-radius: 0;
}

.emeriss-testimonials.default .testimonial-item {
    overflow: hidden;
    padding: 67px 60px 66px 60px;
}

.testimonial-item .image {
    display: inline-block;
    width: 167px;
    height: 167px;
    float: left;
    border-radius: 50%;
    overflow: hidden;
}

.testimonial-item .info {
    display: block;
    overflow: hidden;
    padding: 10px 10px 10px 50px;
    position: relative;
}

.testimonial-item .info .text {
    font-size: 16px;
    line-height: 26px;
    margin-bottom: 20px;
    font-style: italic;
}

.testimonial-item .info .name {
    font-size: 16px;
    margin-bottom: 0;
    text-transform: capitalize;
    color: #fff;
}

.testimonial-item .info .name span {
    display: block;
    font-size: 13px;
    color: #5d9d23;
}

.emeriss-testimonials.default .owl-slick .slick-list {
    margin: 0 !important;
    padding: 0 !important;
}

.emeriss-testimonials.default .slick-dots {
    position: absolute;
    bottom: 18px;
    left: 50%;
    transform: translateX(-50%);
}

.instagram-wrapp {
    border-top: 2px solid #eee;
    text-align: center;
}

.instagram-wrapp .custommenu-title-blog {
    margin-top: 60px;
    position: relative;
}

.instagram-wrapp .custommenu-title-blog i {
    display: block;
    font-size: 60px;
    color: #5d9d23;
    font-weight: normal;
}

.emeriss-instagram {
    overflow: hidden;
}

.emeriss-instagram .instagram {
    padding: 0;
    margin: 0;
}

.instagram .item-instagram {
    position: relative;
    padding: 0;
}

.instagram .item-instagram img {
    width: 100%;
}

.instagram .item-instagram .text {
    position: absolute;
    top: 50%;
    transform: translateY(-50%);
    left: 0;
    right: 0;
    text-align: center;
    z-index: 5;
    font-size: 16px;
    color: #ffffff;
    font-weight: normal;
    opacity: 0;
    visibility: hidden;
}

.instagram .item-instagram:hover .text {
    opacity: 1;
    visibility: visible;
}

.instagram .item-instagram::after {
    position: absolute;
    top: 0px;
    content: '';
    left: 0px;
    right: 0px;
    bottom: 0px;
    background-color: rgba(0, 0, 0, 0.6);
    opacity: 0;
    visibility: hidden;
    -webkit-transform: scale(0.3);
    -moz-transform: scale(0.3);
    -ms-transform: scale(0.3);
    -o-transform: scale(0.3);
    transform: scale(0.3);
    -webkit-transition: all 0.4s ease 0s;
    -moz-transition: all 0.4s ease 0s;
    -o-transition: all 0.4s ease 0s;
    transition: all 0.4s ease 0s;
}

.instagram .item-instagram:hover::after,
.instagram .item-instagram.active::after {
    opacity: 1;
    visibility: visible;
    -webkit-transform: scale(1);
    -moz-transform: scale(1);
    -ms-transform: scale(1);
    -o-transform: scale(1);
    transform: scale(1);
}

.instagram .item-instagram .text .icon {
    font-size: 36px;
    color: #f7f7f7;
    display: block;
    margin-bottom: 8px;
}

.instagram .item-instagram .text a {
    text-decoration: underline;
}

.emeriss-button.button {
    background-color: #111;
    border: 1px solid #111111;
    margin-top: 40px;
}

.brand-slider-wrapp.layout1 {
    background-color: #030303;
}

.header.style10 .block-minicart .shopcart-icon,
.header.style9 .block-minicart .shopcart-icon,
.header.style8 .block-minicart .shopcart-icon,
.header.style7 .block-minicart .shopcart-icon {
    font-size: 0;
    border: none;
    border-radius: 0;
    width: auto;
}


.header.style10 .block-minicart .shopcart-icon .count,
.header.style9 .block-minicart .shopcart-icon .count,
.header.style8 .block-minicart .shopcart-icon .count,
.header.style7 .block-minicart .shopcart-icon .count {
    top: -11px;
    right: 0;
    font-size: 12px;
}

.header.style10 .header-control .block-header,
.header.style9 .header-control .block-header,
.header.style8 .header-control .block-header,
.header.style7 .header-control .block-header {
    padding-left: 15px;
}

.slider-item.style10 .slider-inner .slider-infor,
.slider-item.style11 .slider-inner .slider-infor,
.slider-item.style12 .slider-inner .slider-infor {
    padding-bottom: 130px;
    padding-top: 133px;
    padding-left: 494px;
    padding-right: 70px;
}

.slider-item.style10 .title-big,
.slider-item.style11 .title-big,
.slider-item.style12 .title-big {
    letter-spacing: -0.05em;
    font-size: 32px;
    margin-bottom: 16px;
}

.slider-item.style10 .title-small,
.slider-item.style11 .title-small,
.slider-item.style12 .title-small {
    margin-bottom: 6px;
}

.slider-product.style6 .slick-slider>.slick-arrow {
    width: 51px;
    height: 51px;
    text-align: center;
    line-height: 48px;
    border: 1px solid #eeeeee;
    color: #aaaaaa;
    right: -20px;
    z-index: 33;
    background: #ffffff;
    opacity: 0;
    visibility: hidden;
}

.slider-product.style6:hover .slick-slider>.slick-arrow {
    opacity: 1;
    visibility: visible;
}

.slider-product.style6 .slick-slider>.slick-arrow:first-child {
    left: -20px;
}

.home-slider-10 .slider-item .slider-infor .button.bgroud-style-2,
.home-slider-10 .slider-item .slider-infor .button:hover {
    color: #ffffff
}

.slider-product.style6 .product-thumb .slick-slider>.slick-arrow:first-child {
    left: 0;
}

.product-item.style-6 .product-inner {
    border-width: 4px;
    padding: 15px;
}

.product-item.style-6 .product-info {
    opacity: 1;
}

.product-item.style-6 .loop-form-add-to-cart {
    opacity: 1;
    visibility: visible;
    position: static;
    padding: 0;
    margin-top: 15px;
}

.product-item.style-6.product-type-variable .product-inner {
    padding-bottom: 0;
}

.product-item.style-6 .product-thumb .variations {
    position: static;
    opacity: 1;
    visibility: visible;
    margin-top: 1px;
}

.product-item.style-6 .loop-form-add-to-cart .button {
    width: 100%;
    background-color: #75905e;
    border-color: #75905e;
    color: #ffffff;
}

.product-item.style-6 .loop-form-add-to-cart .button:hover {
    opacity: 0.8;
}

.product-item.style-6 .product-top {
    position: absolute;
    left: 15px;
    right: 15px;
    z-index: 999;
}

.product-item.style-6:hover .product-inner {
    box-shadow: none;
}

.product-item.style-4 .product-inner {
    padding: 0;
    border: 0;
}

.product-item.style-4:hover .product-inner {
    box-shadow: none;
}

.product-item.style-4 .product-info {
    opacity: 1;
}

.product-deal-slider {
    border: 4px solid #eeeeee;
    padding: 19px 15px 25px;
}

.product-deal-slider .title {
    font-size: 26px;
    color: #222222;
    text-align: center;
    font-weight: 700;
    padding-bottom: 2px;
    border-bottom: 3px solid #75905e;
    margin: 0 25px 3px;
}

.product-deal-slider .sub-title {
    color: #888888;
    text-align: center;
    margin-bottom: 15px;
    font-size: 15px;
}

.product-item.style-4 .product-thumb {
    margin-bottom: 10px;
}

.product-item.style-4 .group-info {
    overflow: hidden;
    display: inline-block;
    margin-bottom: 5px
}

.product-item.style-4 .price {
    display: inline-block;
    font-size: 24px;
    font-weight: 700;
    margin-right: 10px;
}

.product-item.style-4 .stars-rating {
    display: inline-block;
}

.product-item.style-4 .group-buttons .button,
.product-item.style-4 .group-buttons .added_to_cart {
    width: 100%;
    margin-top: 20px;
    font-size: 14px;
    color: #ffffff;
}

.product-item.style-4 .group-buttons .button:hover,
.product-item.style-4 .group-buttons .added_to_cart:hover {
    opacity: 0.8;
}

.product-item.style-4 {
    margin-bottom: 0;
}

.weekly-featured-wrapp .custommenu-title-blog {
    margin-top: -9px;
}

.emeriss-product .product-list-owl.nav-botton-center {
    padding-bottom: 51px
}

.slider-product .slick-slider.nav-botton-center>.slick-arrow {
    right: 43.5%;
    bottom: 0px;
    opacity: 1;
    visibility: visible;
    font-size: 30px;
}

.slider-product .slick-slider.nav-botton-center>.slick-arrow:hover {
    color: #222222;
}

.slider-product .slick-slider.nav-botton-center>.slick-arrow:first-child {
    left: 43.5%;
}

.sevice-item {
    position: relative;
}

.sevice-item .quick-install {
    background: rgba(0, 0, 0, 0.3) url(../img/demo/play.png) no-repeat scroll 24px 20px;
    border-radius: 50%;
    cursor: pointer;
    display: inline-block;
    height: 64px;
    left: 50%;
    line-height: 64px;
    border: 1px solid rgba(255, 255, 255, 0.3);
    position: absolute;
    text-align: center;
    top: 50%;
    width: 64px;
    -webkit-transform: translateX(-50%) translateY(-50%);
    -ms-transform: translateX(-50%) translateY(-50%);
    -o-transform: translateX(-50%) translateY(-50%);
    transform: translateX(-50%) translateY(-50%);
    -webkit-transition: all .6s ease-in-out;
    -moz-transition: all .6s ease-in-out;
    -ms-transition: all .6s ease-in-out;
    -o-transition: all .6s ease-in-out;
    transition: all .6s ease-in-out;
}

.sevice-item .quick-install:hover {
    -webkit-transform: translateX(-50%) translateY(-50%) scale(0.9);
    -ms-transform: translateX(-50%) translateY(-50%) scale(0.9);
    -o-transform: translateX(-50%) translateY(-50%) scale(0.9);
    transform: translateX(-50%) translateY(-50%) scale(0.9);
}

.loadmore-wapper {
    text-align: center;
    margin-top: 10px;
    margin-bottom: 50px;
}

.loadmore-wapper a {
    display: inline-block;
    min-width: 161px;
    height: 42px;
    padding: 8px 10px;
    border: 1px solid #eeeeee;
    color: #222222;
    font-weight: 700;
    text-align: center;
    font-size: 14px;
    text-transform: uppercase;
}

.brand-slider-wrapp .owl-slick .slick-arrow {
    width: 51px;
    height: 51px;
    line-height: 45px;
    font-size: 30px;
    position: absolute;
    top: 50%;
    transform: translateY(-50%);
    border: 1px solid #F1F1F1;
    z-index: 9;
    background-color: #fff;
    text-align: center;
    opacity: 0;
    visibility: hidden;
}

@media (min-width: 1280px) {
    .brand-slider-wrapp .owl-slick .slick-arrow:first-child {
        left: -41px;
    }

    .brand-slider-wrapp .owl-slick .slick-arrow {
        right: -41px;
    }
}

.brand-item img {
    border: 1px solid transparent;
    margin: 0 auto;
}

.brand-slider-wrapp:hover .owl-slick .slick-arrow {
    opacity: 1;
    visibility: visible;
}

.header.style9 .logo {
    text-align: left;
}

.header.style9 .bar-open-menu {
    padding: 12px 10px;
    border: 1px solid #e9e9e9;
    margin: 0 auto;
    display: block;
    width: 44px;
}

.bar-open-menu span {
    width: 20px;
    display: block;
    background: #fff;
    height: 2px;
    margin-bottom: 5px;
}

.header.style9 .bar-open-menu span {
    background: #555555;
}

.bar-open-menu span:last-child {
    margin-bottom: 0;
}

.bar-open-menu span:nth-child(2) {
    width: 17px;
}

.header.style9 .main-header {
    position: relative;
}

.header.style9 .header-nav {
    position: absolute;
    top: 100%;
    background: #fff;
    z-index: 99;
    width: 100%;
    border-top: 1px solid #f1f1f1;
    opacity: 0;
    visibility: hidden;
    -webkit-transition: .35s;
    -o-transition: .35s;
    transition: .35s;
    -webkit-transform: translateY(-20px);
    -moz-transform: translateY(-20px);
    -ms-transform: translateY(-20px);
    -o-transform: translateY(-20px);
    transform: translateY(-20px);
}

.header.style9 .header-nav.show-menu {
    -webkit-transform: translateY(0px);
    -moz-transform: translateY(0px);
    -ms-transform: translateY(0px);
    -o-transform: translateY(0px);
    transform: translateY(0px);
    opacity: 1;
    visibility: visible;
    z-index: 100;
}

.header.style9 .bar-open-menu.active:before {
    display: inline-block;
    position: absolute;
    content: url(../img/demo/hover-menu.png);
    width: 100%;
    top: 0;
    border: 0;
    text-align: center;
    left: 0;
    line-height: 44px;
}

.header.style9 .bar-open-menu.active span {
    width: 0;
}

.slider-item.style13 .slider-inner .slider-infor {
    padding-bottom: 165px;
    padding-top: 188px;
    padding-left: 700px;
    padding-right: 70px;
}

.slider-item.style13 .price,
.slider-item.style14 .price {
    font-size: 13px;
    text-transform: uppercase;
    font-weight: 700;
    margin-bottom: 45px;
}

.slider-item.style13 .price .number-price,
.slider-item.style14 .price .number-price {
    font-weight: 400
}

.slider-item.style14 .slider-inner .slider-infor {
    padding-bottom: 165px;
    padding-top: 145px;
    padding-left: 700px;
    padding-right: 70px;
}

.slider-item.style14 .title-big {
    font-weight: 900;
}

.slider-item.style15 .slider-inner .slider-infor {
    padding-bottom: 167px;
    padding-top: 158px;
    padding-left: 700px;
    padding-right: 170px
}

.slider-item.style15 .title-big {
    font-size: 48px;
    line-height: 48px;
    letter-spacing: -0.05em;
    margin-bottom: 6px;
}

.home-slider-9 .slider-item .slider-infor .button.bgroud-style-2,
.home-slider-9 .slider-item .slider-infor .button:hover {
    color: #ffffff;
}

.product-item.style-5 {
    margin-bottom: 0;
}

.product-item.style-5 .product-thumb {
    margin-bottom: 10px;
}

.product-item .thumb-inner {
    position: relative;
}

.product-item.style-5 .thumb-inner {
    margin-bottom: 20px;
}

.product-item.style-5 .product-thumb img {
    margin: 0 auto;
}

.group-pinap {
    display: none;
}

.group-pinap .pinmap-buttom {
    position: absolute;
    width: 30px;
    height: 30px;
    border-radius: 100%;
    text-align: center;
    line-height: 30px;
}

.group-pinap .pinmap-buttom .icon {
    font-size: 15px;
    color: #ffffff;
}

.slider-item.style13 .pinmap-buttom.btn-pinmap-1 {
    top: 230px;
    left: 475px;
}

.slider-item.style13 .pinmap-buttom.btn-pinmap-2 {
    top: 365px;
    left: 330px;
}

.slider-item.style14 .pinmap-buttom.btn-pinmap-1 {
    top: 270px;
    left: 500px;
}

.slider-item.style14 .pinmap-buttom.btn-pinmap-2 {
    top: 400px;
    left: 515px;
}

.slider-item.style15 .pinmap-buttom.btn-pinmap-1 {
    top: 290px;
    left: 340px;
}

.popup-pinmap {
    position: absolute;
    top: 50%;
    -webkit-transform: translateY(-50%);
    -ms-transform: translateY(-50%);
    -o-transform: translateY(-50%);
    transform: translateY(-50%);
    opacity: 0;
    visibility: hidden;
}

.popup-pinmap.left {
    right: calc(100% + 20px)
}

.popup-pinmap.right {
    left: calc(100% + 20px);
}

.pinmap-popup-main {
    min-width: 279px;
    background: #ffffff;
    text-align: center;
    padding: 20px;
}

.pinmap-popup-main .product-thumbnail {
    margin-bottom: 15px;
}

.pinmap-popup-main .product-thumbnail img {
    margin: 0 auto;
}

.pinmap-popup-main .product-name-pinmap {
    font-size: 16px;
    color: #333333;
    font-weight: 700;
    margin-bottom: 0;
}

.pinmap-popup-main .pinmap-price {
    font-size: 16px;
    color: #111111;
    text-decoration: none;
    font-weight: 700;
}

.pinmap-price del {
    font-weight: 300;
    color: #888888;
    margin-right: 10px;
}

.pinmap-price ins {
    text-decoration: none;
}

.popup-pinmap::before {
    content: '';
    position: absolute;
    border: 8px solid transparent;
    opacity: 0;
    visibility: hidden;
}

.popup-pinmap.left:before {
    border-left: 8px solid #fff;
    right: -16px;
}

.popup-pinmap.right:before {
    border-right: 8px solid #fff;
    left: -16px;
}

.popup-pinmap.left:before,
.popup-pinmap.right:before {
    top: calc(50% - 8px);
}

.pinmap-popup-buttons .button {
    width: 100%;
    border: 1px solid #e9e9e9;
    color: #222222;
    font-size: 14px;
    height: 43px;
    padding-top: 0;
    padding-bottom: 0;
    line-height: 39px;
    background: transparent;
}

.group-pinap .pinmap-buttom:hover .popup-pinmap,
.group-pinap .pinmap-buttom:hover .popup-pinmap::before {
    opacity: 1;
    visibility: visible;
}

.popup-pinmap::after {
    content: '';
    position: absolute;
    width: 20px;
    height: 100%;
    display: inline-block;
    top: 0;
}

.popup-pinmap.left::after {
    right: -20px;
}

.popup-pinmap.right::after {
    left: -20px;
}

.banner-shop {
    margin-bottom: 30px;
}

.item-banner .inner {
    background-position: center;
    background-repeat: no-repeat;
    background-size: cover;
    border-radius: 0;
    position: relative;
}

.full-width .item-banner.style1 .inner {
    background-image: url(../img/demo/banner-01_full_width.jpg);
}

.item-banner.style1 .banner-content {
    padding-left: 150px;
    padding-right: 30px;
    ;
    padding-top: 65px;
    padding-bottom: 70px;
}

.item-banner .emeriss-subtitle {
    color: #5d9d23;
    font-size: 14px;
    font-weight: 700;
    padding: 0 0 5px;
    margin-bottom: 0;
    text-transform: uppercase;
}

.item-banner.style1 .emeriss-subtitle {
    margin-bottom: 9px;
}

.item-banner .title {
    font-weight: 700;
    line-height: 1;
    color: #fff;
    text-transform: capitalize;
    font-family: "Segoe UI", "Fira Sans", "Droid Sans", "Helvetica Neue", "Source Sans Pro", sans-serif;
}

.item-banner.style1 .inner .title {
    font-size: 40px;
    margin-bottom: 8px;
}

.item-banner .when-code {
    font-size: 13px;
    text-transform: uppercase;
    color: #888888;
    margin-bottom: 22px;
    display: block;
    font-weight: 700;
}

.item-banner .when-code .code {
    font-size: 18px;
    color: #5d9d23;
    position: relative;
}

.item-banner .banner-content>.button {
    border: 1px solid #5d9d23;
    color: #fff;
    background-color: #5d9d23;
    padding-right: 20px;
    padding-left: 20px;
    padding-top: 7px;
    padding-bottom: 7px;
    margin-right: 5px;
}

.item-banner .banner-content>.button:last-child {
    margin-right: 0;
}

.item-banner.style6 .inner {
    background-image: url(../img/banner/service.banner.grey.jpg);
    border-radius: 0;
}

.item-banner.style6 .banner-content {
    padding-left: 0;
    padding-bottom: 180px;
    padding-right: 0;
    padding-top: 180px;
}

.item-banner.style6 .title {
    font-size: 44px;
    margin-bottom: 20px;
    line-height: normal;
}

.item-banner.style7 .inner {
    background-image: url(../img/demo/banner-home-5.jpg);
}

.item-banner.style7 .banner-content {
    padding-top: 58px;
    padding-right: 165px;
    padding-bottom: 60px;
    padding-left: 30px;
    margin-bottom: 20px;
}

.item-banner.style7 .title,
.item-banner.style8 .title {
    font-size: 26px;
    line-height: 32px;
}

.item-banner.style7 .description {
    margin-bottom: 15px;
}

.item-banner.style8 .inner {
    background-image: url(../img/demo/banner-home-6.jpg);
}

.item-banner.style8 .banner-content {
    padding-top: 60px;
    padding-right: 166px;
    padding-bottom: 70px;
    padding-left: 30px;
    margin-bottom: 20px;
}

.item-banner.style8 .description {
    margin-bottom: 13px;
}

.item-banner .price {
    font-size: 23px;
    font-weight: 700;
    line-height: 28px;
    color: #5d9d23;
    position: relative;
}

iframe {
    max-width: 100%;
}

.videoWrapper {
    position: relative;
    padding-bottom: 66.666667%;
    overflow: hidden;
    max-width: 100%;
    height: auto;
}

.videoWrapper iframe,
.videoWrapper object,
.videoWrapper embed {
    position: absolute;
    top: 0;
    left: 0;
    width: 100%;
    height: 100%;
    background: #222222;
    border: none;
}

.videoWrapper .player .vp-player-layout {
    top: 0 !important;
}

.item-banner.style9 .inner {
    background-image: url(../img/demo/banner-home-7.jpg);
}

.item-banner.style9.type1 .inner {
    background-image: url(../img/demo/banner-home-71.jpg);
}

.item-banner.style9 .banner-content {
    padding-top: 74px;
    padding-right: 300px;
    padding-bottom: 77px;
    padding-left: 40px;
    margin-bottom: 30px;
}

.item-banner.style9 .title {
    font-size: 32px;
    line-height: 1.1;
    margin-bottom: 15px;
}

.item-banner.style9 .emeriss-subtitle {
    font-style: normal;
}

.item-banner.style9 .code {
    font-size: 13px;
    color: #fff;
    font-weight: 500;
    text-transform: uppercase;
    margin-bottom: 26px;
}

.item-banner.style9 .code .nummer-code {
    font-size: 18px;
    color: #5d9d23;
    font-weight: 700;
    position: relative;
}

.item-banner.style22 .banner-content {
    padding-top: 88px;
    padding-right: 15px;
    padding-bottom: 99px;
    padding-left: 39px;
    margin-bottom: 30px;
}

.item-banner.style22 .title {
    font-size: 30px;
    line-height: 32px;
    color: #ffffff;
    font-weight: 700;
    font-family: "Oswald"
}

.item-banner.style23 .banner-content {
    padding-top: 110px;
    padding-right: 15px;
    padding-bottom: 109px;
    padding-left: 41px;
    margin-bottom: 30px;
}

.item-banner.style23 .title {
    font-size: 30px;
    line-height: 32px;
    color: #ffffff;
    font-weight: 700;
    font-family: "Oswald"
}

.item-banner.style24 .banner-content {
    padding-top: 324px;
    padding-right: 15px;
    padding-bottom: 39px;
    padding-left: 25px;
    margin-bottom: 30px;
}

.item-banner.style24 .title {
    font-weight: 700;
    font-family: 'Oswald';
    font-size: 30px;
    line-height: 32px;
    margin-bottom: 25px;
}

.item-banner.style25 .banner-content {
    padding-top: 190px;
    padding-right: 15px;
    padding-bottom: 110px;
    padding-left: 27px;
    margin-bottom: 30px;
}

.item-banner.style25 .title {
    font-size: 48px;
    font-weight: 900;
    line-height: 48px;
    text-transform: uppercase;
    margin-bottom: 5px;
}

.item-banner.style25 .code {
    font-size: 13px;
    font-weight: 700;
    color: #888888;
    text-transform: uppercase;
    display: block;
    margin-bottom: 25px;
}

.item-banner.style25 .code span {
    font-size: 18px;
    color: #ffffff;
}

.item-banner.style25 .code span {
    border-bottom: 1px solid;
}

.item-banner.style26 .banner-content {
    padding-top: 72px;
    padding-right: 15px;
    padding-bottom: 53px;
    padding-left: 15px;
    margin-bottom: 30px;
    text-align: center;
}

.item-banner.style26 .title {
    font-size: 24px;
    font-family: 'Oswald';
    border-bottom: 1px solid;
    margin-bottom: 15px;
    display: inline-block;
}

.item-banner .icon {
    font-size: 48px;
    color: #f7f7f7;
    margin-bottom: 6px;
    display: block;
}

.item-banner .sub-title {
    font-size: 15px;
    color: #888888;
    font-weight: 700;
    line-height: 30px;
}

.item-banner.style27 .banner-content {
    padding-top: 43px;
    padding-right: 15px;
    padding-bottom: 59px;
    padding-left: 30px;
    margin-bottom: 30px;
}

.item-banner.style27 .title {
    font-size: 48px;
    font-weight: 900;
    text-transform: uppercase;
    margin-bottom: 2px;
}

.item-banner.style27 .description {
    font-size: 13px;
    font-weight: 700;
    text-transform: uppercase;
    color: #888888;
    margin-bottom: 0;
}

.item-banner.style27 .emeriss-subtitle {
    margin-bottom: 0;
}

.item-banner.style18 .banner-content {
    padding-top: 53px;
    padding-right: 15px;
    padding-bottom: 60px;
    padding-left: 50px;
}

.item-banner.style18 .title {
    font-size: 30px;
    line-height: 32px;
    font-weight: 700;
    margin-bottom: 13px;
    font-family: 'Oswald'
}

.item-banner.style18 .description {
    margin-bottom: 20px;
}

.item-banner.style19 .banner-content {
    padding-top: 86px;
    padding-right: 15px;
    padding-bottom: 90px;
    padding-left: 15px;
    text-align: center;
    margin-bottom: 20px;
}

.item-banner.style19 .icon {
    color: #f7f7f7;
    font-size: 48px;
    margin-bottom: 15px;
    display: block;
}

.item-banner.style19 .title {
    font-size: 24px;
    border-bottom: 1px solid;
    display: inline-block;
    margin-bottom: 5px;
    font-family: 'Oswald';
    letter-spacing: 0;
}

.item-banner.style19 .sub-title {
    font-size: 15px;
    line-height: 30px;
    font-weight: 700;
    color: #ffffff;
}

.item-banner.style20 .banner-content {
    padding-top: 69px;
    padding-right: 15px;
    padding-bottom: 56px;
    padding-left: 30px;
    margin-bottom: 20px;
}

.item-banner.style20 .title {
    font-size: 38px;
    line-height: 40px;
    text-transform: uppercase;
    margin-bottom: 5px;
}

.item-banner.style20 .code {
    font-size: 13px;
    color: #cccccc;
    text-transform: uppercase;
    font-weight: 700;
    margin-bottom: 23px;
}

.item-banner.style20 .code .nummer-code {
    font-size: 18px;
    color: #ffffff;
    border-bottom: 1px solid
}

.banner-pinmap-wrapp .item-banner .inner {
    position: relative;
}

.item-banner.style21 .inner {
    background-image: url(../img/demo/banner-home-19.jpg);
    border-radius: 0;
}

.item-banner.style21 .banner-content {
    padding-top: 180px;
    padding-right: 15px;
    padding-bottom: 180px;
    padding-left: 830px;
}

.item-banner.style21 .title {
    font-size: 46px;
}

.item-banner.style21 .start-from {
    text-transform: capitalize;
    margin-bottom: 23px;
    color: #bdbdbd;
}

.item-banner.style21 .start-from span {
    color: #5d9d23;
    font-weight: 500;
    font-size: 120%;
}

.item-banner.style21 .group-pinap .btn-pinmap-1 {
    top: 92px;
    left: 520px;
}

.item-banner.style21 .group-pinap .btn-pinmap-2 {
    bottom: 20px;
    left: 313px;
}

.popup-pinmap.right.style1 {
    top: -83px;
    -webkit-transform: none;
    -ms-transform: none;
    -o-transform: none;
    transform: none;
}

.popup-pinmap.right.style1:before {
    top: 90px;
}

.popup-pinmap.left.style1 {
    top: auto;
    -webkit-transform: none;
    -ms-transform: none;
    -o-transform: none;
    transform: none;
    bottom: -5px;
}

.popup-pinmap.left.style1:before {
    top: auto;
    bottom: 10px;
}

.pinmap-popup-main.style1 {
    min-width: 231px;
}

.item-banner.style12 .inner {
    background-image: url(../img/demo/banner-home-10.jpg);
}

.item-banner.style12.type2 .inner {
    background-image: url(../img/demo/banner-home-11.jpg);
}

.item-banner.style12 .banner-content {
    padding-top: 53px;
    padding-right: 160px;
    padding-bottom: 57px;
    padding-left: 23px;
    margin-bottom: 30px;
}

.item-banner.style12 .title {
    font-size: 26px;
    line-height: 32px;
    margin-bottom: 5px;
}

.item-banner.style12 .description {
    margin-bottom: 20px;
}

.item-banner.style12 .button {
    padding-top: 5px;
    padding-bottom: 5px;
    height: 39px;
}

.item-banner.style13 .banner-content {
    padding-top: 48px;
    padding-right: 160px;
    padding-bottom: 76px;
    padding-left: 35px;
    margin-bottom: 30px;
    text-align: center;
}

.item-banner.style13 .sub-title {
    font-size: 15px;
    line-height: 30px;
    color: #ffffff;
    font-weight: 700;
}

.item-banner.style13 .icon {
    font-size: 48px;
    color: #f7f7f7;
    margin-bottom: 15px;
    display: block;
}

.item-banner.style13 .title {
    border-bottom: 1px solid;
    display: inline-block;
    margin-bottom: 7px;
    letter-spacing: 0;
}

.item-banner.style14 .inner {
    background-image: url(../img/demo/banner-home-12.jpg);
}

.item-banner.style14 .banner-content {
    padding-top: 45px;
    padding-right: 30px;
    padding-bottom: 45px;
    padding-left: 30px;
    margin-bottom: 30px;
    text-align: center;
}

.item-banner.style14 .title {
    font-size: 37px;
    line-height: 1.2;
    margin-bottom: 21px;
}

.item-banner.style14 .code {
    font-size: 13px;
    font-weight: 700;
    text-transform: uppercase;
    color: #888888;
    margin-bottom: 0;
}

.item-banner.style14 .code .nummer-code {
    font-size: 18px;
    color: #5d9d23;
    position: relative;
}

.item-banner.style15 .inner {
    background-image: url(../img/demo/banner-home-13.jpg);
}

.item-banner.style15 .banner-content {
    padding-right: 30px;
    padding-left: 500px;
    margin-bottom: 30px;
    padding-top: 36px;
    padding-bottom: 42px;
}

.item-banner.style15 .title {
    font-size: 28px;
    font-weight: 700;
    line-height: 32px;
}

.item-banner.style15 .description {
    margin-bottom: 20px;
}

.item-banner.style15 .banner-price {
    font-size: 23px;
    font-weight: 700;
    line-height: 28px;
    color: #ffffff;
    text-decoration: underline;
}

.item-banner.style16 .inner {
    background-image: url(../img/demo/banner-home-14.jpg);
}

.item-banner.style16 .banner-content {
    padding-top: 36px;
    padding-right: 30px;
    padding-bottom: 42px;
    padding-left: 23px;
    margin-bottom: 30px;
}

.item-banner.style16 .title {
    font-size: 28px;
    font-weight: 700;
    line-height: 32px;
}

.item-banner.style16 .description {
    margin-bottom: 20px;
}

.item-banner.style16 .button {
    height: 40px;
    padding-bottom: 5px;
    padding-top: 5px;
}

.item-banner.style17 .inner {
    background-image: url(../img/demo/banner-home-15.jpg);
}

.item-banner.style17 .banner-content {
    padding-top: 57px;
    padding-bottom: 60px;
    padding-left: 15px;
    padding-right: 15px;
    text-align: center;
}

.item-banner.style17 .title {
    font-size: 34px;
    line-height: 32px;
    margin-bottom: 10px;
}

.item-banner.style17 .description {
    margin-bottom: 15px;
}

.item-banner.style17 .banner-price {
    font-size: 16px;
    color: #bdbdbd;
    line-height: 28px;
    letter-spacing: -0.05em;
    margin-bottom: 22px;
}

.item-banner.style17 .number-price {
    font-size: 30px;
    color: #5d9d23;
    font-weight: 700;
    position: relative;
}

.item-banner.style10 .inner {
    background-image: url(../img/demo/banner-home-8.jpg);
}

.item-banner.style10 .banner-content {
    padding-top: 80px;
    padding-right: 200px;
    padding-bottom: 75px;
    padding-left: 50px;
    margin-bottom: 30px;
}

.item-banner.style10 .emeriss-subtitle {
    line-height: 24px;
}

.item-banner.style10 .title {
    font-size: 34px;
    line-height: 48px;
    margin-bottom: 3px;
}

.item-banner.style10 .description {
    margin-bottom: 0;
}

.item-banner.style11 .inner {
    background-image: url(../img/demo/banner-home-9.jpg);
}

.item-banner.style11 .banner-content {
    padding-top: 70px;
    padding-right: 330px;
    padding-bottom: 63px;
    padding-left: 50px;
    margin-bottom: 30px;
}

.item-banner.style11 .title {
    font-size: 26px;
    line-height: 32px;
    margin-bottom: 5px;
    font-weight: 700;
}

.item-banner.style11 .description {
    margin-bottom: 25px;
}

.footer {
    background: #151515;
    margin-top: 35px;
}

.footer .container-wapper {
    padding-top: 40px;
}

.footer .footer-end {
    padding: 10px 0;
}

.footer .widget-box .single-img {
    margin-bottom: 20px;
}

.footer .widget-box .text-content-elememnt {
    font-size: 15px;
}

.footer.default .widget-box .text-content-elememnt {
    padding-right: 100px;
}

.footer .widget-box .text-content-elememnt p {
    margin-bottom: 0;
}

.footer .widgettitle {
    font-size: 15px;
    font-weight: 700;
    margin-bottom: 26px;
    line-height: 24px;
    position: relative;
    margin-top: 10px;
    color: #fff;
    text-transform: uppercase;
}

.footer .menu {
    padding: 0;
    margin: 0;
    list-style: none;
}

.footer .menu .menu-item {
    color: #868686;
    line-height: 26px;
    padding-top: 5px;
    padding-bottom: 5px;
}

.footer .menu .menu-item>span {
    padding-right: 5px;
    color: #5d9d23;
}

.emeriss-newsletter.style1 {
    margin-bottom: 10px;
}

.emeriss-newsletter.style1 .title,
.emeriss-newsletter.style2 .title {
    font-size: 16px;
    font-weight: 700;
    text-transform: uppercase;
    color: #fff;
    margin-bottom: 29px;
    position: relative;
    margin-top: 11px;
}

.emeriss-newsletter.style1 .title,
.emeriss-newsletter.style2 .title,
.footer .widgettitle {
    font-family: 'Oswald', sans-serif;
}

.footer .border-custom span {
    margin-top: 15px;
}

@media (max-width: 1199px) {
    .item-banner.style1 .inner .title {
        font-size: 30px;
    }

    .item-banner.style2 .title {
        font-size: 28px;
    }

    .item-banner .hot-price .price-number {
        font-size: 26px;
    }

    .product-item.style-list .product-name {
        font-size: 18px;
    }

    .emeriss-product.layout1 .head .title {
        font-size: 24px;
    }

    .emeriss-newsletter.default .title {
        font-size: 26px;
    }

    .emeriss-blog-item .blog-title {
        font-size: 18px;
    }

    .emeriss-tabs .tab-link li a {
        font-size: 12px;
    }

    .item-banner.style15 .title,
    .item-banner.style16 .title {
        font-size: 26px;
    }

    .emeriss-tabs.default.rows-space-40 {
        margin-bottom: 35px;
    }

    .item-banner.style17 .title,
    .item-banner.style4 .title,
    .item-banner.style5 .title,
    .item-banner.style7 .title,
    .item-banner.style8 .title,
    .item-banner.style17 .title,
    .item-banner.style4 .title,
    .item-banner.style5 .title,
    .item-banner.style7 .title,
    .item-banner.style8 .title {
        font-size: 24px;
    }

    .emeriss-newsletter.style3 .title {
        font-size: 24px;
    }

    .team-member .border-custom {
        margin-top: 55px;
    }

    .item-banner.style12 .banner-content {
        margin-bottom: 18px;
    }

    .emeriss-newsletter.style3::before,
    .item-banner .inner::before,
    .slider-item .slider-inner::before {
        content: '';
        position: absolute;
        top: 0;
        left: 0;
        right: 0;
        bottom: 0;
        background-color: #fff;
        opacity: 0.5;
        display: none;
    }

    .header-banner.banner-image .banner-wrap .banner-header,
    .emeriss-newsletter>*,
    .item-banner .banner-content {
        position: relative;
    }

    .banner-wrapp.rows-space-65,
    .emeriss-product.produc-featured .rows-space-65 {
        margin-bottom: 55px;
    }

    .home-slider-banner {
        margin-bottom: 33px;
    }

    .item-banner.style9 .banner-content {
        padding-right: 15px;
    }

    .emeriss-newsletter.default .subtitle {
        margin-bottom: 20px;
    }

    .emeriss-iconbox.default {
        padding: 25px 10px;
    }

    .slider-item.style4 .title-big,
    .slider-item.style5 .title-big,
    .slider-item.style6 .title-big {
        font-size: 34px;
    }

    .sevice-box-content .sevice-title,
    .header-banner .title {
        font-size: 28px;
        font-weight: 500;
    }

    .comments-area {
        margin-bottom: 50px;
    }

    .pagination {
        margin-top: 35px;
    }

    .pagination.grid {
        margin-top: 10px;
    }

    .post-item .post-title {
        font-size: 24px;
    }

    .emeriss-product.produc-featured.rows-space-65 {
        margin-bottom: 55px;
    }

    .item-banner.style9 .title {
        font-size: 28px;
    }

    .emeriss-tabs.default.rows-space-30 {
        margin-bottom: 20px;
    }

    .item-banner.style21 .title {
        font-size: 36px;
    }

    .slick-dots {
        margin-top: 30px;
    }

    .emeriss-blog-wraap.default {
        padding-top: 52px;
        padding-bottom: 52px;
    }

    .banner-pinmap-wrapp.rows-space-70 {
        margin-bottom: 55px;
    }

    .home-slider.fullwidth.rows-space-60 {
        margin-bottom: 45px;
    }

    .banner-video-wrapp.rows-space-40,
    .emeriss-product.produc-featured.rows-space-40 {
        margin-bottom: 25px;
    }

    .emeriss-product.layout1 {
        padding: 55px 0 20px;
    }

    .banner-wrapp.rows-space-30 {
        margin-bottom: 25px;
    }

    .slider-item .title-big {
        font-size: 30px;
    }

    .banner-wrapp.rows-space-35 {
        margin-bottom: 20px;
    }

    .banner-wrapp.rows-space-60 {
        margin-bottom: 55px;
    }

    .emeriss-tabs.default.rows-space-40 {
        margin-bottom: 35px;
    }

    .item-banner.style6 .banner-content {
        padding-bottom: 120px;
        padding-top: 120px;
    }

    .item-banner.style6 .title {
        font-size: 36px;
    }

    .product-in-stock-wrapp.rows-space-40 {
        margin-bottom: 20px;
    }

    .product-grid-title,
    .custommenu-title-blog {
        font-size: 26px;
        margin-bottom: 40px;
    }

    .main-content {
        padding-bottom: 45px;
    }

    .banner-wrapp.rows-space-70 {
        margin-bottom: 50px;
    }

    .instagram-wrapp .custommenu-title-blog {
        margin-top: 50px;
    }

    .emeriss-tabs .tab-head {
        margin-bottom: 35px;
    }

    .footer .container-wapper {
        padding-top: 45px;
    }

    .footer .widgettitle {
        margin-bottom: 26px;
    }

    .home-slider.style1 {
        padding-top: 0;
    }

    .form-message {
        padding: 45px;
    }

    .blog-slider.style-1 .blog-item {
        margin: 0;
    }

    .footer .border-custom span {
        margin-top: 20px;
    }

    .slider-product .slick-slider>.slick-arrow:first-child,
    .emeriss-blog .slick-slider>.slick-arrow:first-child {
        left: 0;
    }

    .slider-product .slick-slider>.slick-arrow,
    .emeriss-blog .slick-slider>.slick-arrow {
        right: 0;
    }

    .header.style1 .header-element {
        float: right;
        text-align: right;
    }

    .header.style1 .header-language .emeriss-language {
        margin-left: 25px;
        float: left;
    }

    .header .logo {
        text-align: left;
    }

    .header .header-nav {
        display: none;
    }

    .header .header-block-text,
    .emeriss-menu-panel .header-block-text {
        display: none;
    }

    .header-control {
        text-align: center;
        padding: 20px 0 0;
    }

    .header-language .emeriss-submenu {
        left: auto;
        right: 0
    }

    .block-search .emeriss-submenu {
        left: -100%;
        right: auto;
    }

    .submenu.menu-page {
        padding: 30px 20px;
    }

    .mega-menu .emeriss-custommenu {
        margin-bottom: 30px;
    }

    .footer .box-footer {
        margin-bottom: 20px;
    }

    .emeriss-contact-info .socials {
        padding-top: 15px;
    }

    .product-item.style-list .product-info-left {
        width: auto;
        padding: 0 10px;
    }

    .product-info-left .product-name a {
        color: #5d9d23;
    }

    .product-item.style-list .product-info-right {
        border: 0;
        text-align: left;
        padding: 0 0 0 10px;
        width: auto;
    }

    .full-width .product-item.style-list .product-info-right {
        width: auto;
    }

    .product-item.style-list .product-thumb {
        border: none;
        padding-right: 10px;
    }

    .slider-lookbook.nav-center>.slick-arrow {
        opacity: 0;
        visibility: hidden;
    }

    .slider-lookbook:hover>.slick-arrow {
        opacity: 1;
        visibility: visible;
    }

    .slick-slider.slider-lookbook.nav-center>.slick-arrow {
        right: 0;
    }

    .slick-slider.slider-lookbook.nav-center>.slick-arrow:first-child {
        left: 0;
    }

    .header.style7 .mobile-navigation {
        top: -10px;
    }

    .mobile-navigation {
        display: inline-block;
        vertical-align: top;
        margin-left: 17px;
        border: 2px solid #dedede;
        border-radius: 0;
        padding: 14px 11px 10px;
        position: relative;
    }

    .mobile-navigation span {
        background-color: #333;
        display: block;
        width: 16px;
        margin-bottom: 3px;
        height: 2px;
    }

    .checkout-wrapp .row-col-2 {
        padding-left: 15px;
    }

    .full-width .details-thumd {
        padding-left: 0;
    }

    .product-item.style2 .product-inner {
        display: block;
    }

    .slider-item.style1 .slider-inner .slider-infor,
    .slider-item.style3 .slider-inner .slider-infor,
    .slider-item.style2 .slider-inner .slider-infor {
        padding-left: 200px;
    }

    .item-banner.style3 .banner-content {
        padding-left: 320px;
    }

    .header .main-header {
        padding: 40px 0 37px;
    }

    .header.style7 .header-nav-container,
    .header.style7 .header-nav-wapper {
        display: none;
    }

    .header.style7 .header-control {
        padding-top: 0;
    }

    .slider-item.style19 .slider-inner .slider-infor,
    .slider-item.style20 .slider-inner .slider-infor,
    .slider-item.style21 .slider-inner .slider-infor {
        padding-left: 300px;
    }

    .header.style8 .header-control .block-header .emeriss-submenu {
        left: auto;
    }

    .item-banner.style20 .title {
        font-size: 30px;
    }

    .item-banner.style20 .code .nummer-code {
        font-size: 15px;
    }

    .item-banner.style21 .banner-content {
        padding-left: 500px;
        padding-top: 80px;
        padding-bottom: 80px;
    }

    .item-banner.style21 .group-pinap .btn-pinmap-1 {
        left: 360px;
    }

    .header.style10 .logo {
        text-align: center;
    }

    .header.style10 .header-language .emeriss-language {
        margin-left: 30px;
    }

    .header.style10 .header-control {
        padding: 0;
    }

    .header.style10 .header-control .block-header .emeriss-submenu {
        right: 0;
        left: auto;
    }

    .item-banner.style10 .banner-content {
        padding-right: 40px;
        padding-left: 40px;
    }

    .item-banner.style11 .banner-content {
        padding-right: 160px;
        padding-left: 50px;
    }

    .emeriss-product .product-list-owl.nav-botton-center {
        padding: 0;
    }

    .slider-product .slick-slider.nav-botton-center>.slick-arrow {
        right: 0;
        top: 50%;
        transform: translateY(-50%);
    }

    .slider-product .slick-slider.nav-botton-center>.slick-arrow:first-child {
        left: 0;
    }

    .slider-item.style10 .slider-inner .slider-infor,
    .slider-item.style11 .slider-inner .slider-infor,
    .slider-item.style12 .slider-inner .slider-infor {
        padding-left: 230px;
    }

    .product-item.style-6 .product-thumb {
        margin-bottom: 2px;
    }

    .breadcrumb {
        border-top: 1px solid #e8e8e8;
    }

    .custom_blog_title {
        margin-bottom: 30px;
        font-size: 24px;
    }

    .team-member .custom_blog_title {
        margin-top: 53px;
        margin-bottom: 37px;
    }
}

@media (max-width: 1024px) {
    .main-menu .submenu .submenu {
        left: 60%;
        top: 50%;
    }
}

@media (max-width: 1199px) and (min-width: 768px) {
    .col-lg-4.banner-wrapp .banner {
        width: calc(50% - 10px);
        float: left;
    }

    .col-lg-4.banner-wrapp .banner:last-child {
        float: right;
    }
}

@media (max-width: 991px) {
    .item-banner.style7 .banner-content {
        padding-right: 130px;
    }

    .item-banner.style8 .banner-content {
        padding-right: 136px;
    }

    .header .main-header {
        padding: 30px 0 20px;
    }

    .kt-popup-newsletter .image-newsletter {
        display: none !important;
    }

    .kt-popup-newsletter.style-1 {
        width: 100%;
    }

    .kt-popup-newsletter .popup-content {
        text-align: center;
    }

    .sidebar .wrapper-sidebar {
        margin-top: 40px;
    }

    .customer_login .login-item {
        margin-bottom: 30px;
    }

    .woof_Widget {
        padding: 20px;
    }

    .coppyright,
    .footer-end .emeriss-payment,
    .footer-end .demos {
        text-align: center;
        padding: 5px 0;
    }

    .footer .widget-box .text-content-elememnt {
        padding-right: 0;
    }

    .sevice-item .sevice-thumb {
        text-align: center;
        margin-bottom: 30px;
    }

    .sevice-item .col-sm-6~.col-sm-6>.sevice-thumb {
        margin-bottom: 0;
    }

    .sevice-box-content {
        position: static;
        transform: none;
        padding: 0;
    }

    .sevice-item.style-1.has-item-sevice .sevice-box-content {
        padding-bottom: 40px;
        padding-top: 0;
    }

    .checkout-wrapp .row-col {
        width: 100%;
        float: none;
        margin-bottom: 20px;
        padding: 0;
    }

    .checkout-form {
        padding: 30px 20px 10px;
    }

    .your-order .title-form {
        margin-bottom: 25px;
    }

    .checkout-wrapp .button {
        margin-bottom: 30px;
    }

    .shop-grid-content.full-width .shop-top-control .select-item {
        width: auto;
    }

    .slider-item.style10 .slider-inner .slider-infor,
    .slider-item.style11 .slider-inner .slider-infor,
    .slider-item.style12 .slider-inner .slider-infor {
        padding-left: 200px;
    }

    .product-deal-slider .product-list-owl .thumb-link img {
        margin: 0 auto;
    }

    .product-deal-slider {
        margin-bottom: 30px;
    }

    .emeriss-iconbox.default .iconbox-inner {
        display: block;
        text-align: center;
    }

    .emeriss-iconbox.default .iconbox-inner .icon,
    .emeriss-iconbox.default .content {
        display: block;
        width: 100%;
        padding: 0
    }

    .emeriss-iconbox.default .iconbox-inner .icon {
        padding-bottom: 20px;
    }

    .cart-form .shop_table tbody>tr>td {
        padding: 10px;
    }

    .cart-form .shop_table .product-thumbnail {
        padding-left: 10px;
    }

    .emeriss-newsletter.default .title,
    .product-grid-title,
    .custommenu-title-blog {
        font-size: 24px;
    }
}

@media (max-width: 767px) {
    .product-item.style-list .product-name {
        font-size: 16px;
    }

    .title-form {
        font-size: 16px;
    }

    .item-banner.style15 .title,
    .item-banner.style16 .title {
        font-size: 22px;
    }

    .banner-video-wrapp.rows-space-40 {
        margin-bottom: 15px;
    }

    .emeriss-product.produc-featured.rows-space-40 {
        margin-bottom: 20px;
    }

    .item-banner.style1 .title br {
        display: block;
    }

    .item-banner .title br {
        display: none;
    }

    .emeriss-blog-wraap.default {
        padding-top: 45px;
        padding-bottom: 45px;
    }

    .instagram-wrapp .custommenu-title-blog {
        margin-top: 45px;
    }

    .item-banner.style11 .title {
        font-size: 24px;
    }

    .emeriss-product.produc-featured.rows-space-65 {
        margin-bottom: 45px;
    }

    .slider-item .title-big {
        font-size: 24px;
        font-weight: 500;
    }

    .item-banner .title {
        font-weight: 500;
    }

    .slider-item .price .number-price,
    .item-banner.style17 .number-price {
        font-size: 20px;
        font-weight: 500;
    }

    .item-banner .emeriss-subtitle {
        font-size: 13px;
    }

    .item-banner.style17 .title,
    .item-banner.style4 .title,
    .item-banner.style5 .title,
    .item-banner.style7 .title,
    .item-banner.style8 .title,
    .item-banner.style17 .title,
    .item-banner.style4 .title,
    .item-banner.style5 .title,
    .item-banner.style7 .title,
    .item-banner.style8 .title {
        font-size: 20px;
    }

    .emeriss-tabs .tab-link::before {
        display: none;
    }

    .item-banner.style6 .banner-content {
        padding-bottom: 75px;
        padding-top: 75px;
    }

    .footer .widgettitle {
        margin-bottom: 13px;
    }

    .shop-top-control {
        padding-bottom: 10px;
    }

    .emeriss-newsletter.style1 .title,
    .emeriss-newsletter.style2 .title,
    .footer .widgettitle {
        margin-bottom: 13px;
    }

    .emeriss-newsletter.style3 .title {
        font-size: 20px;
    }

    .emeriss-iconbox .content .title {
        font-size: 14px;
    }

    .emeriss-newsletter.style3 {
        overflow: hidden;
        padding-top: 40px;
        padding-bottom: 30px;
    }

    .footer .emeriss-socials li a {
        height: 40px;
        line-height: 40px;
        min-width: 40px;
        margin-bottom: 7px;
        font-size: 16px;
    }

    .slider-item.style4 .slider-inner .slider-infor,
    .slider-item.style5 .slider-inner .slider-infor,
    .slider-item.style6 .slider-inner .slider-infor,
    .slider-item.style1 .slider-inner .slider-infor,
    .slider-item.style3 .slider-inner .slider-infor,
    .slider-item.style2 .slider-inner .slider-infor,
    .slider-item.style7 .slider-inner .slider-infor,
    .slider-item.style8 .slider-inner .slider-infor,
    .slider-item.style9 .slider-inner .slider-infor,
    .slider-item.style13 .slider-inner .slider-infor,
    .slider-item.style14 .slider-inner .slider-infor,
    .slider-item.style15 .slider-inner .slider-infor,
    .slider-item.style19 .slider-inner .slider-infor,
    .slider-item.style20 .slider-inner .slider-infor,
    .slider-item.style21 .slider-inner .slider-infor,
    .slider-item.style25 .slider-inner .slider-infor,
    .slider-item.style26 .slider-inner .slider-infor,
    .slider-item.style27 .slider-inner .slider-infor {
        padding-top: 70px;
        padding-bottom: 70px;
    }

    .item-banner.style1 .inner .title {
        font-size: 26px;
    }

    .item-banner.style2 .title {
        font-size: 24px;
    }

    .emeriss-newsletter.style1 .newsletter-form-wrap .input-text {
        font-size: 13px;
    }

    input[type="text"],
    input[type="email"],
    input[type="password"],
    input[type="tel"],
    input[type="search"],
    input[type="url"],
    textarea,
    select {
        padding: 7px 10px;
    }

    .button,
    button,
    input[type="submit"] {
        font-size: 12px;
    }

    .item-banner.style10 .title {
        font-size: 28px;
        line-height: 1.2;
    }

    .banner-wrapp.rows-space-65 {
        margin-bottom: 40px;
    }

    .home-slider-banner {
        margin-bottom: 25px;
    }

    .banner-wrapp.rows-space-70 {
        margin-bottom: 43px;
    }

    .details-infor .product-title {
        font-size: 18px;
    }

    .details-infor .price {
        font-size: 24px;
        margin-bottom: 15px;
    }

    .sevice-item.style-1 {
        padding-bottom: 40px;
        margin-bottom: 40px;
    }

    .content-inlookbook .pagination {
        margin-bottom: 40px;
    }

    .wapper-slider-lookbook {
        padding: 40px 0;
    }

    .slider-lookbook-item .lookbook-inner {
        padding: 15px;
    }

    .sevice-box-content .sevice-title,
    .header-banner .title {
        font-size: 22px;
    }

    .pagination {
        margin-top: 30px;
    }

    .comments-area {
        margin-bottom: 30px;
    }

    .comments-area .comment .children {
        padding-left: 30px;
        padding-top: 30px;
    }

    .comment-form .comment-reply-content {
        padding: 0 15px;
    }

    .comment-form {
        padding-top: 0;
        margin-bottom: 30px;
    }

    blockquote,
    q {
        margin-bottom: 25px;
        margin-top: 0;
    }

    .post-item .post-title {
        font-size: 22px;
    }

    .blog-articles>.custom_blog_title,
    .comments-area>.custom_blog_title {
        font-size: 16px;
    }

    .widget .widgettitle {
        font-size: 14px;
        margin-bottom: 20px;
    }

    .widget {
        margin-bottom: 30px;
    }

    .newsletter-widget {
        padding: 20px 15px;
    }

    .form-message .title {
        margin-bottom: 15px;
        font-size: 14px;
    }

    .emeriss-newsletter.style3 {
        overflow: hidden;
        padding-top: 40px;
        padding-bottom: 40px;
    }

    .emeriss-tabs.default.rows-space-30 {
        margin-bottom: 10px;
    }

    .banner-wrapp.rows-space-60,
    .emeriss-product.produc-featured.rows-space-60 {
        margin-bottom: 35px;
    }

    .item-banner.style9 .title {
        font-size: 22px;
    }

    .item-banner.style21 .banner-content {
        padding-top: 60px;
        padding-bottom: 60px;
    }

    .item-banner.style21 .title {
        font-size: 26px;
    }

    .emeriss-product.layout1 .head .title {
        font-size: 22px;
    }

    .emeriss-product.layout1 {
        padding: 40px 0 20px;
    }

    .banner-pinmap-wrapp.rows-space-70 {
        margin-bottom: 40px;
    }

    .home-slider.fullwidth.rows-space-60 {
        margin-bottom: 35px;
    }

    .item-banner.style16 .title,
    .item-banner.style12 .title {
        font-size: 26px;
    }

    .item-banner.style14 .title {
        font-size: 30px;
    }

    .product-in-stock-wrapp.rows-space-40 {
        margin-bottom: 10px;
    }

    .instagram-wrapp .custommenu-title-blog i {
        font-size: 50px;
    }

    .home-slider .slick-slider.nav-center>.slick-arrow {
        display: none !important;
    }

    .emeriss-newsletter.default .title,
    .product-grid-title,
    .custommenu-title-blog {
        font-size: 20px;
    }

    .product-grid-title,
    .custommenu-title-blog {
        margin-bottom: 30px;
    }

    .emeriss-tabs .tab-head {
        margin-bottom: 30px;
    }

    .emeriss-tabs.default.rows-space-40 {
        margin-bottom: 25px;
    }

    .banner-wrapp.rows-space-60 {
        margin-bottom: 47px;
    }

    .logo img {
        max-width: 140px;
    }

    .slick-dots {
        margin-top: 25px;
    }

    .emeriss-tabs .tab-link li {
        padding: 10px 0;
    }

    .emeriss-tabs .tab-link li a {
        margin: 0 15px;
        font-size: 11px;
    }

    .item-banner.style6 .title {
        font-size: 24px;
    }

    .product-grid-title {
        padding-top: 18px;
    }

    .tab-details-product {
        margin-top: 10px;
    }

    .cart-form .shop_table tbody tr.cart_item td.product-remove {
        position: static;
        transform: none;
        padding: 20px 0 10px;
    }

    .cart-form .shop_table,
    .cart-form .shop_table tbody,
    .cart-form .shop_table tr,
    .cart-form .shop_table td {
        display: block !important;
        text-align: center !important;
        width: 100% !important;
    }

    .cart-form .shop_table .product-price {
        padding-bottom: 20px;
    }

    .cart-form .shop_table tbody>tr>td.actions {
        padding: 20px;
    }

    .shop_table .actions>.order-total {
        float: none;
    }

    .cart-form .shop_table .product-quantity .quantity {
        margin: 0 auto;
    }

    .breadcrumb {
        padding: 6px 0 12px;
    }

    .custom_blog_title {
        margin-bottom: 30px;
        font-size: 18px;
    }

    .blog-articles>.main-info-post {
        margin-top: 30px;
        margin-bottom: 30px;
    }

    .error-404 {
        padding: 35px 0 0;
    }

    .footer .footer-end {
        padding: 20px 0;
    }

    .footer .container-wapper {
        padding-top: 40px;
    }

    .footer .border-custom span {
        margin-top: 20px;
    }

    .col-sm-12:last-child .item-banner.style11 .banner-content,
    .col-xs-12:last-child .item-banner.style16 .banner-content {
        margin-bottom: 0;
    }

    .header .main-header,
    .header .top-bar {
        display: none;
    }

    .footer-device-mobile,
    .header-device-mobile {
        display: block;
    }

    .blog-item .post-format {
        float: none;
        width: auto;
    }

    .blog-list .blog-item .post-format {
        max-width: 100%;
    }

    .blog-item .post-info {
        width: 100%;
        padding: 0;
        overflow: visible;
    }

    .blog-item .post-info::before {
        display: none;
    }

    .blog-slider.style-1 .blog-item {
        margin: 0;
        padding: 15px;
    }

    .blog-list .blog-item {
        padding: 20px;
    }

    .pagination .page-numbers {
        margin-bottom: 10px;
    }

    .error-404 {
        display: block;
    }

    .error-404 .images,
    .error-404 .text-404 {
        display: block;
        width: 100%;
        text-align: center;
        padding-left: 0;
    }

    .error-404 .images {
        margin-bottom: 30px;
    }

    .error-404 .search-form .search-field {
        margin-right: 0
    }

    .text-404 .page-title {
        margin-top: 0;
    }

    .emeriss-iconbox.layout1 {
        text-align: center;
        margin-top: 50px;
    }

    .emeriss-iconbox.layout1 .icon-item {
        display: inline-block;
    }

    .shop-top-control .select-form,
    .shop-top-control .grid-view-mode,
    .shop-top-control {
        display: inline-block;
        text-align: center;
        vertical-align: top;
    }

    .shop-top-control .select-form,
    .grid-view-mode {
        margin-bottom: 10px;
        margin-top: 10px;
    }

    .shop-top-control .grid-view-mode {
        width: auto;
    }

    .full-width .details-thumd {
        padding: 0;
    }

    .full-width .details-thumd .owl-nav .owl-prev {
        left: 0;
    }

    .full-width .details-thumd .owl-nav .owl-next {
        right: 0;
    }

    .item-banner.style1 .banner-content,
    .item-banner.style2 .banner-content {
        padding-left: 30px;
    }

    .product-item .loop-form-add-to-cart {
        display: none;
    }

    .product-item.style-list .product-thumb,
    .product-item.style-list .product-info-left,
    .product-item.style-list .product-info-right {
        display: block;
        padding: 0;
        border: none;
        text-align: center;
        margin: 0 auto
    }

    .product-item.style-list .yith-wcwl-add-to-wishlist {
        width: auto;
        float: none;
    }

    .slider-lookbook-item .lookboox-thumb {
        float: none;
        text-align: center;
        margin: 0 auto;
    }

    .slider-lookbook-item .lookboox-infore {
        padding: 15px 0 0;
    }

    .slider-lookbook-item .name-lookbook {
        margin-bottom: 20px;
    }

    .details-thumd {
        width: 100%;
        padding: 0;
        margin-bottom: 8px;
    }

    .details-infor {
        width: 100%;
        padding: 0;
        border: 0;
        float: none;
    }

    .tab-details-product .tab-link li {
        display: block;
        text-align: center;
        padding: 0;
        margin-bottom: 10px;
    }

    .product-item.style-6.product-type-variable .product-inner {
        padding-bottom: 30px;
    }

    .emeriss-iconbox.default {
        border: none;
    }

    .emeriss-contact-info .title {
        margin-bottom: 20px;
        font-size: 14px;
    }

    .emeriss-newsletter.style1 .title,
    .emeriss-newsletter.style2 .title,
    .footer .widgettitle {
        margin-top: 5px;
    }

    .slider-item.style4 .title-big,
    .slider-item.style5 .title-big,
    .slider-item.style6 .title-big {
        font-size: 28px;
    }
}

@media (max-width: 480px) {

    .emeriss-newsletter.style3 .title,
    .emeriss-newsletter.default .title,
    .product-grid-title,
    .custommenu-title-blog {
        font-size: 18px;
    }

    .slider-item .title-big {
        max-width: 100%;
    }

    .emeriss-blog-item.style2 .post-thumb {
        float: none;
        width: auto;
    }

    .emeriss-blog-item.style2 .blog-title {
        margin-bottom: 30px;
    }

    .emeriss-blog-item.style2 .blog-info {
        width: 100%;
        padding: 0;
        overflow: visible;
    }

    .product-item .product-inner {
        text-align: center;
    }

    .product-list-owl .product-item .thumb-inner img {
        margin: 0 auto;
    }

    .emeriss-newsletter.style1 .newsletter-form-wrap .submit-newsletter {
        padding-left: 10px;
        padding-right: 10px;
    }

    .view-share .author-view,
    .view-share .share {
        display: block;
        float: none;
    }

    .comment-form .form-submit .controll {
        float: none;
        text-align: center;
    }

    .pagination.style1 {
        text-align: center;
    }

    .customer_login .login,
    .customer_login .register {
        padding: 20px 15px 10px;
    }

    .customer_login .title-login {
        padding: 15px;
    }

    .form-message,
    .form-contact-information {
        padding: 20px 15px
    }

    .emeriss-contact-info .socials {
        padding-top: 0;
    }

    .emeriss-contact-info .item {
        margin-bottom: 20px;
    }

    .shop-top-control .select-form,
    .shop-top-control .grid-view-mode,
    .shop-top-control {
        display: block;
        width: 100%;
        border: none;
    }

    .shop-top-control {
        padding-top: 10px;
        margin-bottom: 30px;
    }

    .shop-top-control .grid-view-mode {
        margin-bottom: 0;
    }

    .sevice-box-content {
        padding-left: 15px;
        padding-right: 15px;
    }

    .shipping-address .form-row.form-row-first,
    .shipping-address .form-row.form-row-last {
        width: 100%;
    }

    .shipping-address .form-row.form-row-last {
        float: none;
    }

    .checkout-wrapp .forn-row-col {
        width: 100%;
        padding: 0;
    }

    .payment-method .form-row-card-number {
        max-width: 100%;
    }

    .list-product-order .product-thumb {
        float: none;
        width: auto;
        margin-bottom: 20px;
        margin-right: 0;
    }

    .item-banner .button {
        padding-right: 10px;
        padding-left: 10px;
    }

    .emeriss-blog-item .post-thumb img {
        width: 100%;
    }

    .slider-item .button {
        margin-bottom: 20px;
    }

    .header-block-text-wrapp {
        background: #111111;
    }

    .header-top-message {
        font-size: 11px;
        padding-top: 5px;
        padding-bottom: 5px;
        line-height: 16px;
    }

    .header-block-text {
        font-size: 11px;
        padding-top: 5px;
        padding-bottom: 5px;
        line-height: 16px;
    }

    .header-top-message .icon {
        font-size: 15px;
    }

    .header-block-text .icon {
        font-size: 15px;
    }

    .header-device-mobile .mobile-search-box,
    .header-device-mobile .mobile-settings-box,
    .header-device-mobile .menu-bar {
        width: 35px;
    }

    .header-device-mobile .mobile-navigation,
    .mobile-search-box>a,
    .mobile-settings-box>a {
        width: 35px;
        height: 35px;
        line-height: 31px;
    }

    .header-device-mobile .mobile-navigation {
        padding: 11px 8px 10px;
    }

    .slider-item.style4 .slider-inner .slider-infor,
    .slider-item.style5 .slider-inner .slider-infor,
    .slider-item.style6 .slider-inner .slider-infor,
    .slider-item.style1 .slider-inner .slider-infor,
    .slider-item.style3 .slider-inner .slider-infor,
    .slider-item.style2 .slider-inner .slider-infor,
    .slider-item.style7 .slider-inner .slider-infor,
    .slider-item.style8 .slider-inner .slider-infor,
    .slider-item.style9 .slider-inner .slider-infor,
    .slider-item.style13 .slider-inner .slider-infor,
    .slider-item.style14 .slider-inner .slider-infor,
    .slider-item.style15 .slider-inner .slider-infor,
    .slider-item.style19 .slider-inner .slider-infor,
    .slider-item.style20 .slider-inner .slider-infor,
    .slider-item.style21 .slider-inner .slider-infor,
    .slider-item.style25 .slider-inner .slider-infor,
    .slider-item.style26 .slider-inner .slider-infor,
    .slider-item.style27 .slider-inner .slider-infor {
        padding-right: 15px;
        padding-left: 15px;
        padding-top: 55px;
        padding-bottom: 55px;
    }

    .slider-item.style4 .title-big,
    .slider-item.style5 .title-big,
    .slider-item.style6 .title-big {
        font-size: 26px;
    }

    .slider-item .slider-inner .slider-infor {
        text-align: center !important;
    }

    .item-banner .banner-content {
        padding-right: 15px !important;
        text-align: center !important;
        padding-left: 15px !important;
    }

    .emeriss-newsletter.style3 .newsletter-form-wrap,
    .emeriss-newsletter.style3 .email-newsletter {
        width: 100%;
    }

    .emeriss-newsletter.style3 {
        padding-left: 15px;
        padding-right: 15px;
    }

    .emeriss-testimonials.default .testimonial-item {
        padding: 20px;
        text-align: center;
    }

    .testimonial-item .image {
        float: none;
    }

    .testimonial-item .info {
        padding: 20px;
    }
}

.button,
button,
input[type="submit"],
.block-minicart .shopcart-icon .count,
.load-more a:hover,
.emeriss-newsletter.style1 .newsletter-form-wrap .submit-newsletter:hover,
.product-item .button:hover,
.customer_login input[type="submit"],
.sevice-box-content .sevice-button:hover,
.footer-device-mobile-item.device-cart .count-icon,
.widget_filter_size li.active,
.widget_filter_size li:hover,
.product-item.style-list .single_variation_wrap>.button:hover,
.shoppingcart-content .control-cart .button:hover,
.checkout-wrapp .button:hover,
.product-item .button.quick-wiew-button:hover,
.checkout-wrapp .group-button-payment .btn-credit-card,
.payment-method-wrapp .button-control .btn-pay-now,
.end-checkout .button,
.btn-zoom.open_qv:hover,
.attribute_size .list-size a.active,
.attribute_size .list-size a:hover,
.tab-details-product .tab-link li a::after,
.product-item.style2 .group-buttons .button:hover,
.product-item.style-2 .group-buttons .added_to_cart:hover,
.kt-popup-newsletter.style-2 .mfp-close,
.shopcart-description .actions .button-viewcart:hover,
.kt-popup-quickview .mfp-close,
.emeriss-newsletter.style2 .newsletter-form-wrap .submit-newsletter:hover,
.product-item.style-6 .loop-form-add-to-cart .button,
.pinmap-buttom,
.header-nav-wapper .vertical-wapper,
.slider-item .slider-infor .button:hover,
.list-category .category-item:hover {
    background-color: #5d9d23;
}

.product-item .button:hover,
input[type="text"]:focus,
input[type="number"]:focus,
input[type="search"]:focus,
input[type="email"]:focus,
input[type="password"]:focus,
input[type="tel"]:focus,
input[type="url"]:focus,
textarea:focus,
button:focus,
select:focus,
.sevice-box-content .sevice-button:hover,
.widget_filter_size li.active,
.widget_filter_size li:hover,
.shoppingcart-content .control-cart .button:hover,
.checkout-wrapp .button:hover,
.checkout-wrapp .group-button-payment .btn-credit-card,
.payment-method-wrapp .button-control .btn-pay-now,
.end-checkout .button,
.btn-zoom.open_qv:hover,
.attribute_size .list-size a.active,
.attribute_size .list-size a:hover,
.shopcart-description .actions .button-viewcart:hover,
.emeriss-tabs .tab-link li.active a,
.product-item.style-6 .loop-form-add-to-cart .button,
.slider-item .slider-infor .button:hover {
    border-color: #5d9d23 !important;
}

a:hover,
a:focus,
a:active,
.product-item.style-2 ul li a:hover,
.quantity .btn-number:hover,
.header-user-form-tabs .tab-link li.active,
.review .view:hover,
.review .s-comments:hover,
.product-item.style-list .product-info-left .attributes-display li a:hover,
.cart-form .product-remove:hover a:before,
.cart-form .shop_table .product-name .attributes-select:hover,
.cart-form .coupon .button:hover,
.slick-slider.slider-lookbook.nav-center>.slick-arrow:hover,
.slider-lookbook-item .view-the-look:hover,
.list-product-order .attributes-select:hover,
.header-language .emeriss-submenu>li>a:hover,
.sidebar input[type="checkbox"]:checked+label::before,
.main-menu .submenu>li:hover>a,
.main-menu .submenu>li.active>a,
.block-minicart .no-product .text span,
.header-account .login .lost_password,
.details-thumd .owl-nav div:hover,
.details-infor .availability a,
.details-infor .group-button .yith-wcwl-add-to-wishlist div a:hover::before,
.details-infor .group-button .size-chart-wrapp .btn-size-chart a:hover::before,
.tab-details-product .tab-link li.active a,
.review_form .comment-form-review .stars a.active,
.review_form .comment-form-review .stars a:hover,
.related .slick-slider.nav-center>.slick-arrow:hover,
.up-sells .slick-slider.nav-center>.slick-arrow:hover,
.slider-item .button:hover,
.slick-slider.nav-center>.slick-arrow:hover,
.emeriss-iconbox.default .icon {
    color: #5d9d23;
}

.details-thumd .thumbnails_carousel .owl-item .active img {
    border-color: #5d9d23;
}

@media (min-width: 1367px) {
    .home-slider.fullwidth.rows-space-60 {
        margin-bottom: 80px;
    }

    .banner-wrapp.rows-space-35 {
        margin-bottom: 55px;
    }

    .banner-wrapp.rows-space-30 {
        margin-bottom: 50px;
    }

    .instagram-wrapp .custommenu-title-blog {
        margin-top: 70px;
    }

    .home-slider-banner {
        margin-bottom: 58px;
    }

    .emeriss-product.produc-featured.rows-space-65 {
        margin-bottom: 82px;
    }

    .banner-wrapp.rows-space-65 {
        margin-bottom: 85px;
    }

    .emeriss-blog-wraap.default {
        padding-top: 72px;
        padding-bottom: 75px;
    }

    .home-slider.fullwidth.rows-space-60 {
        margin-bottom: 80px;
    }

    .emeriss-product.produc-featured.rows-space-40 {
        margin-bottom: 60px;
    }

    .banner-pinmap-wrapp.rows-space-70 {
        margin-bottom: 90px;
    }

    .emeriss-product.layout1 {
        padding: 90px 0 52px;
    }
}

.product-item .product-inner img {
    width: 100%;
}

.product-item.style-list .product-info-left ul.p-l-item-kv-box {
    margin-bottom: 2px;
}

.product-item.style-list .product-info-left ul li.p-l-item-k {
    font-weight: 600;
    line-height: 24px;
}

.product-item.style-list .product-info-left ul li.p-l-item-v {
    line-height: 20px;
    padding-left: 8px;
    font-weight: 350;
}

.p_dt_contrast {
    -webkit-filter: contrast(110%);
    filter: contrast(110%);
}

.h_ele_align {
    display: flex;
    justify-content: center;
    align-items: center;
}

.inq-form-box {
    margin-bottom: 10px;
}

.form-search input:focus,
.form-control input:focus {
    outline: 0;
    border-color: #5d9d23;
    box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(197, 119, 3, 0.6);
}

h5.product-name.product-title {
    margin-bottom: 16px;
    font-family: 'Oswald';
}

div.wrap-img-center {
    display: flex;
    justify-content: center;
    align-items: center;
}

.emeriss-menu-item-title:hover {
    background-color: #5d9d23;
    color: #ffffff;
}

.tb-tr-link:hover {
    cursor: pointer;
    background-color: #3f6a18;
}

.p_dt_item {
    -webkit-filter: contrast(105%);
    filter: contrast(105%);
}

.p-dt-tb-td {
    width: 172px;
}

.icon-service {
    width: 44%;
}

.fa-spin-reverse {
    -webkit-animation: spin 1000ms 1 linear;
    animation: spin 1000ms 1 linear;
}

button.press-effect:hover {
    box-shadow: 0 0.25em 0.25em #a26f28, 0 0.125em 1em rgba(72, 84, 59, 0.7);
    transform: translateY(-0.125em);
}

div.category_name_blk:hover {
    box-shadow: 0 0.25em 0.5em #7083df, 0 0.125em 0.6em rgba(72, 84, 59, 0.7);
    transform: translateY(-0.125em);
}

a.full-div {
    display: block;
    height: 100%;
    width: 100%;
    text-decoration: none;
}

@-webkit-keyframes spin {
    0% {
        -webkit-transform: rotate(0deg);
        transform: rotate(0deg);
    }

    100% {
        -webkit-transform: rotate(359deg);
        transform: rotate(359deg);
    }
}

li.subnewcatmenu-item,
li.newcatmenu-item {
    position: static;
}

.newcatmenu_box {
    position: relative;
}

.newcatmenu {
    position: absolute;
    top: 0;
    left: 0;
    padding: 20px 0;
    width: 210px;
    height: 476px;
    background: #5d9d23;
}

.newcatmenu-item-title {
    margin: 10px 0;
    padding-left: 35px;
    width: 100%;
    height: 56px;
    color: #fff;
    line-height: 56px;
}

.newcatmenu-item:hover>a {
    background-color: #fff;
    color: #232323;
}

.newcatmenu-item-hover {
    background-color: #fff;
    color: #232323;
}

.newcatmenu-item a {
    display: inline-block;
}

.subnewcatmenu {
    position: absolute;
    top: 0;
    left: 210px;
    display: none;
    padding: 15px 10px;
    width: 999px;
    height: 476px;
    overflow: auto;
    background-color: #ffffff;
    border-right: 1px solid #5d9d23;
    border-bottom: 1px solid #000;
}

.subnewcatmenu-item {
    padding-top: 5px;
    height: 46px;
}

.subnewcatmenu a {
    font-size: 14px;
}

.subnewcatmenu-wrap-l3 {
    position: relative;
    margin-left: 100px;
    padding: 0 50px 0 160px;
}

.subnewcatmenu-item-title {
    position: absolute;
    z-index: 2;
    overflow: hidden;
    padding-left: 20px;
    padding-right: 12px;
    width: 270px;
    vertical-align: top;
    text-overflow: ellipsis;
    white-space: nowrap;
    font-weight: 700;
}

.subnewcatmenu-item-title span {
    position: absolute;
    right: 0;
}

.subnewcatmenu-item-title i {
    color: #999;
    font-weight: 400;
    font-size: 12px;
}

.subnewcatmenu-item-title:hover,
.subnewcatmenu-item-title:hover i {
    color: #5d9d23;
}

.subnewcatmenu-item-l3 {
    overflow: hidden;
    width: 100%;
    height: 30px;
    text-overflow: ellipsis;
    white-space: nowrap;
}

.subnewcatmenu-item-l3 a {
    margin-right: 15px;
}

.more-newcatmenu:hover,
.subnewcatmenu-item-l3 a:hover {
    color: #5d9d23;
    text-decoration: none;
}

.more-newcatmenu {
    position: absolute;
    top: 0;
    right: 30px;
    bottom: 12px;
    padding: 0 3px;
    height: 22px;
    border: #795548 double 1px;
    color: #795548;
    line-height: 20px;
}

.show-ele {
    display: block;
}

.detail-info-field {
    font-size: 14px;
    line-height: 1.328 !important;
    font-weight: 700 !important;
    color: #2b2b2b;
    margin-top: 0;
    display: table-cell;
    vertical-align: middle;
    width: 20%;
}

.dt-desc-p1-h {
    display: inline-block;
    font-size: 14px;
    font-weight: normal;
    line-height: 24px;
    color: #2B2B2B;
}

.theme-color {
    color: #5d9d23;
}

.dt-exrs-abs {
    display: block;
    font-size: 20px;
    line-height: 1.428;
    font-weight: normal;
    color: #000000;
    margin-top: 0;
}

.tab-details-product td h2 {
    font-size: 26px;
}

.jumbotron {
    background-color: #eee;
    font-weight: 600;
    margin: 30px 0 20px;
    padding: 10px;
}

.shadow-bottom {
    box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 2px rgba(197, 119, 3, 0.6);
}

.slick-list,
.slick-slider,
.slick-track {
    position: relative;
    display: block
}

.slick-slider {
    box-sizing: border-box;
    -webkit-user-select: none;
    -moz-user-select: none;
    -ms-user-select: none;
    user-select: none;
    -webkit-touch-callout: none;
    -khtml-user-select: none;
    -ms-touch-action: pan-y;
    touch-action: pan-y;
    -webkit-tap-highlight-color: transparent
}

.slick-list {
    overflow: hidden;
    margin: 0;
    padding: 0
}

.slick-list:focus {
    outline: 0
}

.slick-list.dragging {
    cursor: pointer;
    cursor: hand
}

.slick-slider .slick-list,
.slick-slider .slick-track {
    -webkit-transform: translate3d(0, 0, 0);
    -moz-transform: translate3d(0, 0, 0);
    -ms-transform: translate3d(0, 0, 0);
    -o-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0)
}

.slick-track {
    top: 0;
    left: 0
}

.slick-track:after,
.slick-track:before {
    display: table;
    content: ''
}

.slick-track:after {
    clear: both
}

.slick-loading .slick-slide,
.slick-loading .slick-track {
    visibility: hidden
}

.slick-slide {
    display: none;
    float: left;
    height: 100%;
    min-height: 1px
}

[dir=rtl] .slick-slide {
    float: right
}

.slick-initialized .slick-slide,
.slick-slide img {
    display: block
}

.slick-arrow.slick-hidden,
.slick-slide.slick-loading img {
    display: none
}

.slick-slide.dragging img {
    pointer-events: none
}

.slick-vertical .slick-slide {
    display: block;
    height: auto;
    border: 1px solid transparent
}

.emeriss-menu-clone-wrap {
    position: fixed;
    top: 0;
    left: -320px;
    width: 320px;
    height: 100vh;
    background-color: #fff;
    -webkit-transition: .3s;
    -o-transition: .3s;
    -moz-transition: .3s;
    transition: .3s;
    z-index: 100000;
    -webkit-box-shadow: 3px 5px 14px -3px rgba(0, 0, 0, .11);
    -moz-box-shadow: 3px 5px 14px -3px rgba(0, 0, 0, .11);
    box-shadow: 3px 5px 14px -3px rgba(0, 0, 0, .11);
    color: #000
}

.emeriss-menu-clone-wrap.open {
    left: 0
}

.emeriss-menu-panels-actions-wrap {
    border-bottom: 1px solid #eee;
    height: 50px;
    position: relative
}

.emeriss-menu-panels-actions-wrap .emeriss-menu-close-btn,
.emeriss-menu-panels-actions-wrap .emeriss-menu-prev-panel {
    width: 50px;
    height: 50px;
    position: absolute;
    top: 0;
    right: 0;
    z-index: 10;
    border-left: 1px solid #eee;
    text-align: center;
    line-height: 50px;
    color: #000
}

.emeriss-menu-panel>ul>li.active>a,
.emeriss-menu-panel>ul>li:hover>a,
.emeriss-menu-panels-actions-wrap .emeriss-menu-close-btn:hover,
.emeriss-menu-panels-actions-wrap .emeriss-menu-prev-panel:hover {
    color: #000
}

.emeriss-menu-panels-actions-wrap .emeriss-menu-prev-panel {
    right: inherit;
    left: 0;
    border: none;
    border-right: 1px solid #eee
}

.emeriss-menu-panels-actions-wrap .emeriss-menu-current-panel-title {
    display: block;
    text-align: center;
    line-height: 50px;
    padding: 0 50px;
    text-transform: uppercase
}

.emeriss-menu-panels-actions-wrap .emeriss-menu-prev-panel:before {
    content: "\f104";
    font-family: FontAwesome
}

.emeriss-menu-panel>ul {
    padding: 0;
    margin: 0
}

.emeriss-menu-panel li {
    list-style: none;
    position: relative
}

.emeriss-menu-panel>ul>li {
    padding: 0 20px;
    border-bottom: 1px solid #eee
}

.emeriss-menu-panel>ul>li>a {
    display: block;
    line-height: 50px;
    color: #000;
    text-transform: uppercase
}

.emeriss-menu-next-panel {
    width: 50px;
    height: 50px;
    text-align: center;
    line-height: 50px;
    position: absolute;
    top: 0;
    right: 0;
    z-index: 10
}

.emeriss-menu-next-panel:before {
    content: "\f105";
    font-family: FontAwesome
}

.emeriss-menu-clone-wrap .toggle-submenu {
    display: none !important
}

.emeriss-menu-clone-wrap .emeriss-menu-panels {
    background: inherit;
    border-color: inherit;
    z-index: 0;
    box-sizing: border-box;
    overflow: hidden;
    height: calc(100% - 50px);
    position: relative
}

.emeriss-menu-clone-wrap .emeriss-menu-panel {
    background-color: #fff
}

.emeriss-menu-clone-wrap .emeriss-menu-panel.emeriss-menu-sub-panel {
    border-color: #fff;
    bottom: 0;
    box-sizing: border-box;
    display: block;
    left: 0;
    margin: 0;
    overflow-x: hidden;
    overflow-y: auto;
    position: absolute;
    right: 0;
    top: 0;
    transform: translateX(100%);
    transition: .2s;
    z-index: 0
}

.emeriss-menu-clone-wrap .emeriss-menu-panel.emeriss-menu-panel-opened {
    transform: translateX(0);
    z-index: 999
}

.emeriss-menu-clone-wrap .emeriss-menu-sub-opened {
    z-index: 1;
    opacity: 0;
    visibility: hidden
}

.emeriss-menu-clone-wrap .emeriss-menu-hidden {
    display: block !important;
    opacity: 0;
    visibility: hidden
}

.emeriss-menu-clone-wrap .submenu.mega-menu {
    padding: 20px;
    max-width: 100% !important;
    width: 100% !important
}

.emeriss-menu li>a>.icon {
    margin-right: 10px
}

.emeriss-menu-panel-main {
    position: absolute;
    top: 0;
    right: 0;
    left: 0;
    bottom: 0;
    overflow-x: hidden;
    overflow-y: auto;
    -webkit-transition: .3s;
    -moz-transition: .3s;
    -ms-transition: .3s;
    -o-transition: .3s;
    transition: .3s
}

.emeriss-menu-panel.emeriss-menu-panel-opened .submenu {
    opacity: 1;
    visibility: visible
}

.emeriss-menu-panel>.mega-menu .widget-custom-menu {
    width: 100%
}

.emeriss-menu-panels .menu-item-has-children>a::after {
    display: none
}

.emeriss-menu-panel.emeriss-menu-panel-opened .menu-page {
    background-image: none
}

.emeriss-menu-panel .emeriss-demolink .title,
.emeriss-menu-panel .main-menu>li>a,
.emeriss-menu-panel .mega-menu .emeriss-custommenu .widgettitle {
    color: #222 !important
}

.emeriss-menu-panel .mega-menu .emeriss-custommenu ul li {
    color: #555
}

@font-face {
    font-family: 'FontAwesome';
    src: url('fontawesome-webfont.woff2?v=4.7.0') format('woff2'), url('fontawesome-webfont.ttf?v=4.7.0') format('truetype');
    font-weight: normal;
    font-style: normal;
    font-display: swap;
}

.fa {
    display: inline-block;
    font: normal normal normal 14px/1 FontAwesome;
    font-size: inherit;
    text-rendering: auto;
    -webkit-font-smoothing: antialiased;
    -moz-osx-font-smoothing: grayscale
}

.fa-search:before {
    content: "\f002"
}

.fa-gift:before {
    content: "\f06b"
}

.fa-shopping-cart:before {
    content: "\f07a"
}

.fa-angle-double-up:before {
    content: "\f102"
}

.fa-home:before {
    content: "\f015"
}

.fa-compass:before {
    content: "\f14e"
}

.fa-remove:before,
.fa-close:before,
.fa-times:before {
    content: "\f00d"
}

.fa-angle-left:before {
    content: "\f104"
}

.fa-envelope-o:before {
    content: "\f003"
}

.fa-angle-right:before {
    content: "\f105"
}

.fa-phone:before {
    content: "\f095"
}

.fa-facebook-f:before,
.fa-facebook:before {
    content: "\f09a"
}

.fa-long-arrow-left:before {
    content: "\f177"
}

.fa-long-arrow-right:before {
    content: "\f178"
}

@font-face {
    font-family: Flaticon;
    src: url("../fonts/flaticon/Flaticon.woff2") format("woff2");
    font-weight: 400;
    font-style: normal;
    font-display: swap;
}

[class*=" flaticon-"]:after,
[class*=" flaticon-"]:before,
[class^=flaticon-]:after,
[class^=flaticon-]:before {
    font-family: Flaticon;
    font-size: inherit;
    font-style: normal;
    line-height: 1
}

.flaticon-return:before {
    content: "\f133"
}

.flaticon-padlock:before {
    content: "\f134"
}

.flaticon-startup:before {
    content: "\f139"
}

.flaticon-check:before {
    content: "\f114"
}

.flaticon-delivery-truck:before {
    content: "\f121"
}

.flaticon-key:before {
    content: "\f13d"
}

.flaticon-placeholder:before {
    content: "\f11a"
}

.flaticon-clock:before {
    content: "\f109"
}

.flaticon-rocket-ship:before {
    content: "\f131"
}

.flaticon-support:before {
    content: "\f123"
}

.flaticon-mail:before {
    content: "\f107"
}

.flaticon-shopping-cart:before {
    content: "\f136"
}

.desc-part-i {
    flex: 1;
    border: 2px solid rgb(218, 221, 223);
    box-sizing: border-box;
    border-radius: 4px;
    padding: 20px 30px;
}

.desc-part-i-var-btm-line {
    padding-bottom: 12px;
    margin-bottom: 14px;
    border-bottom: 1px dashed rgb(218, 221, 223);
}

.text-in-stock {
    font-size: 24px;
    font-weight: 700;
    color: #007600;
    line-height: 41px;
}

.go_to_inquiry_button {
    float: left;
}

.flex-container {
    display: flex;
    margin-bottom: 30px;
    margin-top: 20px
}

.form-search .form-content .btn-search .icon-search::before {
    content: "\f12d";
    font-family: Flaticon;
    display: inline-block;
    vertical-align: middle;
    position: relative;
}

select::-ms-expand {
    display: none;
}

.simple-select-input {
    display: inline-block;
    box-sizing: border-box;
    padding: 0.3em 2em 0.5em 0.5em;
    border: 1px solid #007600;
    font: inherit;
    line-height: inherit;
    -webkit-appearance: none;
    -moz-appearance: none;
    -ms-appearance: none;
    appearance: none;
    background-repeat: no-repeat;
    background-image: linear-gradient(45deg, transparent 50%, currentColor 50%), linear-gradient(135deg, currentColor 50%, transparent 50%);
    background-position: right 15px top 1em, right 10px top 1em;
    background-size: 5px 5px, 5px 5px;
}

.simple-select-input:focus {
    border: 1px solid #007600 !important;
}

.size-price .product-price {
    display: flex;
    align-items: center;
    font-size: 20px;
    color: #007600;
    font-weight: bold;
}

.row-ins {
    line-height: 2.8rem;
    color: #d79569;
}

.row-ins a {
    font-weight: bold;
}

.three-colum {
    border: 0;
}

.three-colum thead {
    background-color: #fff;
}


.Inquiry .row div{
    padding-top: 10px;
}

.three-colum th {
    font-weight: bold;
}

.three-colum th,
.three-colum td {
    border: 0;
}

.three-colum {
    width: 100%;
}

.three-colum thead {
    border-bottom: 1px solid #ddd;
}

.three-colum tr td,
.three-colum tr th {
    padding-right: 3rem;
    vertical-align: top;
}

.table-break-word tr td,
.table-break-word tr th {
    word-break: break-word;
}

.three-colum tr p {
    margin-bottom: 0.5rem;
}

.ibi-title {
    border-bottom: 1px solid #ddd;
    padding: 5px;
    font-size: 15px;
    font-weight: bold;
}

.ibi-item {
    margin: 15px 10px 10px 0;
    display: flex;
}

.box-img {
    flex: 1;
    box-shadow: 0 3px 3px #acacac;
}

.ibi-info {
    flex: 4;
}

.ibi-img {
    margin-right: 30px;
}

.ibi-info-key {
    flex: 1;
    width: 138px;
    display: inline-block;
    font-weight: bold;
    margin-left: 10px;
}

.ibi-info-key1 {
    width: 150px;
}

.ibi-info-item {
    display: flex;
    margin-top: 0.2rem;
    margin-bottom: 0.8rem;
}

.ibi-info-value {
    flex: 4;
}

.detail-info-field-name {
    position: relative;
}

.field-tooltip {
    display: none;
    position: absolute;
    transform: translateX(-3%);
    background-color: #333;
    color: #fff;
    padding: 5px;
    border-radius: 5px;
}

.show-tooltip:hover .field-tooltip {
    display: block;
    opacity: 1;
    z-index: 853;
}

.show-tooltip {
    cursor: context-menu;
}

.sidebar-inner {
    border: 1px solid #e1e1e1;
    padding: 15px;
    border-radius: 6px;
}

.ss-icon {
    position: absolute;
    right: 0;
}

.card-header {
    border-bottom: 1px solid #ddd;
    line-height: 40px;
    font-size: 15px;
    margin-bottom: 10px;
}

.widget .card a {
    color: #050b20;
}

.cate-item {
    padding: 5px 15px;
    font-size: 14px;
    border-bottom: 1px dotted #ddd;
}

.cate-item1 {
    padding: 5px 13px;
    font-size: 13px;
}

.widget .cate-item1 .active {
    color: #5d9d23;
}

.detail-section-item {
    margin-top: 30px;
    border: 0;
    padding: 0px 1rem 17px 10px;
    border-bottom: 1px solid #e2e2e2;
}

.detail-section-overview {
    margin-top: 50px;
    padding-bottom: 30px;
}

.detail-section-link a {
    font-size: 1.5rem;
    font-weight: normal;
    color: #000;
}

.three-colum .no-btm-border {
    border-bottom: 0;
}

.point-hard :hover {
    cursor: pointer;
}

.properties-tables {
    overflow-x: auto;
    width: 100%;
}

.properties-tables tbody td {
    font-size: 12px;
}

.properties-tables tbody .indent4 {
    padding: 0 35px 10px;
}

.properties-tables tbody tr:last-child td {
    padding-bottom: 20px;
}

.properties-tables tbody tr:first-child td {
    padding-top: 6px;
}

.properties-tables table {
    margin-bottom: 0px;
}

.three-colum tr .properties-sub-table {
    padding-top: 6px;
    padding-bottom: 0;
}

.reaction-title .igc-item-title-left {
    font-size: 1.8rem;
}

.detail-reaction-item {
    margin-top: 30px;
    padding: 1rem;
    padding-bottom: 10px;
    border-bottom: 1px solid #e2e2e2;
}

.reaction-sub-body .detail-section-item {
    border-bottom: 0;
}

.reaction-sub-body :last-child {
    border-bottom: 0;
}

.citation-total {
    margin-top: 30px;
    width: 160px;
    height: 160px;
    font-size: 14px;
    color: #5d9d23;
    text-align: center;
    border: 8px solid #E9F2FF;
    border-radius: 50%;
}

.citation-total-info1 {
    font-size: 13px;
    margin-top: 38px;
    font-weight: 500;
}

.citation-total-num {
    margin-top: 10px;
    font-size: 30px;
    font-weight: 700;
    margin-bottom: 10px;
}

.citation-total-info2 {
    font-weight: 500;
}

.citation-list {
    margin-top: 30px;
    font-size: 15px;
    line-height: 30px;
}

.citation-item {
    margin-bottom: 20px;
}

.citation-item-title a {
    font-weight: 500;
}

.citation-item-author {
    font-size: 13px;
}

.citation-item-author a {
    font-size: 13px;
    text-decoration: underline;
    color: #222222;
    font-weight: 500;
}

.citation-item-info {
    margin-top: 7px;
    color: #050b20;
    font-size: 13px;
    line-height: 18px;
}

.citation-item-quote {
    margin-top: 10px;
    font-size: 14px;
    color: #5d9d23;
    margin-bottom: 10px;
}

.citation-item-quote .citation-quote {
    color: #050b20;
}

.citation-pdf {
    margin-left: 20px;
}

.citation-item-quote a:hover {
    color: #5d9d23;
    cursor: pointer;
}

.citation-more {
    margin-top: 30px;
    margin-bottom: 40px;
}

.citation-button {
    background-color: #fff;
    border: 1px solid #5d9d23;
    color: #5d9d23;
    border-radius: 8px;
    font-weight: 500;
}

.details-product .details-thumd .product-detail-image {
    background-color: #fbfbfb;
    border: 0 solid rgb(218, 221, 223);
    box-shadow: none;
    border-radius: 4px;
}

.desc-part-i {
    background-color: #fbfbfb;
    border: 0 solid rgb(218, 221, 223);
}

.fill-group-td {
    border-top: 1px dotted #ddd;
}

.fill-group-line {
    margin-top: 5px;
    height: 1px;
    margin-left: 25px;
    border-bottom: 1px dotted #ddd;
}

.retro-container .bold {
    font-weight: bold;
}

.retro-container .sub-title2 {
    font-weight: bold;
    font-size: 1.6rem;
    margin-top: 30px;
    margin-bottom: 10px;
}

.retro-container .sub-title2-route {
    margin-top: 10px;
}

.retro-reaction-condition .retro-reaction-condition-title {
    margin-top: 30px;
    font-weight: bold;
    font-size: 1.6rem;
    margin-bottom: 20px;
    border-bottom: 0;
}

.retro-reaction-condition-info {}

.retro-condition-recommend .igc-item-title {
    border-bottom: 0;
}

.retro-container .no-btm-border td,
.retro-container .no-btm-border th {
    padding: 0 6px 0 10px;
}

.retro-container .retro-router-show {
    width: 100%;
    height: 500px;
    border: 1px solid #fbfbfb;
    text-align: center;
    background-color: #fbfbfb;
    margin-bottom: 40px;
}

.retro-container .reaction-procedure-body p {
    margin-bottom: 10px;
}

.retro-router-to {
    margin-top: 30px;
}

.router-tab-inner {
    padding: 50px 0;
}

.router-tab-inner-border {
    border: 1px solid #ddd;
    border-radius: 10px;
    margin-bottom: 30px;
    padding: 30px 10px 10px;
    box-shadow: 0 0 5px #ddd;
}

.retro-tabs {
    display: flex;
    list-style: none;
    padding: 0;
}

.retro-tabs li {
    flex: 1;
    list-style: none;
    border-bottom: 1px solid #e1e1e1;
}

.retro-tabs li a {
    font-weight: bold;
    margin: 0 2px;
    padding: 0 20px 5px;
    display: block;
    text-align: center;
}

.retro-tabs-left li a {
    text-align: left;
}

.retro-tabs li a:hover {
    border-bottom: 1px solid #d79569;
}

.retro-tabs .active a {
    border-bottom: 1px solid #d79569;
}

.retro-reaction-imgshow {
    margin-top: 1rem;
    display: flex;
}

.retro-reaction-img-item {
    text-align: center;
    flex: 2;
}

.retro-reaction-img-item-add {
    flex: 1;
    height: 70px;
    justify-content: center;
    display: flex;
}

.retro-reaction-img-item-arrow {
    flex: 1;
    height: 70px;
    justify-content: center;
    display: flex;
}

.retro-product-img {
    height: 70px;
    justify-content: center;
    display: flex;
}

.retro-product-action {
    margin-top: 30px;
    font-weight: bold;
}

.retro-reaction-product-info {
    margin-top: 30px;
}

.rrpi-img {
    width: 300px;
    justify-content: center;
    display: flex;
}

.rrpi-img img {
    width: 300px;
}

.rrpi-attrs {
    flex: 1;
    margin-left: 30px;
}

.rrpi-attrs-title {
    margin-left: 10px;
    font-weight: bold;
    margin-bottom: 10px;
}

.retro-reaction-product-info-item {
    display: flex;
    border: 1px solid #ddd;
    border-radius: 10px;
    margin-bottom: 30px;
    padding: 30px 10px 10px;
    box-shadow: 0 0 5px #ddd;
}

.retro-reaction-product-info-item:last-child {
    margin-bottom: 0;
}

.inner-table2 {
    margin-top: 20px;
}

.rr-sub-item {
    border-bottom: 1px solid #ddd;
}

.rr-sub-item:last-child {
    border-bottom: 0;
}

.retro-table {
    border: 0;
}

.retro-table>tbody>tr>th {
    padding: 15px 0;
}

.retro-condition-recommend .retro-table>thead>tr>th {
    padding: 10px 5px;
    text-align: center;
}

.retro-condition-recommend .retro-table .td-border td {
    border: 0;
    border-bottom: 1px dotted #e5e5e5;
    text-align: left;
    vertical-align: middle;
}

.retro-condition-recommend .retro-table .retro-reaction-product-info-item .no-btm-border td {
    border-bottom: 0;
}

.retro-condition-recommend .retro-table .td-noborder td {
    border: 0;
    text-align: center;
    vertical-align: middle;
}

.retro-template-item-image {
    text-align: center;
}

.rrpi-attrs table tr td,
.rrpi-attrs table tr th {
    padding: 3px;
    padding-bottom: 3px;
    font-size: 12px;
}

.common-height {
    line-height: 18px;
}

.cs-h3 {
    padding: 0;
    margin: 0;
    font-size: inherit;
    font-weight: bold;
}

.cs-h2 {
    margin-bottom: 0;
}

.product-content-details h2 {
    font-size: inherit;
    font-weight: bold;
}

.product-content-details h3 {
    font-size: 1.6rem;
    font-weight: bold;
    margin: 22px;
}

.product-content-details h4 {
    font-size: 1.5rem;
    font-weight: bold;
    margin-bottom:0px
}

.minwidth700 {
    min-width: 700px;
}

.article-h2 {
    font-size: 20px;
    font-weight: 600;
}

.title-text-href {
    color: #fff;
}

.title-text-href:hover {
    color: #fff;
}

.title-text-href:active {
    color: #fff;
}

.title-text-href:focus {
    color: #fff;
}

div.reaction-procedure-body ul li a {
    color: #000;
}

.site-main .reaction-sub-body {
    color: #000;
}

#ohsnap {
    position: fixed;
    top: 5px;
    right: 5px;
    margin-left: 5px;
    z-index: 99;
    text-shadow: none;
}

.alert {
    text-align: right;
    margin-top: 0px;
    padding: 15px;
    border: 1px solid #eed3d7;
    border-radius: 4px;
    float: right;
    clear: right;
    background-color: white;
}

.alert-red {
    color: white;
    background-color: #DA4453;
}

.alert-green {
    color: white;
    background-color: #007600;
}

.alert-blue {
    color: white;
    background-color: #4A89DC;
}

.alert-yellow {
    color: white;
    background-color: #F6BB42;
}

.alert-orange {
    color: white;
    background-color: #E9573F;
}

.top-bar {
    background: #f3f3f3;
}

.top-bar-left {
    display: inline-block;
    line-height: 60px;
}

.top-bar-right {
    display: inline-block;
    float: right;
}

.top-bar .header-language {
    float: left;
}

.top-bar .header-user-links {
    display: inline-block;
    margin: 0;
    list-style: none;
    padding-left: 15px;
}

.top-bar .social-header {
    float: right;
}

.top-bar .header-language .emeriss-language {
    padding-top: 0;
    margin: 0;
}

.top-bar .emeriss-language .language-toggle {
    line-height: 60px;
    padding-right: 13px;
}

.top-bar .header-language .emeriss-submenu {
    margin-top: 0;
}

.top-bar .header-user-links a {
    line-height: 48px;
}

.top-bar-right .social-header .socials {
    padding-top: 0;
}

.top-bar-right .social-header .social-item {
    color: #fff;
    line-height: 48px;
    padding: 0 12px;
}

.top-bar-right .social-header .social-item:last-child {
    padding-right: 0;
}

.header.style2 .top-bar {
    background: #111;
}

.top-bar-left .header-message {
    color: #565656;
}

.reaction-procedure-body p {
    margin-bottom: 0;
}

.reaction-procedure-body p.qa_answer {
    margin-bottom: 30px;
}

.reaction-procedure-body h4 {
    margin-top: 18px;
    margin-bottom: 0;
}

.bgmain {
    padding: 0;
    margin: 0;
    background-color: #5d9d23;
    color: #fff;
    /* background-image: url("../img/banner6.jpg"); */
    /* background-image: linear-gradient(rgba(255,255,255,0.5), rgba(255,255,255,0.5)), url('../img/banner.jpg'); */
    /* background-size: cover; */
}
.banner{
    background-image: url("../img/banner6.jpg");
}

.to_upper {
    text-transform: uppercase;
}

.emeriss-menu-item-title:hover {
    background-color: #5d9d23;
    color: #ffffff;
}

.to_upper:hover {
    color: #fff;
}

.navbar-brand {
    padding: 30px 15px;
}

.newcatmenu {
    background: #1e2334;
}

.subnewcatmenu {
    color: #333;
}

.subnewcatmenu-item-title:hover,
.subnewcatmenu-item-title:hover i {
    color: #000;
}

.search-main {
    padding: 100px 0;
    margin: auto;
}

.search-main-info1 {
    font-family: 'DM Sans';
    font-style: normal;
    font-weight: 700;
    font-size: 26px;
    line-height: 45px;
    leading-trim: both;
    text-edge: cap;
    text-align: center;
}

.search-main-info2 {
    font-family: 'DM Sans';
    font-style: normal;
    font-weight: 700;
    font-size: 52px;
    line-height: 45px;
    leading-trim: both;
    text-edge: cap;
    text-align: center;
    margin-top: 30px;
    color: #fff;
}

.search-main-search {
    margin: 70px;
}

.home-search {
    display: flex;
    height: 70px;
    background-color: #fff;
    border-radius: 35px;
    line-height: 70px;
}

.search-input {
    flex: 5;
}

.search-input input {
    height: 70px;
    border: 0;
    color: #333;
    font-size: 25px;
    padding-left: 30px;
    width: 100%;
    border-radius: 35px;
}

.search-input input::placeholder {
    color: gray;
}

.home-search .search-input input:focus {
    border: 0;
    box-shadow: None;
}

.search-input-select-type {
    flex: 1;
    color: #405FF2;
    font-size: 15px;
}

.search-input-select-type .btn-default {
    color: #405FF2;
    border: 0;
    border-left: 1px solid #e1e1e1;
    border-radius: 0;
}

.search-input-submit {
    flex: 1;
}

.search-btn-primary {
    border-radius: 25px;
    padding: 13px 15px;
    font-size: 20px;
    font-weight: bold;
    background-color: #5d9d23;
    border: 0px;
}
.search-btn-primary:hover,.search-btn-primary:active{
    color: #fff;
    background-color: #3f6a18;
    border-color: #3f6a18;
}

.search-main-category-info {
    text-align: center;
    font-weight: 500;
}

.search-main-category-list {
    margin-top: 10px;
    text-align: center;
}

.search-btn-label {
    border-radius: 25px;
    padding: 12px 12px;
    font-size: 16px;
    font-weight: bold;
    background-color: #ffffff;
    color: #5d9d23;
    border: 0;
}

.search-btn-label:hover{
    background: #3f6a18;
}

.home-corner {
    border-radius: 35px;
    height: 80px;
    margin-top: -40px;
    width: 100%;
    background: #ffffff;
}

.home-corner-bottom {
    position: absolute;
    margin-top: -40px;
    background-color: #fff;
}

.home-item {
    padding-top: 30px;
}

.home-item-header {
    display: flex;
}

.home-item-header-left {
    font-family: 'DM Sans';
    font-style: normal;
    font-weight: 700;
    font-size: 40px;
    line-height: 45px;
    color: #050B20;
    flex: 5;
}

.home-item-header-right {
    font-family: 'DM Sans';
    font-style: normal;
    font-weight: 500;
    font-size: 15px;
    line-height: 45px;
    color: #050B20;
}

.home-nav-tabs {
    margin-top: 30px;
}

.home-nav-tabs .nav-tabs>li.active>a,
.nav-tabs>li.active>a:focus,
.nav-tabs>li.active>a:hover {
    border-radius: 0;
    color: #050B20;
    font-family: 'DM Sans';
    font-style: normal;
    font-weight: 500;
    font-size: 16px;
    line-height: 28px;
    background-color: #f9fbfc;
    border: 0;
}

.home-nav-tabs .nav-tabs>li>a {
    line-height: 28px;
}

.home-nav-tabs .nav-tabs .active {
    border-bottom: 1px solid #5d9d23;
}

.home-nav-tabs .nav-tabs>li:hover {
    color: #050B20;
    background-color: #f9fbfc;
    border: 0;
    border-bottom: 1px solid #5d9d23;
    line-height: 28px;
}

.home-nav-tabs .nav-tabs>li>a {
    border: 0;
}

.gray-bg {
    background-color: #f9fbfc;
}

.home-product-item {
    margin-top: 30px;
    border: 1px solid #e1e1e1;
    border-radius: 6px;
    box-shadow: 0 0 2px #ddd;
    overflow: hidden;
}
.home-product-item .hpi-img{
    text-align: center;
}
.home-product-item .hpi-img img{
    width: 70%;
}

.hpi-info-main {
    margin: 10px;
}

.hpi-info-main .hpi-name {
        font-weight: bold;
    font-size: 16px;
    width: 100%;
    margin-bottom: 10px;
    color: #050B20;
    height: 40px;
}

.hpi-info-main .hpi-name a {
    color: #050B20;
}

.hpi-info-main .hpi-name a:hover {
    color: #5d9d23;
}

.hpi-info-main .hpi-info {
    font-size: 14px;
    color: #050B20;
}
.hpi-info-main .hpi-price {
    font-size: 21px;
    color: #5d9d23;
}
.hpi-info-main .hpi-price span{
    padding-left: 5px;
    font-size: 14px;
    color: #050B20;
}

.hpi-info-more {
    display: none;
    margin-right: 20px;
    line-height: 28px;
    font-size: 15px;
    text-align: right;
    color: #405FF2;
    margin-bottom: 5px;
}

.hpi-info-more img {
    margin-left: 5px;
}

.hpi-info-more a:hover {
    color: #405FF2;
}

.home-tabs-controller {
    margin-top: 30px;
    margin-bottom: 50px;
    display: flex;
}

.htc-lr {
    padding: 5px 20px;
    border: 1px solid #ddd;
    border-radius: 20px;
}

.htc-mid {
    padding: 15px 0 15px 25px;
    text-align: center;
}

.home-tabs-controller-dot {
    display: flex;
    list-style: none;
    position: inherit;
    width: 100%;
}

.home-tabs-controller-dot li {
    width: 7px;
    height: 7px;
    border-radius: 50%;
    background-color: #957d7d;
    padding: 0;
    margin-left: 2px;
    margin-right: 2px;
}

.home-tabs-controller-white {
    color: #fff;
}

.home-tabs-controller-white .htc-lr {
    border: 1px solid #fff;
}

.carousel-indicators .active {
    background-color: #0b0b0b;
    width: 7px;
    height: 7px;
    line-height: 32px;
}

.carousel-indicators li {
    margin: 0 5px;
}

.carousel-indicators .active {
    margin: 0 5px;
}

.wall-img img {
    max-width: 100%;
    max-height: 70px;
}

.wall-img {
    margin: 10px 5px;
    height: 70px;
    text-align: center;
    vertical-align: middle;
    line-height: 70px;
}

.wall-info {
    padding: 40px;
    background-color: #eef1fb;
}

.wall-info-list {
    padding: 0;
    margin: 0;
    list-style: none;
    margin-top: 20px;
}

.wall-info-list li {
    list-style: none;
    line-height: 26px;
    margin-right: 5px;
    font-family: 'DM Sans';
    font-style: normal;
    font-weight: 500;
    font-size: 15px;
    color: #050B20;
    margin-bottom: 10px;
}

.wall-info-title {
    font-size: 35px;
    color: #050B20;
}

.wall-info-text {
    font-size: 15px;
    line-height: 26px;
    margin-top: 10px;
}

.wil-dot {
    width: 25px;
    height: 25px;
    border-radius: 50%;
    display: inline-block;
    background-color: #fff;
    text-align: center;
    box-shadow: 0 0 3px #ddd;
    line-height: 25px;
    margin-right: 6px;
}

.branding-wall {
    margin-top: 30px;
}

.started-btn-primary {
    background-color: #405FF2;
}

.wall-more {
    margin-top: 20px;
}

.htcount {
    margin-top: 20px;
}

.htcount-title {
    text-align: center;
    color: #050B20;
    font-size: 38px;
}

.htcount-info {
    text-align: center;
    color: #050B20;
    font-size: 15px;
    margin-top: 15px;
}

.home-hr {
    margin-top: 50px;
}

.home-paper-header {
    display: flex;
}

.home-paper-title {
    flex: 5;
    font-size: 38px;
    color: #fff;
}

.home-paper-more {
    flex: 1;
}

.home-paper {
    margin-top: 50px;
    background-color: #5d9d23;
    padding-top: 50px;
    padding-bottom: 50px;
}

.home-paper-more {
    color: #fff;
}

.home-paper-more a:hover {
    color: #fff;
}

.home-paper-more {
    margin-top: 20px;
    line-height: 26px;
    font-size: 15px;
    text-align: right;
}

.hpb-item-body {
    color: #fff;
    background-color: #191e32;
}

.hpb-item-body a {
    color: #fff;
}

.hpb-item-body {
    display: flex;
}

.hpb-item-img {
    flex: 1;
    width: 240px;
    height: 350px;
    margin-right: 10px;
}

.hpb-item-img img {
    border-radius: 10px;
    max-width: 100%;
    width: 100%;
    padding: 3px;
    box-shadow: 0 0 5px #5d9d23;
}

.hpb-item-item {
    flex: 1;
    padding: 15px 15px 15px 0;
}

.home-paper-body {
    margin-top: 30px;
}

.hpb-item-img img {
    border-radius: 10px;
    max-width: 100%;
}

.hpb-item-title {
    font-size: 18px;
}

.hpb-item-info {
    margin-top: 10px;
    font-size: 14px;
    line-height: 22px;
}

.hpb-item-info1 {
    margin-top: 5px;
    font-size: 16px;
    line-height: 23px;
}

.hpb-item-info-main {
    margin-top: 10px;
}

.hpb-item-info2 {
    font-size: 14px;
    line-height: 22px;
}

.hpb-item-more {
    margin-top: 10px;
    font-size: 15px;
    text-align: right;
    position: absolute;
    bottom: 5px;
    right: 30px;
    display: none;
}

.hpb-item-more img {
    margin-left: 5px;
}

.home-service {
    margin-top: 50px;
    margin-bottom: 60px;
}

.home-service-title {
    font-family: DM Sans;
    font-size: 40px;
    font-weight: 700;
    line-height: 45px;
}

.home-service-body {
    margin-top: 40px;
    color: #050B20;
}

.home-service-body a {
    color: #050B20;
}

.home-service-body a:hover {
    color: #5d9d23;
}

.home-service-item-img img {
    width: 80px;
}

.home-service-item-title {
    margin-top: 15px;
    font-family: DM Sans;
    font-size: 20px;
    font-weight: 500;
    line-height: 26.04px;
}

.home-service-item-info {
    margin-top: 20px;
    font-family: DM Sans;
    font-size: 14px;
    font-weight: 400;
    line-height: 26px;
}

.v1-footer {
    margin-top: 50px;
    background-color: #5d9d23;
    color: #fff;
    padding-bottom: 50px;
}

.v1-footer2 {
    background-color: #5d9d23;
    color: #fff;
    border-top: 1px solid #ffffff;
    padding-top: 30px;
    padding-bottom: 30px;
}

.v1-footer2 a {
    color: #fff;
}

.v1-footer:a {
    color: #fff;
}

.footer-site-title {
    font-family: Bebas Neue;
    font-size: 35px;
    font-weight: 400;
    line-height: 42px;
    letter-spacing: 0.05em;
}

.footer-site-info {
    font-family: DM Sans;
    font-size: 15px;
    font-weight: 400;
    line-height: 26px;
    text-align: left;
}

.footer-link-body {
    margin-top: 20px;
    padding-top: 30px;
    border-top: 1px solid #ffffff;
}

.link-lists {
    padding: 0;
    margin: 0;
    list-style: none;
}

.link-lists li {
    padding: 0;
    margin: 0;
    list-style: none;
    font-family: DM Sans;
    font-size: 13px;
    font-weight: 400;
    line-height: 35px;
}

.link-lists .link-header {
    font-family: DM Sans;
    font-size: 20px;
    font-weight: 500;
    line-height: 30px;
    margin-bottom: 10px;
}

.footer-emeriss-payment {
    text-align: right;
}

.top-search {
    margin-top: 8px;
    display: flex;
    border: 2px solid #d1d1d1;
    height: 40px;
    line-height: 40px;
    background-color: #fff;
    border-radius: 15px;
    margin-left: 15px;
    box-shadow: 0 0 5px #ddd;
}

.top-search:hover {
    box-shadow: 0 0 10px #dad2d2;
}

.top-search input {
    height: 37px;
    border: 0;
    flex: 1;
    position: relative;
    vertical-align: top;
    background-color: transparent;
    width: 230px;
        padding-left: 10px;
    padding-right: 10px;
}
.top-search button{
        position: absolute;
    width: 110px;
    height: 38px;
    margin-top: -1px;
    border-radius: 9px;
    /* padding: 13px 15px; */
    line-height: 14px;
    margin-left: 0px;
    font-size: 14px;
    font-weight: bold;
    background-color: #5d9d23;
    border: 0px;
    padding-left: 30px;
    background-image: url(../img/search-icon.svg);
    background-size: 20px;
    background-repeat: no-repeat;
    background-position: 12px 9px;
}

.top-search button:hover{color: #fff;
    background-color: #3f6a18;
    border-color: #3f6a18;}

body .top-search input:focus {
    border: 0;
    box-shadow: None;
}

body .top-search input::placeholder {
    color: #666;
    font-size: 12px;
}

.top-search-submit {
    border-left: 1px solid #ddd;
}

.top-search-submit .btn-group,
.btn-group-vertical {
    margin-top: -6px;
    margin-right: 1px;
}

.top-search-submit .btn {
    border-radius: 15px;
    border: 0;
}

.top-bar-flex {
    display: flex;
}

.top-bar-flex-1 {
    flex: 1;
}

.top-bar-flex-2 {
    flex: 1;
}

.sub-corner {
    height: 40px;
    background-color: #5d9d23;
}

.sub-corner-inner {
    height: 80px;
    background-color: #fff;
    margin-top: -40px;
    border-radius: 40px;
    margin-bottom: -40px;
}

.publications-info {
    margin-top: 10px;
    font-family: DM Sans;
    font-size: 40px;
    font-weight: 700;
    line-height: 45px;
}

.plists-item {
    display: flex;
    margin-bottom: 30px;
}

.plists-item-info {
    flex: 1;
}

.plists-item-info a:hover {
    color: #000;
}

.plists-item-img {
    width: 240px;
}

.plists-item-img img {
    border-radius: 10px;
    max-width: 100%;
    width: 100%;
    border: 1px solid #a1a4ad;
    padding: 3px;
    box-shadow: 0 0 5px #ddd;
}

.plists-item-info {
    margin-left: 30px;
}

.plii-title {
    margin-top: 20px;
    font-family: DM Sans;
    font-size: 26px;
    font-weight: 600;
    line-height: 33px;
    text-align: left;
}

.plii-title a:hover {
    color: #5d9d23;
}

.plii-info {
    margin-top: 25px;
    font-family: DM Sans;
    font-size: 20px;
    font-weight: 500;
    line-height: 30px;
    text-align: left;
}

.plii-info-title {
    margin-top: 25px;
    font-family: DM Sans;
    font-size: 18px;
    font-weight: 500;
    line-height: 30px;
    text-align: left;
    margin-bottom: 5px;
}

.plii-info-info {
    font-family: DM Sans;
    font-size: 14px;
    font-weight: 500;
    line-height: 32px;
    text-align: left;
}

.publications-list {
    margin-top: 30px;
}

.plii-info-more {
    color: #405FF2;
    text-align: right;
}

.plii-info-more :hover {
    color: #405FF2;
    text-align: right;
}

.pub-detail-title {
    margin-top: 20px;
    font-family: DM Sans;
    font-size: 28px;
    font-weight: 700;
    line-height: 40px;
    text-align: left;
    color: #050B20;
}

.pub-detail-info {
    margin-top: 30px;
}

.pub-detail-info ul li {
    font-family: DM Sans;
    font-size: 15px;
    font-weight: 400;
    line-height: 46px;
    text-align: left;
}

.pub-detail-item-title {
    font-size: 28px;
    margin-top: 30px;
}

.pub-detail-abs-info {
    margin-top: 30px;
    font-size: 15px;
    line-height: 28px;
}

.pub-detail-item-info .rrpi-img img {
    max-width: 150px;
}

.common-img {
    width: 100%;
    height: 100%;
    object-fit: cover;
    border-style: none;
}

.header-device-mobile {
    background-color: #5d9d23;
    color: #fff;
    border-bottom: 1px solid #7a829e;
}

.header-device-mobile i {
    color: #fff;
}

.header-device-mobile .fa-times {
    color: #000000;
}

.header-device-mobile a {
    color: #fff;
}

.header-device-mobile .mobile-navigation span {
    background-color: #fff;
}

.logo .navbar-brand {
    padding-top: 15px;
}

.searchform-wrap .submit {
    background-color: #5d9d23;
}

.product-item .button:hover,
input[type="text"]:focus,
input[type="number"]:focus,
input[type="search"]:focus,
input[type="email"]:focus,
input[type="password"]:focus,
input[type="tel"]:focus,
input[type="url"]:focus,
textarea:focus,
button:focus,
select:focus,
.sevice-box-content .sevice-button:hover,
.widget_filter_size li.active,
.widget_filter_size li:hover,
.shoppingcart-content .control-cart .button:hover,
.checkout-wrapp .button:hover,
.checkout-wrapp .group-button-payment .btn-credit-card,
.payment-method-wrapp .button-control .btn-pay-now,
.end-checkout .button,
.btn-zoom.open_qv:hover,
.attribute_size .list-size a.active,
.attribute_size .list-size a:hover,
.shopcart-description .actions .button-viewcart:hover,
.emeriss-tabs .tab-link li.active a,
.product-item.style-6 .loop-form-add-to-cart .button,
.slider-item .slider-infor .button:hover {
    border: 1px solid #ddd;
}

.button.press-effect {
    background-color: #5d9d23;
}

.button.press-effect:hover {
    background-color: #5d9d23;
    box-shadow: 0 0.25em 0.25em #5d9d23
}

.detail-section-link a {
    color: #000;
}

.detail-section-link a:hover {
    color: #5d9d23;
}

.footer-siteinfo a {
    color: #fff;
}

.navbar-header a {
    color: #fff;
    font-family: Bebas Neue;
    font-size: 28px;
    font-weight: 400;
    letter-spacing: 0.05em;
}

.list-products .single_add_to_cart_button {
    width: 100%;
    border-radius: 8px;
}

.product-item .product-info.float-left {
    text-align: left;
}

.product-item .product-inner {
    border: 1px solid #e1e1e1;
    border-radius: 6px;
    box-shadow: 0 0 2px #ddd;
}

.product-item .product-inner:hover {
    border: 1px solid #e1e1e1;
    border-radius: 6px;
    box-shadow: 0 0 5px #ddd;
}

.product-item:hover .product-inner {
    border: 1px solid #e1e1e1;
    border-radius: 6px;
    box-shadow: 0 0 5px #ddd;
}

.emeriss-contact-fom .button-submit {
    border-radius: 8px;
}

.product-item .product-left-style {
    text-align: left;
}

.group-info {
    margin-top: 5px;
}

.owl-products .product-item .product-name {
    overflow: hidden;
    display: -webkit-box;
    -webkit-line-clamp: 2;
    -webkit-box-orient: vertical;
    text-overflow: ellipsis;
}

.product-info-left .text-in-stock {
    font-size: 22px;
    font-weight: 700;
    color: #007600;
    line-height: 41px;
    margin-top: 15px;
}

.dt-desc-p1-flex {
    display: flex;
}

.dt-desc-p1-flex span {
    display: inline-block;
    flex: 4;
    line-height: 22px;
}

.dt-desc-p1-flex .dt-desc-p1-title {
    flex: 1;
    font-weight: bold;
}

.details-infor .variations .text-attribute .dt-desc-p1-title {
    font-weight: 600;
}

.qa-header-info {}

.qa-header-info1 {
    font-size: 25px;
    margin-top: 40px;
}

.qa-header-info2 {
    font-size: 30px;
    margin-top: 15px;
    font-weight: bold;
}

.qa-procedure-body {
    margin-top: 30px;
}

.qa_question {
    font-size: 15px;
}

.qa_answer {
    margin-top: 8px;
    font-size: 13px;
    line-height: 22px;
    margin-bottom: 10px;
}

p a svg>path {
    fill: #5d9d23;
}

.reaction-procedure-body a svg>path {
    fill: #5d9d23
}
.publications-body .rrpi-img {
    width: 240px;
    justify-content: center;
    display: flex
}

.publications-body .rrpi-img img {
    max-width: 230px
}

.publications-body table {
    margin-bottom: 0;
}

.publications-body .retro-reaction-product-info-item {
    padding: 12px;
}

div#swal2-html-container {
    font-size: 16px;
}

.twitter-typeahead {
    width: 100%;
}

.tt-menu {
    background-color: #fff;
    border-radius: 20px;
    width: 100%;
    margin-top: 5px;
    padding: 15px 5px;
    box-shadow: 0 0 5px #ddd;
    min-width: 280px;
}

.tt-suggestion {
    line-height: 25px;
    padding: 5px 10px;
    color: #111;
    font-size: 16px;
    word-wrap: break-word;
}

.s-rs-line {
    border-bottom: 1px solid #ddd;
}

.left-side-menu {
    padding: 0;
    border-left: 1px solid #ddd;
    position: sticky;
    top: 5px;
    z-index: 10;
    margin-top: 5px;
    overflow-y: auto;
    max-height: calc(100vh - 10px);
}

.left-side-menu ul {
    list-style: none;
    margin: 0;
    padding: 0;
}

.left-side-menu ul li {
    list-style: none;
    padding: 0;
    float: none;
}

.left-side-menu ul .active {
    border-left: 1px solid #5d9d23;
}

.left-side-menu ul .active a {
    color: #5d9d23;
}

.left-side-menu ul li a {
    color: #050B20;
    text-decoration: none;
    font-size: 15px;
    padding-left: 15px;
    display: -webkit-box;
    -webkit-line-clamp: 2;
    -webkit-box-orient: vertical;
    overflow: hidden;
    text-overflow: ellipsis;
    margin-top: 20px;
    margin-bottom: 20px;
    padding-top: 0;
    padding-bottom: 0;
}

.table-recommend-title td {
    font-size: 14px;
}

.table-recommend-title td span {
    display: inline-block;
}

.table-recommend-title td a {
    padding-left: 5px;
    padding-right: 5px;
}

.custom-collapse.collapsing {
    height: auto;
    transition: height 0.35s ease;
    overflow: hidden;
}

.custom-collapse.collapse {
    height: 30px;
    overflow: hidden;
}

.custom-collapse.collapse.in {
    height: auto;
}

.table-recommend-title .collapse {
    display: block;
    min-height: 30px !important;
}

.properties-tables table {
    margin-top: 10px;
}

.reaction-procedure .detail-section-item-title {
    color: #5d9d23;
}

.reaction-procedure .detail-section-item-title span {
    padding-bottom: 5px;
    border-bottom: 2px solid #5d9d23;
    padding-right: 3px;
    padding-left: 2px;
}

.h3-block {
    border: 1px solid #ddd;
    padding: 20px;
    border-radius: 10px;
    z-index: 666;
    margin: 20px 0;
}

.h3-block:hover {
    box-shadow: 0 0 15px #0000001a;
}

.h3-block h3 {
    margin: 0 0 20px;
}

.h4-block {
    margin: 5px 0 20px;
    padding: 15px;
    background-color: rgb(249 250 251);
    border-radius: 10px;
}

.h4-block h4 {
    margin: 0 0 15px;
}

p.p_li {
    position: relative;
    padding-left: 1.2em;
    margin: 0.5em 0;
}

p.p_li::before {
    position: absolute;
    left: 0;
    top: 0;
    color: black;
    font-size: 1em;
    line-height: 1.4;
}

.links-more {
    display: inline-block;
    position: relative;
}

.links-items {
    display: none;
    position: absolute;
    top: 100%;
    left: 0;
    background-color: #e1e1f9;
    padding: 10px;
    border: 1px solid #ddd;
    border-radius: 5px;
    white-space: nowrap;
    box-shadow: 0 5px 8px rgb(18 14 14 / 15%);
    z-index: 100;
}

.links-items .link-item {
    display: block;
}

.links-more:hover .links-items {
    display: block;
}

.links-more svg>path {
    fill: #5d9d23;
}

.fast-inquiry {
    width: 50px;
    height: 50px;
    font-size: 24px;
    font-weight: 700;
    background: #4261f2;
    color: #fff;
    border-radius: 50%;
    position: fixed;
    bottom: 150px;
    right: 25px;
    text-align: center;
    z-index: 999;
}

.fast-inquiry svg {
    width: 30px !important;
    height: 30px !important;
    color: #fff;
    margin-top: 9px;
    display: inline-block;
}

.fast-inquiry span {
    display: inline-block;
    color: #4261f2;
    font-size: 15px;
    font-weight: bold;
    margin-top: 5px;
}

.qc-data-item {
    border: 1px solid #5d9d23;
    font-size: 13px;
    padding: 1px 5px;
    border-radius: 12px;
    cursor: pointer;
    display: inline-block;
    /*font-weight: bold;*/
    color: #212121;
    padding-bottom: 2px;
    margin-bottom: 3px;
}

.qc-data-item:hover {
    background-color: #405FF2;
    color: #fff;
}

.qc-data-item svg {
    width: 16px;
    height: 16px;
    color: #ddd;
    vertical-align: middle;
    line-height: 20px;
}

.qc-data-item:hover svg path {
    fill: #fff;
}

.p_bottle_img {
    max-height: 328px;
    display: block;
    transition: transform 0.25s ease;
}

.image-preview-container {
    border-radius: 12px;
    overflow: hidden;
    transition: transform 0.25s ease, box-shadow 0.25s ease;
    transform-origin: center;
}

.image-preview-container:hover {
    /*transform: translateY(-6px) scale(1.01); !* 涓婃诞骞跺井鏀惧ぇ *!*/
    /*box-shadow: 0 20px 40px rgba(0,0,0,0.18);*/
}

.image-preview-container:hover img {
    transform: scale(1.02);
}

.structures-tools {
    background-color: #f5f5f5;
    padding: 10px;
    padding-left: 5px;
}

.structures-tools-info {
    text-align: left;
}

.structures-tools-body {
    height: 360px;
    display: flex;
    justify-content: center;
    align-items: flex-start;
}

.structures-tools-body .row {
    width: 100%;
}

.control-button {
    width: 30px;
    height: 30px;
    border: 1px solid #d0d7e6;
    background: #fff;
    cursor: pointer;
    transition: transform .08s ease;
    color: #a1a1a1;
    font-size: 22px;
    padding: 0;
    margin: 0;
    font-weight: 100;
    margin-bottom: 5px;
}

.control-button svg {
    width: 16px;
}

.control-button:active {
    transform: scale(.98);
}

.control-button:disabled {
    opacity: .45;
    cursor: not-allowed;
}

.structure-control-image {
    width: 250px;
    height: 250px;
    object-fit: contain;
    transition: width .16s ease, height .16s ease;
    display: block;
}

#control-image-area {
    display: flex;
    align-items: center;
    justify-content: center;
    position: relative;
    height: 360px;
}

.structure-tools-info,
.structure-tools-type {
    font-size: 12px;
}

.product-content-details .structure-sub-title {
    margin: 0;
}

.structure-main .h3-block {
    margin: 10px 0 20px;
}

.bottle-help-text {
    position: absolute;
    bottom: -10px;
    font-size: 13px;
    color: #007600;
    width: 100%;
    right: 10px;
    text-align: right;
}

.Pictograms img{
    width: 80px;
    margin-right: 15px;
}

.downloadBtn{
    width: 150px;
    height: 35px;
    background: #FFFFFF;
    line-height: 20px;
    border-radius: 5px;
    color: #5d9d23;
    border: 1px solid #5d9d23;
    background: url(../img/sds.svg);
    background-repeat: no-repeat;
    background-position: 5px;
    padding-left: 25px;
    margin-right: 15px;
    margin-bottom: 15px;
}
.downloadBtn:hover{
    border: 1px solid #3f6a18;
}

.quoteBtn{
    width: 100%;
    height: 35px;
    background: #FFFFFF;
    line-height: 20px;
    border-radius: 5px;
    color: #5d9d23;
    border: 1px solid #5d9d23;
    background: url(../img/quote.svg);
    background-repeat: no-repeat;
    background-position: 5px;
    background-size: 25px;

}
.quoteBtn:hover{
    border: 1px solid #3f6a18;
    font-size: 1.4rem;
}

.downloadNotion{
    position: absolute;
    font-size: 12px;
    margin-top: -30px;
    color: #6f6a6a;
}

.route{
    width: 100%;
    height: auto;
    margin-left: -25px;
    /* border:1px solid red */
}
.route li{
    width: 95%;
    min-height: 165px;
    list-style: none;
    text-align: center;
    display: flow-root;
    /* border: 1px solid blue; */
}
.route li h4{
    text-align: left;
    margin-top: 0px;
    padding-left: 5px;
}
.routeProduct{
    width: 110px;
    height: 130px;
    float: left
}
.routeProduct img {
    width: 100px;
    border-radius: 5px;
    border: 1px solid #cccccc;
    background: #ffffff;
}
.routeProduct b {
    display: block;
    color: #8f8f8f;
    font-size: 12px;
    text-align: center;
    cursor: pointer;
}
.arrow {
    width: 50px;
    height: 50px;
    float: left;
    margin-top: 35px;
}
.plus{
    width: 50px;
    height: 50px;
    float: left;
    margin-top: 35px;
}
.plus img{
    width: 30px;
}
.arrow img {
    width: 30px;
}

.routecontainer{
    background-image: radial-gradient(#e9ebf0 10%, transparent 0);
    background-size: 15px 15px;
}

.smilesRate{
    font-size: 12px;
    font-weight: 100;
    color: #8f8f8f;
}

.RetrosynthesisBtn{
   width: 250px;
    height: 26px;
    background: #FFFFFF;
    line-height: 13px;
    border-radius: 5px;
    color: #5d9d23;
    border: 1px solid #5d9d23;
    background: url(../img/reaction.svg);
    background-repeat: no-repeat;
    background-position: 4px;
    padding-left: 26px;
    background-size: 20px;
}

.changeContainer .RetrosynthesisBtn{
    display: none;
}

ul.route li:hover .RetrosynthesisBtn {
  display: block; /* 关键：hover时切换为显示状态 */
}
ul.route li:hover h4 {
  color: #5d9523;
}

/* SDS */
.sdsInput{
    border: 2px solid #5d9d23;
    border-radius: 5px;
    display: block;
    width: 100%;
    height: 34px;
    padding: 6px 12px;
    font-size: 14px;
    line-height: 1.42857143;
    color: #555;
    background-color: #fff;
    background-image: none;
    -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
    box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
    -webkit-transition: border-color 
ease-in-out .15s, -webkit-box-shadow 
ease-in-out .15s;
    -o-transition: border-color ease-in-out .15s,box-shadow ease-in-out .15s;
    transition: border-color 
ease-in-out .15s, box-shadow 
ease-in-out .15s;
}

.SDSNotice{
    width: 100%;
    /* height: 76px; */
    /* border: 1px solid #5d9d23; */
    background: #5d9d23;
    color: #ffffff;
    padding: 10px;
    border-radius: 5px;
}

.SdsList{
    width: 100%;
    max-width: 100%;
    margin-bottom: 20px;
    border: 1px solid #f3f3f3;
    border-collapse: collapse;
    border-spacing: 0;
    table-layout: auto;
}
.SdsList td{
    border: 1px solid #f3f3f3;
}
.SdsList thead tr td{
    font-weight: bolder;
}

.sds-search input{
    background: url(../img/search.svg);
    background-repeat: no-repeat;
    background-size: 20px;
    background-position: 5px;
    padding-left: 30px;
    padding-right: 120px;
}

.sds-search button{
    width: 100px;
    height: 35px;
    /* line-height: 0px; */
    border-radius: 5px;
    padding: 0px;
    position: absolute;
    margin-top: -35px;
    right: 15px;
    background-color: #5d9d23;
    border: 0;
    font-weight: bolder;
}

.sds-search{
    padding-bottom: 20px;
}
.sds-search span{
    font-size: 18px;
    color: #5d9d23;
    font-weight: bolder;
}


.SpectrumsBtn img{
    width: 50px;
}
.SpectrumsBtn span{
    font-weight: bolder;
    color: #5d9d23;
    display: block;
    position: absolute;
    margin-top: -39px;
    margin-left: 50px;
    line-height: 18px;
}
.SpectrumsBtn span:hover{
    color: #3f6a18;
}


.routePlan{
    min-height: 500px;
    border: 1px solid #ddd;
    padding: 20px;
    border-radius: 10px;
    z-index: 666;
    margin: 20px 0;
}

.routeTitle{
    padding-bottom: 5px;
    border-bottom: 2px solid #5d9d23;
    padding-right: 3px;
    padding-left: 2px;
    color: #5d9d23;
    font-weight: bolder;
}


.changeContainer{
    width: 100%;
    height: 100%;
    background-color: #5d9d23C7;
    position: fixed;
    top: 0;
    left: 0;
    z-index: 999;
    display: none;
}

.changeRoute{
    width: 850px;
    height: 600px;
    background: #ffffff;
    border-radius: 5px;
    position: fixed;
    left: 50%;
    margin-left: -425px;
    top: 50%;
    margin-top: -300px;
    background-image: radial-gradient(#e9ebf0 10%, transparent 0);
    background-size: 15px 15px;
    padding: 20px;
    overflow: auto;
    overflow-x: hidden;
}

.changeRouteTitle{
    border-bottom: 2px solid #5d9d23;
    font-weight: bolder;
    margin-left: -5px;
}

.changeRoute .route{
    padding-top: 20px;
    width: 815px;
    
}
.routeRef{
    padding-left: 5px;
    font-size: 1.3rem;
    font-weight: lighter;
    display: block;
    width: 580px;
    height:18px;
    text-align: left;
    position: absolute;
    margin-top: 140px;
    color: #8f8f8f;
    overflow: hidden;
    white-space: nowrap;
    text-overflow: ellipsis
}
.routePlan .routeRef{
    width: 100%;
}
.RouteLoading{
    text-align: center;
    padding-top: 200px;
}
.changeContainer .RetrosynthesisBtn{
       width: 169px;
    position: absolute;
    /* bottom: 5px; */
    right: 66px;
    margin-top: 114px;
}

.changeRoute ul li:hover{
    border-bottom:2px solid #5d9d23;
    border-top:2px solid #5d9d23;
    /* border-radius: 5px; */
}

.closeBtn{
    position: fixed;
    width: 30px;
    height: 30px;
    left: 50%;
    top: 50%;
    margin-left: 415px;
    margin-top: -324px;
}

.modifyReaction{
    color: #5D9D23;
    cursor: pointer;
    font-size: 12px;
    padding-left: 10px;
}

.changeRouteProduct{
    margin-top: 30px;
}
.changeRouteProduct li{
    width: 150px;
    height: 160px;
    list-style: none;
    
}
.changeRouteProduct li:hover{
border: 0px!important;
cursor: pointer;
}

.changeRouteProduct li img:hover{
    border:2px solid #5d9d23;
}

.btnPage{
    line-height: 35px;
}
.btnPage a{
    border: 1px solid #5d9d23;
    padding: 5px;
    border-radius: 5px;
}
.btnPage a:hover{
    border: 2px solid #5d9d23;
}

.applicationsList li {
    padding-top: 5px;
}

.TB_milestone tr td{
    font-size: 14px;
}

.TB_milestone thead{
    background: #ffffff;
}


.TB_milestone thead th{
    font-weight: bolder;
}

.TB_milestone tr{
    border-bottom: 1px solid #f3f3f3;;
}

.skuInfoTB thead{
    background-color: #f4f4f4;
    border-radius:5px
}
.skuInfoTB tbody tr{
    border-bottom: 1px solid #f3f3f3;
}
.skuInfoTB tbody tr:hover{
    border-bottom: 1px solid #5d9d23;
    cursor: pointer;
}
.skuInfoTB tbody tr input{
    text-align: center;
}
.cartInfo button{
    width: 200px;
    height: 35px;
    background: #FFFFFF;
    line-height: 20px;
    border-radius: 5px;
    background-image: url('../img/cart.svg');
    background-size: 18px;
    background-repeat: no-repeat;
    color: #5d9d23;
    border: 1px solid #5d9d23;
    background-position: 9px 9px;
}

.cartInfo span{
    color: #5d9d23;
    font-weight: bolder;
    margin-right: 20px;
}

.downloadCoaTB input{
    width:220px;
}
.downloadCoaTB span{
    font-size: 12px;
    color: #9c9c9c;
}

.shopcart-icon{
    background:url('../img/cart.svg');
     background-size: 28px;
     background-position: 1px 7px;
    background-repeat: no-repeat;
}

.cartDV{
    width: 100%;
    height: 100%;
    background: rgba(0, 0, 0, 0.5);
    position: fixed;
    top: 0px;
    z-index: 9999;
    display: none;
}

.cartDV .right {
    position: absolute;
    right: 400px;
    top: 0;
    width: 400px;
    height: 100%;
    background: #fff;
    transform: translateX(100%);     /* 默认隐藏在右侧 */
    transition: transform 0.3s ease;
    box-shadow: rgba(0, 0, 0, 0) 0px 8px 10px -5px, rgba(0, 0, 0, 0.14) 0px 16px 24px 2px, rgba(0, 0, 0, 0.12) 0px 6px 30px 5px;
}

.cartDV.active .right {
    transform: translateX(0);        /* 显示时滑入 */
}

.cartDV .right .title{
    display: flex;
    -webkit-box-pack: justify;
    justify-content: space-between;
    padding: 16px;
    border-bottom: 1px solid #bababa;
    font-size: 20px;
    font-weight: 700;
    line-height: normal;
    text-transform: inherit;
    letter-spacing: -0.22px;
    color: #000000;
}

.cartDV .right .title img{
    position: absolute;
    width: 22px;
    right: 15px;
    cursor: pointer;
    z-index: 999999;
}

.cartDV .right .footerrt{
    flex-shrink: 0;
    padding: 20px 16px 16px;
    box-shadow: rgba(50, 50, 50, 0.75) -1px 0px 7px;
    width: 100%;
    position: absolute;
    bottom: 0px;
    height: 150px;
    background: #fff;
}
.cartDV .right .cartList{
    /* border:1px solid red; */
    width: 100%;
    height: 100%;
    overflow: auto;
}
.cartDV .right .cartList ul {
    padding-bottom: 300px;
}
.cartDV .right .cartList ul li{
    border-bottom:1px solid #bababa;
    height: 150px;
    list-style: none;
    margin-left: -18px;
}
.cartDV .right .cartList ul li img{
    width: 60px;
    height: 60px;
    border: 1px solid #bababa;
    margin-top: 10px;
    margin-left: 10px;
    border-radius: 5px;
}
.cartDV .right .cartList ul li .cartContent{
    width: 300px;
    /* position: absolute; */
    /* border: 1px solid red; */
    height: 130px;
    margin-left: 80px;
    margin-top: -60px;
}
.cartDV .right .cartList ul li .cartContent span{
    display: block;
}
.cartDV .right .cartList ul li .cartContent .skuInfo{
    color: #5d9d23;
    font-weight: bolder;
}
.cartDV .right .cartList ul li .cartContent .titleInfo{
    font-weight: 700;
    white-space: nowrap;
    overflow: hidden;
    text-overflow: ellipsis;
}
.cartDV .right .cartList ul li .cartContent .stockInfo{
   background-image: url(../img/gou.svg);
    background-size: 14px;
    background-repeat: no-repeat;
    padding-left: 18px;
    font-size: 12px;
    color: #5e5e5e;
    background-position: 1px 5px;
}
.cartDV .right .cartList ul li .cartContent .quantity{
   width: 50px;
    border-radius: 5px;
    text-align: center;
    border: 1px solid #bababa;
}
.cartDV .right .cartList ul li .cartContent .unitPrice{
    margin-top: 5px;
    font-weight: 700;
}
.cartDV .right .cartList ul li .cartContent .remove{
    width: 20px;
    height: 20px;
    border: 0px;
    margin-top: -280px;
    margin-left: 280px;
    cursor: pointer;
}
.cartDV .right .cartList ul li .cartContent .subTotal{
    font-weight: 700;
    /* position: absolute; */
    margin-top: -20px;
    margin-left: 227px;
}
.cartDV .right .footerrt .estimatedTotal{
    display: flex;
    -webkit-box-pack: justify;
    justify-content: space-between;
    -webkit-box-align: center;
    align-items: center;
    font-weight: 700;
    font-size: 16px;
}
.cartDV .right .footerrt .estimatedTotal p{
    margin-bottom: 0px;
}
.cartDV .right .footerrt .subTitle{
    color: rgb(148, 148, 148);
    /* font-size: 0.75rem; */
    margin-top: -10px;
    font-size: 10px;
    border-bottom: 1px solid #9d9d9d;
}
.cartDV .right .footerrt button{
    width: 100%;
    margin-top: 10px;
    border-radius: 5px;
}
.shopcart-icon{
    cursor: pointer;
}

.NotificationInformation{
    display: none;
    min-width: 300px;
    height: 50px;
    padding-left: 50px;
    padding-right: 20px;
    background-color: #5d9d23;
    border: 1px solid #fff;
    position: fixed;
    border-radius: 5px;
    right: 30px;
    top: 200px;
    /* margin-left: -150px; */
    color: #ffffff;
    font-size: 18px;
    text-align: center;
    line-height: 50px;
    box-shadow: rgba(50, 50, 50, 0.75) -1px 0px 7px;
    background-image: url("../img/tongzhi.svg");
    background-repeat: no-repeat;
    background-size: 30px;
    background-position: 10px;
}

.menu-page-new-title{
        font-size: 22px;
    font-weight: bold;
    color: #050B20;
    padding: 17px;
}

.header-nav-new-menus{
    width: 100%;
}
.header-nav-new-menus-research {
    margin-top: 0;
}
.nav-page-item ul li {
    list-style: none;
    border-bottom: 1px solid #ddd;
    padding-bottom: 10px;
    min-height: 47px;
}

.header-nav-new-menus li {
        line-height: 18px;
    margin-top: 30px;
}

.promotionAD{
    width: 100%;
    padding: 0px 1rem 17px 10px;
}
.promotionAD img{
    border: 1px solid red;
    border-radius: 5px;
}
.registerInfo {
    padding-bottom: 200px;
}
.registerInfo input,.changePassword input{
    position: absolute;
    width: 70%;
    left: 15px;
    top: 23px;
    flex: 1;
    vertical-align: top;
    background-color: transparent;
    border: 2px solid #d1d1d1;
    height: 40px;
    line-height: 40px;
    background-color: #fff;
    border-radius: 5px;
    box-shadow: 0 0 5px #ddd;
    padding: 5px 10px;
}

.registerInfo button,.changePassword button{
    border-radius: 5px;
}

.registerInfo .row,.changePassword .row{
    padding-bottom: 60px;
}

.loginInfo{
    height: 500px;
    background-color: rgb(255, 255, 255);
    color: rgb(0, 0, 0);
    box-shadow: rgba(0, 0, 0, 0) 0px 2px 4px -1px, rgba(0, 0, 0, 0.14) 0px 4px 5px 0px, rgba(0, 0, 0, 0.12) 0px 1px 10px 0px;
    transition: box-shadow 300ms cubic-bezier(0.4, 0, 0.2, 1);
    border-radius: 5px;
    padding: 30px;
}
.loginInfo h2{
    font-size: 23px;
}

.loginInfo input{
    position: absolute;
    width: 100%;
    top: 26px;
    left: 0px;
    vertical-align: top;
    background-color: transparent;
    border: 2px solid #d1d1d1;
    height: 40px;
    line-height: 40px;
    background-color: #fff;
    border-radius: 5px;
    box-shadow: 0 0 5px #ddd;
    padding: 5px 10px;
}

.loginInfo .row{
   padding-top: 30px;
    padding-bottom: 20px;
}

.loginInfo label{
    font-size: 13px;

}

.loginInfo span{
    display: block;
    margin-top: 50px;
    text-align: right;
    width: 100%;
    position: absolute;
    right: 0px;
    cursor: pointer;
    font-weight: 700;
}

.loginInfo button{
        width: 100%;
    position: absolute;
    left: 0px;
    border-radius: 5px;
    margin-top: 36px;
}
.signInRight img{
    height: 500px;;
    object-fit: cover;
    object-position: center;   
    box-shadow: rgba(0, 0, 0, 0) 0px 2px 4px -1px, rgba(0, 0, 0, 0.14) 0px 4px 5px 0px, rgba(0, 0, 0, 0.12) 0px 1px 10px 0px;
    transition: box-shadow 300ms cubic-bezier(0.4, 0, 0.2, 1);
    border-radius: 5px;
}

.signIco{
     position: absolute;
    /* border: 1px solid red; */
    height: 40px;
    width: 100px;
    margin-left: -100px;
    margin-top: 10px;
    line-height: 46px;
    font-size: 18px;
    font-weight: 700;
    color: #5d9d23;
    padding-left: 42px;
    background-image: url(../img/login.svg);
    background-repeat: no-repeat;
    background-size: 35px;
    background-position: 4px 3px;
}
.signIco:hover{
    font-size: 19px;
}
.cartStep img{
    border-radius: 5px;
    /* box-shadow: rgba(0, 0, 0, 0) 0px 2px 4px -1px, rgba(0, 0, 0, 0.14) 0px 4px 5px 0px, rgba(0, 0, 0, 0.12) 0px 1px 10px 0px; */
    /* transition: box-shadow 300ms cubic-bezier(0.4, 0, 0.2, 1); */

}
.cartTB,.orderTB{
    margin-top: 5px;
    border: 1px solid #f3f3f3;
}
.cartTB thead,.orderTB thead{
    font-weight: bold;
}
.cartTB .Structure,.orderTB .Structure,.rightCT .Structure{
    width: 60px;
    height: 60px;
    border: 1px solid #bababa;
    border-radius: 5px;
}
.cartTB tbody tr,.orderTB tbody tr ,.rightCT tbody tr{
    border-bottom: 1px solid #f3f3f3;
    cursor: pointer;
    background-color: #fff;
}
.cartTB tbody tr:hover,.rightCT tbody tr:hover{
    border-bottom: 1px solid #5d9d23;

}


.cartTB tbody .remove{
    width: 30px;
    height: 30px;
    border: 0px;
    cursor: pointer;
}
.cartTB button,.orderTB button{
    width: 100%;
    border-radius: 5px;
}

.orderConfirm h2{
    padding-bottom: 5px;
    border-bottom: 2px solid #5d9d23;
    padding-right: 3px;
    padding-left: 2px;
    padding-top: 30PX;
}
.orderConfirm .selectAddress li{
    width: 100%;
    height: 45px;
    /* border: 1px solid red; */
    list-style: none;
    margin-left: -15px;
    line-height: 50px;
}
.orderConfirm .selectAddress li input[type='radio']{
    transform: scale(1.5);
}
.orderConfirm .selectAddress li span{
    padding-left: 7px;
    overflow: hidden;
    text-overflow: ellipsis;
    position: absolute;
    height: 40px;
    width: 80%;
    margin-top: -2px;
}
.orderConfirm .selectAddress li .editAddress{
    width: 30px;
    margin-top: 4px;
    position: absolute;
    right: 10px;
    display: none;
    cursor: pointer;

}
.orderConfirm .newAddress{
    padding-top: 20px;
    padding-left: 0px;
    display: none;
}

.orderConfirm .newAddress .lb{
   font-weight: 700;
    display: inline-block;
    width: 100%;
    padding-top: 20px;
    line-height: 10px;
}
.orderConfirm .newAddress .lb label{
    font-size: 10px;
    color: #8e8e8e;
    padding-left: 10px;
}

.orderConfirm .newAddressinput,.orderConfirm .newAddress select{
    width: 100%;
    background-color: transparent;
    border: 2px solid #d1d1d1;
    height: 40px;
    line-height: 40px;
    background-color: #fff;
    border-radius: 5px;
    box-shadow: 0 0 5px #ddd;
    padding: 5px 10px;
}

.newAddressBtn{
    border-radius: 5px;
    margin-top: 10px;
}

.TotalPrice{
    font-size: 18px;
}

input[name='order_ExternalNotes']{
       height: 30px;
    border: 1px solid #707070;
    /* flex: 1; */
    /* position: relative; */
    /* vertical-align: top; */
    background-color: transparent;
    width: 100%;
    padding-left: 10px;
    padding-right: 10px;
    border-radius: 5px;
}

.orderSubmitted{
    text-align: center;
}
.orderSubmitted h2{
    padding-top: 20px;
    font-size: 20px;
}
.orderSubmitted img{
    width: 100px;
    padding-top: 20px;
}

.SideNavigation{
    width: 100%;
    background-color: rgb(255, 255, 255);
    color: rgb(0, 0, 0);
    box-shadow: rgba(0, 0, 0, 0) 0px 2px 4px -1px, rgba(0, 0, 0, 0.14) 0px 4px 5px 0px, rgba(0, 0, 0, 0.12) 0px 1px 10px 0px;
    transition: box-shadow 300ms cubic-bezier(0.4, 0, 0.2, 1);
    border-radius: 5px;
    overflow: hidden;
    /* padding: 30px; */
}
.SideNavigation li{
    list-style: none;
    height: 40px;
    /* padding: 20px 10px; */
    border-bottom: 1px solid #c7c7c7;
    margin-left: -17px;
    line-height: 20px;
    padding-left: 40px;
    padding-right: 20px;
    padding-top: 10px;
    padding-bottom: 10px;
}
.SideNavigation li:hover{
    font-weight: 700;
}

.SideNavigation .title{
        background: #5d9d23;
    color: #fff;
    font-weight: 700;
    padding-left: 20px;
}
.rightCT{
    width: 100%;
    min-height: 500px;
    background-color: rgb(255, 255, 255);
    color: rgb(0, 0, 0);
    box-shadow: rgba(0, 0, 0, 0) 0px 2px 4px -1px, rgba(0, 0, 0, 0.14) 0px 4px 5px 0px, rgba(0, 0, 0, 0.12) 0px 1px 10px 0px;
    transition: box-shadow 300ms cubic-bezier(0.4, 0, 0.2, 1);
    border-radius: 5px;

}

.rightCT table tbody tr button{
    border-radius: 5px;
    padding: 5px 10px;
    font-weight: 100;
}
.rightCT table tbody tr button:hover{
    font-weight: 700;
}

.CancelOrderBtn{
    padding: 5px;
    margin-left: 20px;
    border-radius: 5px;
}
.Cancelled{
    color: red;
}

.kefusm img{
    width: 33px;
    position: absolute;
}

.kefusm b{
       font-weight: 100;
    display: block;
    width: 100%;
    line-height: 15px;
    padding-left: 36px;
    color: #797979;
    font-size: 12px;
}